science ap chemistry

What is the equilibrium expression for the following acid dissociation reaction?
CH3COOH + H2O CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

  1. 0
  2. 7
asked by jessie

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.
  2. Chem

    Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O CH3COOH + OH- Now, using the above formulas, I have to
  3. chemistry

    A student prepared a .10M solution of acidic acid. Acidic acid has a Ka of 1.75 x 10-3. What are the hydronium ion concentration and the PH of the solution? I think the PH is 1.76 because I hit -log(1.75 x 10-3) on my calculator
  4. chemistry

    A reaction mixture is in a 5.4 L flask at 25 oC initially contains only 7.64 grams of acetic acid. (CH3COOH). Set up your I.C.E. table and use it to answer the following questions. HINT: You will need to look up the Ka for this
  5. Chemistry

    25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH. my work CH3COOH + H2O H3O^+ + CH3COO^- 25mL x 0.100 mmol/ml = 2.5mmol CH3COOH 27mL x
  6. Chemistry

    6. Which of the following chemical reactions is most likely to have the largest equilibrium constant K? CH3COO- (aq) + H2O(l) = CH3COOH(aq) + OH-(aq) HCl(aq) + H2O(l) = H3O+(aq) + Cl-(aq) CH3COOH(aq) + H2O(l) = CH3COO- (aq) +
  7. Chemistry 102

    For a question like “calculate the pH of an aq.solution that is 1.0 M CH3COOH and 1.0 M CH3COONa, how do you know to write the equation like this: CH3COOH + H2O => H3O+ + CH3COO- and not like H3O+ + CH3COO- => CH3COOH + H2O for
  8. Chemistry

    This is a question I am presently doing right now which I found in my homework. I am quite sure that in (a) I have to use the Hasselbach equation though I am not sure how to work it out. If anyone knows any of the answers, and how
  9. Chemistry

    This is a question I am presently doing right now which I found in my homework. I am quite sure that in (a) I have to use the Hasselbach equation though I am not sure how to work it out. If anyone knows any of the answers, and how
  10. CHEMISTRY LAB urgent assistance

    1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH) Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this relationship show that pH = pKa + log [base]\[acid] urgently need assistance

More Similar Questions