chemistry

What is the equilibrium expression for the following acid dissociation reaction?
CH3COOH + H2O CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]

B. [CH3COOH][H2O]/[CH3COO-][H3O+]

C. [CH3COOH]/[CH3COO-][H3O-]

D. [CH3COO-][H3O+]/[CH3COOH]

  1. 👍
  2. 👎
  3. 👁
  1. You need to indicate your thoughts on these. What do you the answers are and why. For example, this looks straight forward to me; i.e., you just plug in the definition.

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    what is the 1. chemical equation 2. complete ionic equation 3. net ionic equation include phase of HCH3COO+NaHCO3 pls correct my answers 1. CH3COOH(aq)+NaHCO3(aq)+CH3COONa(aq)+H2O(l)+CO2(g) 2.

  2. Chemistry

    For the reaction CH3COOH- CH3COO + H+, which of the following statements is true? CH3COO- is an Arrhenius base. CH3COO- is a conjugate CH3COOH- is a Brønsted-Lowry acid.

  3. Chemistry

    Ethanoic acid can be reacted with alcohols to form esters, an equilibrium mixture being formed. CH3CO2H + ROH CH3CO2R + H2O The reaction is usually carried out in the presence of an acid catalyst. In an experiment to determine Kc

  4. chemistry

    The equilibrium constant of the reaction CH3COOH (l)+C2H5OH (l)=CH3COOC2H5+H2O is 4.if one mole of each of acetic acid and ethyl alcohol are heated in presence of little concentrated H2SO4 at equilibrium the amount of ester

  1. Chemistry

    In the equilibrium system CH3COOH(aq) + H2O(l) —> — H3O+ CH3COO-(aq) .

  2. Chemistry 12

    9. According to Arrhenius, which of the following groups contain: i)only acids ii)only bases a. NaOH, H2CO3, KCl b. MgCl2, H2SO4, HCl c. HNO3, HCl, H3PO4 d. Mg(OH)2, AgBr, HF e. KOH, NH4OH, Ba(OH)2 10. Enough water is added to 100

  3. chemistry

    Which of the following chemical reactions represents a neutralization reaction? A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl C. NH3 + H2O NH4++ OH- D. CH3COOH + H2O CH3COO- + H3O+

  4. Chemistry Help Please!!!

    Find Net Ionic equation for hydrolysis , Expression for equilibrium constant (Ka or Kb) and Value of (Ka or Kb) Net Ionic equations I've got NaC2H3O2 == CH3COO^-+H2O -->CH3COOH+OH^- Na2CO3 ==== CO3 + 2H2O → H2CO3 + 2-OH Kb =

  1. Chemistry

    Acetic acid ionizes in water as follows: CH3COOH + H2O CH3COO– + H3O+ Fewer than 1% of ethanoic acid molecules are ionized at any instant. The acetate ion (CH3COO– ) is therefore ____. A.a poor hydrogen-ion acceptor B.a good

  2. Chemistry

    Write the acid-dissociation reaction of nitrous acid (HNO2) and its acidity constant expression.

  3. Chemistry

    Write the dissociation reaction and the corresponding Ka equilibrium expression for each of the following acids in water. (Use the lowest possible coefficients. Include states-of-matter under SATP conditions in your answer. Omit

  4. Chemistry

    Acetic acid ionizes in water as follows: CH3COOH + H2O --> CH3COO– + H3O+

You can view more similar questions or ask a new question.