Compound 1 / Compound 2
/ O
"
CH2 = CH - CH - OH + CH3 - CH - CH2 - C
' ' '
CH3 CH3 OH
i) Identify any functional groups in Compounds 1 and 2 and name them.
ii) Complete the equation for reaction 1 by drawing the abbreviated structural formula(e) of the products of this reaction. Identify any new functional groups it the organic products, name them??
iii) state the type of reaction that has occurred and explain in one sentence how you arrived at the answer
Drawing structural formulas on the computer is almost impossible.
i) To identify the functional groups in Compounds 1 and 2, we need to analyze the given structures.
Compound 1:
- CH2=CH-CH-OH: This compound contains an alkene (CH2=CH-), which is a carbon-carbon double bond, and an alcohol (OH) functional group.
Compound 2:
- CH3-CH-CH2-C(OH)(CH3)(CH3): This compound contains a ketone (C=O) and an alcohol (OH) functional group.
ii) To complete the equation for reaction 1, we need to know what the reactants were and the conditions under which the reaction was carried out. Without this information, it is difficult to draw the structural formulae of the products and identify new functional groups.
iii) The type of reaction that has occurred cannot be determined without the information mentioned in part (ii). Generally, reactions could involve substitution, addition, elimination, or rearrangement. However, without further context, it is impossible to conclude which specific type of reaction has occurred.