What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?
I would name this 3,5-dimethyl-3-heptene
Ch3ch(ch3)ch2ch(c2h5)ch(ch3)ch3
To determine the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3, we follow a step-by-step approach:
Step 1: Identify the longest continuous carbon chain.
In this case, the longest continuous carbon chain contains six carbon atoms.
Step 2: Number the carbon atoms in the chain.
Start numbering from the end that gives the lowest numbers to the substituents. In this case, the chain can be numbered from either end because both ends have substituents.
CH3CH(CH2CH3)CH=CHCH2CH3
| | | | | |
1 2 3 4 5 6
Step 3: Identify and name the substituents.
In this compound, there are two ethyl (C2H5) substituents attached to carbon atoms 2 and 5.
Step 4: Identify and name any double or triple bonds.
In this compound, there is a double bond between carbon atoms 3 and 4.
Step 5: Combine the substituents and the main chain.
Putting it all together, the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3 is 3-ethyl-4-ethylhex-3-ene.
Please note that the numbers 3 and 4 in "hex-3-ene" indicate the positions of the double bond in the chain.
To determine the IUPAC name of the given compound (CH3CH(C2H5)CH=CH(C2H5)CH3), we need to follow a step-by-step process:
1. Identify the longest continuous carbon chain: In this case, the longest chain consists of six carbon atoms.
2. Number the carbon chain: Start numbering from the end closest to the first substituent. In this case, there are two methyl (CH3) groups as substituents. The numbering will begin from the end closest to any of these methyl groups.
3. Assign a prefix to each substituent: The substituent CH3CH(C2H5) is called '2-methylbutyl' since it is attached to the second carbon atom in the chain.
4. Indicate the positions of the substituents: Use the numbers assigned to the carbon atoms to indicate the position of each substituent. In this case, '2-methylbutyl' is attached to the second carbon atom.
5. Indicate the double bond: The double bond is present between the third and fourth carbon atoms. Since it is a terminal alkene, we use '-ene' as a suffix to indicate the presence of the double bond. Therefore, the name of the compound becomes '2-methylbut-2-ene.'
6. Indicate any additional substituents: There are no other substituents in this compound.
Putting it all together, the IUPAC name of the compound CH3CH(C2H5)CH=CH(C2H5)CH3 is 2-methylbut-2-ene.