an alkane formula c8h18 can form only three monochlorination products give its structure
To find the three monochlorination products of the alkane C8H18, we need to replace one of the hydrogen atoms with a chlorine atom at different positions. Here are the possible structures:
1. 2-Chloro-octane:
C-C-C-C-C-C-C-C
| | | | | | |
H H H H H H H Cl
2. 4-Chloro-octane:
C-C-C-C-C-C-C-C
| | | | | | |
H H H H H H Cl H
3. 6-Chloro-octane:
C-C-C-C-C-C-C-C
| | | | | | |
H H H H H H H Cl
These are the three monochlorination products that can be formed from C8H18. Each structure represents the substitution of a single hydrogen atom with a chlorine atom at different positions along the carbon chain.
To determine the three possible monochlorination products of C8H18, we need to understand the structure of the alkane molecule.
C8H18 represents an alkane with eight carbon atoms (C8) and 18 hydrogen atoms (H18). Since alkane molecules are composed solely of carbon and hydrogen atoms and follow a specific pattern, we can generate a structural formula for C8H18 using the general formula for alkanes: CnH2n+2.
Using this formula, we find that C8H18 follows the pattern CnH2n+2, where n = 8. Substituting the value of n, we get C8H18 = C8H18.
Now, let's consider the three possible monochlorination products by replacing one hydrogen atom with a chlorine atom.
1. In the first product, we replace a hydrogen atom from the end carbon (CH3 group) of the alkane. The resulting structure would be:
CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-Cl
2. In the second product, we replace a hydrogen atom from the middle carbon of the alkane. The resulting structure would be:
CH3-CH2-CH2-CH2-CH2-CH2-CH(Cl)-CH2
3. In the third product, we replace a hydrogen atom from the other end carbon (CH3 group) of the alkane. The resulting structure would be:
Cl-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3
These three structures represent the three possible monochlorination products of C8H18, where one hydrogen atom has been replaced by a chlorine atom.