Chemistry

CH3−CH2−CH2−O−CH2−CH2−CH2−CH2−CH3

Spell out the full name of the compound

  1. 👍
  2. 👎
  3. 👁
  1. isnt it a -O- an ether?

    five C on one side, three C on the other

    Pentyl-propyl-ether in the olden dark days, but now
    1-Propoxypentane

    1. 👍
    2. 👎
    👤
    bobpursley
  2. And in the "older" olden days it was amyl-propyl-ether

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  2. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  3. chemistry

    complete each of the following and name the product a CH3CH2CH=CH2+HCl gives b CH3CH2CH=CH2+Br2 gives c CH3CH2CH=CH2+H2o-H+gives d CH3CH2CH=CH2 alkalin and kMno4 gives as

  4. chem

    drawing Lewis structure 1. NH2 || CH3-CH2-CH2-CH-CH2-CH3 2. O || CH3-CH2_C-CH2-CH2-OCH2-CH circle around the hydrophilic regions in each structure that

  1. Chem

    whats the name of the compound H3C-CH2-CH2-CH3

  2. chemistry

    please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3

  3. Chemistry

    Identify the major intermolecular forces between each of the following atoms or molecules: a. He b. HBr c. SnH4 d. CH3-CH2-CH2-OH

  4. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon...

  1. Chemistry - - Hydrocarbons

    Name the following hydrocarbons. A) CH3-CH2-CH-CH2-CH2-CH3 | CH3 I don't know if this will show up correctly after I post. But the CH3 at the bottom is supposed to be under the CH. I don`t get how to name. I counted up all the

  2. Chemistry, Science, Intermolecular Forces

    Identify the major intermolecular forces between each of the following atoms or molecules: a. He b. HBr c. SnH4 d. CH3¬CH2¬CH2¬OH I think b and c are hydrogen bonds. D is dipole-dipole attractions?

  3. chemistry

    1. Would Ch3-OH or CH3-CH2-CH2-CH2-CH2-OH have a higher boiling point? Fully explain ypur answer. 2. Explain why a tertiary alcohol will not undergo an oxidation reaction. Give an example. 3. Compare and contyrast

  4. chemistry

    CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound

You can view more similar questions or ask a new question.