chem

what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

asked by Kasia

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and
  2. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3
  3. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and
  4. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank
  5. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas
  6. Chemistry

    I am rewriting this question and using dots to make sure that everything lines up correctly so please ignore the dots. 1. name this hydrocarbon .......CH3...CH3 .......|.....| CH3-CH-C-CH2-C-CH2-CH3 ....|..|.....| ....CH3CH2..CH2
  7. Chemistry

    Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon? A. CH3-CH-CH-CH3
  8. Chem - IUPAC naming system

    I don't know how to name this. Help? You'll have to write out what I'm describing because I can't set it up in this. In a straight line, there is (1)CH3 - (2)C - (3)CH2 - (4)C - (5)CH - (6)CH3. On #2, there is CH3 and CH3. On #4,
  9. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to
  10. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

More Similar Questions