Posts by ivy

Total # Posts: 176

Chem 1
Use oxidation states to identify the element that is being oxidized in the following redox reaction: Cu(s)+2 H 2 S O 4 (aq) ? CuS O 4 (aq)+S O 2 (g)+2 H 2 O(l)

a toy balloon is in the shape of a sphere. it is being inflated at the rate of 20 in^3 / min. at the moment that the sphere has volume 64 cubic inches. what is the rate of change of the radius ?

300/ 31 2/7= 300/ 219/7= 300*7/219= 9 43/73 minutes

Use the pythagorean theorem. x*x+12*12=13*13 x*x+144=169 x*x=25 x=5 5 is the side length of the remaining side. to find the area of a right triangle you do base*height divided by two. 12*5=60 60/2=30 area=30

I need help! We have to create a business and i have no clue what a 'mission statement' is or anything so please help me! (^~*)

You train for A race by running at a speed of 6 mph. A) At this speed, how many minutes does it take for you to run 3.2 miles? B) on race day, you run 3.2 miles in 30 minutes. What is your speed in miles per hour?

A student has a mean score of five tests taken. What score must she obtain on her next test to have a mean average of 88 on all six tests?

math trigonometry
Prove that 2sin150*cos315*cos(90-x)/sin(360-x)cos(-240)sin135

Algebra (check my work?)
Thank you so much!

Algebra (check my work?)
1. Write a proportion using an unknown value x and the ratio 5:6 then solve it. 5/6 = x/12 6 * 2 = 12 5 * 2 = 10 x = 10 2. In an orchestra, the ratio of trombones to violas is 1 to 3. There are 9 violas, Write a proportion that gives the number t of trombones in the orchestra...

1. 5/6 = x/12 6 * 2 = 12 5 * 2 = 10 x = 10 does that work? 2. 1/3 = t/9 3 * 3 = 9 1 * 3 = 3 t = 3 so yeah i think we're right 3. i don't quite understand, if you can write it out like how i write out the above answers that'd be great.

Write a proportion using an unknown value x and the ratio 5:6 then solve it. In an orchestra, the ratio of trombones to violas is 1 to 3. There are 9 violas, Write a proportion that gives the number t of trombones in the orchestra. How many trombones are in the orchestra? The ...

y=2/5x+c, determine the value of c if the line passes through the point P(-2,-4). answer: c=-16/5 ?

A ship sails north, then turns 45° in a clockwise direction. After another hour, it turns clockwise 90°. In which direction is the ship now sailing? 90 + 45 = 135° west?

math estimating products
5 3/4

At the fair, not only can I eat tasty food, but I can also see awesome fireworks. need help making sure its a parallel structure and has linking words

which following trinomial is a perfect square? A. x^2 + 2x - 3 B. x^2 - 4x - 4 C. x^2 + x + 1/4 D. x^2 - x -56 question B & C 1-term and 3-term is perfect square. how do figure which is perfect square?

Eric is planning a 7-day resort vacation. He will play golf on four mornings. He also wants to play tennis but can only play tennis on days he does not play croquet. He will play croquet on any day immediately following a day that he plays golf. What is the greatest number of ...

Can someone please check my answers if it is right. Thank you! True/False 1. Rosenstand argues that moral subjectivism is an intuitively sound, "live and let live" kind of moral position that is both appealing and socially cohesive. -FALSE 2. For the members of the ...

My answers are T/F 1. False 2. True On the Multiple Choice 1. b 2. d

True/False 1. Rosenstand argues that moral subjectivism is an intuitively sound, "live and let live" kind of moral position that is both appealing and socially cohesive. 2. For the members of the Flat Earth Society, who believe that all physical evidence of a round ...

True/False 1. Rosenstand argues that moral subjectivism is an intuitively sound, "live and let live" kind of moral position that is both appealing and socially cohesive. 2. For the members of the Flat Earth Society, who believe that all physical evidence of a round ...


Calculate the pH of .100 of a buffer solution that is .25 M in HF and .50 M in NaF. What is the change in pH on addition of the following? A. .002 mol of HNO3 B. >004 mol of KOH I calculated the correct pH of the solution but am having trouble calculating A & B. Thanks, Ivy

What is the source of the magma that fuels the island arc complex?

Crude oil pumped out of the ground may be accompanied by the formation of water, a solution that contains high concentrations of NaCl and other salts. If a boiling point of a sample of the formation of water is 2.0 Celsius above the boiling point of pure water, what is the ...

A student has a mean score of five tests taken. What score must she obtain on her next test to have a mean average of 88 on all six tests?

what property of multiplication is used in the equation below? why? 2 (3) 2 - (-)= - 7 3 7

ΔG = -RTlnK = [-8.314 x (273+37)] x ln (.50/1.7) 3154.08 J/mol 3.154 kj/mol

sam said if he ate half of a pie and ava ate a fourth of the pie then three-fourths of the pie will have been eaten

A&P 1
Why is it important to understand the relationship between nerves and muscles?

A Solute That Removes Hydrogen Ions from Solution

Write net ionic equation for the reaction between nitric acid and calcium hydroxide.

What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?

What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?

What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?

Rick rides 11 1/8 miles in an hour with his bike in second gear going uphill. If Rick rides downhill in fourth gear he goes 2 1/2 faster. How many miles will Rick go in an hour downhill in fourth gear?

if antiseptic hydrogen peroxide is 3% H2O2 by mass, approximately how many moles of H2O2 are present in each gram of antiseptic solution? you can assume the solution has the same density as water. show your calculations.

which procedure is a chemical change that may be used to break down a compound?


Onomatopoeia is imitation of sounds of nature. I don't see the onomatopoeia in this lines.

The answer is D. :)

The correct Answers is B.

A swimming pool is 16 meters wide and 25 meters long. At $50 per square meter. how much will a child-proof covering for the pool cost?

A parking lot is 60 meters wide and 80 meters long. At $ 15 per square meter, how much will it cost to pave the parking lot?

organic chemistry
Why must the alkyl halide product be dried carefully with anhydrous calcium chloride before the distillation?

organic chemistry
Aqueous sodium bicabonate used to wash the crude n-butyl bromide. a) What was the purpose of this wash? Give equation. b)Why would it be undesirable to waash the crude halide with aqueous sodium hydroxide?

organic chemistry
An ether and an alkene are formed as by-products in this reaction. Draw the structure of these by-products and give mechanism for their formation.

organic chemistry
Why does the alkyl halide layer switch from the top layer to the bottom layer at the point where water is used to extract the organic layer?

organic chemistry
what are the formulas of the salts that may precipitate when the reaction mxture is cooled?

Ap Chemistry
HOw much energy is required to ionize a mole of Hydrogen atoms?

Ap Chemistry
Calculate the wavelength of light that must be absorbed by hydrogen atom in its ground state to reach the excited ste of E=+2.914*10^(-18)

What happened if you put the Elodea leaf cells in a solution of 0.5% NaCl,1.8% NaCl and 0.9%NaCl?

. Explain the following unexpected result: $ whereis date date: /bin/date ... $ echo $PATH .:/usr/local/bin:/usr/bin:/bin $ cat > date echo "This is my own version of date." $ ./date Fri May 22 11:45:49 PDT 2009

In your own words, explain the second law of thermodynamics and explain why it is not violated by living organisms?

examples of folk narratives with sources

why does the melted wax turns solid when dropped on water ?

okay,this is what i have so far: so is the chemical formula: O2 + CxHyOz --> CO2 + H2O ? CO2: 0.41 g of C 1.09 g of O2 H2O: 0.045 g of H2 0.36 g of O Empirical Formula: CH2O -> n = 0.033 mol C: 0.033 mol x 12g/mol = 0.396 g of C H2: 0.033 mol x 2g/mol = 0.066 g of H2 O: ...

When 1 gram of sex hormone (contains C, H, and O) was burned in a combustion analysis, 1.5 grams of CO2 and 0.405 grams of H2O were obtained. The molar mass was found to be 352g/mol. What is the molecular formula for the sex hormone?

A train braking with constant deceleration covers 1km in 20s, and a second kilometre in 30s. Find the Deceleration. Wgat further distance will it cover before coming to a stop. and how long will it take?

An iceberg breaks off from the Antarctic continent and floats due north at constant velocity/ It's latitude south decreases by 1 degree in 8 days. Taking the circumference of the earth to be 40 000km, calculate the speed of iceberg in ms^-1.

in triangle fgh,angle f=32, angle g= 100. find angle h

Draw the condensed structural formulas of ethyl alcohol

Indicate the effect of the hormone on the response (increase, decrease, no effect)? 1.__________________ effect of secretion of insulin on blood glucose levels 2.__________________ effect of secretion of ADH on blood pressure 3.__________________ effect of secretion of ...

Match the hormone or regulatory mechanism to digestive function.? a. Enterokinase b. gastrin c. intestinal cells of Cajal d. cholecystokinin e. CFTR f.enteric nervous system 1._______ this hormone contributes to the secretion of pancreatic juice 2._______ this component of the...

For discussion of endocrine disorders 1.Diabetes insipidus Hormone affected? Too much or too little? 2.Graves’ disease Hormone affected? Too much or too little? 3.Acromegaly Hormone affected? Too much or too little? 4.Addison’s disease Hormone affected? Too much or ...

Clotting disorders are common, complex and affected by a variety of medications or mechanisms. Match the mechanism to the description. a. coumarin b. EDTA c. aspirin d. factor VIII deficiency e. tissue-plasminogen activator (TPA) f. heparin 1.inhibits the formation pf ...

Indicate the site of the following activity in the digestive system (mouth, esophagus, stomach, small intestine, large intestine, liver, gall bladder, pancreas). 1.breakdown of cholesterol by formation of bile acid 2. principal site of formation of folic acid and vitamin K by ...

Indicate whether the following would increase or decrease during exercise.? 1.activity of the sympathetic nervous system 2.urine FORMATION 3.vasodilation of blood vessels in the skeletal muscles 4. stroke volume 5.venous return 6.activity of the vagus nerve

Suppose you were to grind up and homogenate a pancreas. Do you think it would be possible to isolate insulin from this hemogenate? ( Hint: remember that the pancreas is also an exocrine gland, producing pancreatic juice) Explain your answer

Compare and Contrast the structure and function of the epithelium of the skin and the epithelium of the intestion

Would you expect the muscle fibers of the tongue to be striated or smooth? What about the muscle of the diaphragm? Explain your answer.

Before the invention of refrigerators, pioneers preserved meat by salting it. Explain how meat can be preserved by this procedure.(Hint: think about what salting the meat would do to decomposer organisms, such as bacteria and fungi)

Suppose a salt and a glucose solution are separated by a membrane that is permeable to water but not to the solutes. The NaCl solution has a concentration of 1.95 g per 250 mL (molecular weight = 58.5). The glucose solution has a concentration of 9.0 g per 250 mL (molecular ...

How might the following affect blood volume (increase or decrease) (note: refer to physiology of kidney): High protein concentration in blood plasma Secretion of ADH Renin-angiotensin-aldosterone ANF (atrial natriuretic factor)

If 39.2 of 0.177 is required to neutralize completely 22.0 solution, what is the molarity of the acid?

how do regions of the brain control motor neurons?

what causes calcium to be released in sliding filament action for muscle contraction?

what does skin have to do with bone formation?

what is the meaning of the numeral represented by X in the general formula for hydrate salt * XH2O

How many milliliters of 3.60 {\rm M} {\rm HCl} are required to react with 140 {\rm mL} of 1.60 {\rm M}{\rm Al}({\rm OH})_{3}?

If Tums is added to 55.0 {\rm mL} of 0.750 {\rm M}{\rm HCl}, how many grams of {\rm CO}_{2} gas are produced?

If you placed the stethoscope on the patient's bracial artery, but did not put the BP cuff on the patient, you wouldnt hear blood flow sounds. Explain Why you woundnt hear hear bllod floww sounds if you didn't put the BP cuff in the patient?

Where is Parathyroid hormone and Calcitonin each synthesize, and by what specific type of cell?

How is this hormones regulated: hypothlamus/pituitary axis, nervous system,feedback inhibition indicate which? 1. Follicle stimulating hormone 2. Cortisol 3. Antidiuretic hormone 4. Parathyroid hormone 5. Thyroid-stimulating hormone 6. Insulin 7. Norepinephrine

Which might, in theory, be used to combat osteoporosis? Parathyroid or Calcitonin?

Compare and Contrast the following thyroid disorders? 1. IODINE DEFICIENCY a. Does it cause goiter (yes or no) b. Is the metabolic too high or too low? (indicate which) c. Effect on TSH levels (will they increase or decrease?) d. What is the most appropriate way to treat this ...

Is the hormone protein,steroid or glycoprotein? 1. Follicle-stimulating hormone 2. Cortisol 3. Antidiuretic hormone 4. Parathyroid hormone 5. Thyroid-stimulating hormone 6. Insulin 7. Norepinephrine

Calculate each of the following quantities in 0.183 mole {\rm (C_3H_5)_2O}: Find the Atoms of H and C

A sample of propane, \rm C_3H_8, contains 12.8 moles of carbon atoms. How many total moles of atoms does the sample contain?

Why is it important to clear a neurotransmitter quickly from the synaptic cleft? What might happen to the target muscle cell if the neurotransmitter were NOT cleared? What might happen if neurotransmitter reuptake occured too quickly?

The 16th term of an Arithmetric Progression is four times the 36th term, and exceeds it by 32. Finda the numbers.


given that a+b/5 = b+c/6 = c+a/7 = k, find the ratio a:b:c.

Parathyroid hormone and calcitonin are synthesized where?

What condition triggers its release(e.g., glucose in blood) 1.Thyroid hormone 2.ADH 3. Aldosterone 4. Epinephrine 5. Melatonin 6. Estrogen

find p/q if (2q^2-pq):(q^2-pq) = 2:3.

Compare and contrast the activity of acetylcholine, dopamine, serotonin, and norepinephrine. If the statement applies to more than one, indicate which ones. ___________________________ curare interferes with the action of this neurotransmitter ___________________________ ...

There may be more than one region in which the neurotransmitter is active. Choose one, and make sure your answer in column 4 matches the region identified in column 3. 1.Glutamate a.Is it excitatory or inhibitory (indicate which)? b. Name a specific region in the brain where ...

Match the poison/drug to the effect. a. curare b. tetanus toxin c. a-bungarotoxin d. strychnine e. botulinum toxin f. neostigmine __________ causes spastic paralysis by specifically blocking glycine receptors __________ causes flaccid paralysis by blocking the release of ...

  1. Pages:
  2. 1
  3. 2
  4. Next>>