what does the structure of 2-ethyl- 3-methyl-4-ethyl -heptane look like?
IS a correct name for it 5-ethyl- , 3,4- dimethyl -octane?
also the correct name is 3 methyl pentane for 2 ethyl butane who do we get that? I understand where the ethyl group goes and that there is 5 carbons in a chain instead of 4, but how is it methyl instead of ethyl when at 3. It still has the chain -CH2-CH3
I typed all of this in and it didn't post. So I'll try again.
CH3CH2CH(CH3)CH(CH3)CH2CH2CH2CH3
Your name is correct except for the -octane. Omit the -.
I don't understand the second question. Is that why insted of who? at 3? whats at 3? I don't know what's confusing you.
Why is the correct name of 2 ethyl butane determined to be 3 methyl pentane? I understand it has 5 carbons to have it be considered pentane, but how is there a methyl group? The group of methyl is at 3.
CH3
|
CH2
|
HC-CH3
|
CH2
|
CH3
To determine the structure of 2-ethyl-3-methyl-4-ethyl-heptane, we need to break down the name and understand the meaning of each part.
The name consists of several parts:
1. "2-ethyl": This indicates that there is an ethyl group (C2H5) attached to the second carbon atom of the parent chain.
2. "3-methyl": This indicates that there is a methyl group (CH3) attached to the third carbon atom of the parent chain.
3. "4-ethyl": This indicates that there is another ethyl group (C2H5) attached to the fourth carbon atom of the parent chain.
4. "heptane": This indicates that the parent chain is a heptane, which consists of seven carbon atoms in a continuous line.
Based on this information, we can now construct the structure:
CH3 - CH2 - CH2 - CH2 - CH2 - CH(CH3) - CH2 - CH3
| |
2-ethyl 4-ethyl
3-methyl
Now, let's analyze the alternative name you suggested, "5-ethyl, 3,4-dimethyl-octane." The name implies that there is an ethyl group attached to the fifth carbon, and there are dimethyl groups attached to the third and fourth carbons. However, this name does not match the given structure. Therefore, 5-ethyl, 3,4-dimethyl-octane is not a correct name for the structure given.