chemistry

posted by .

I think it is a trick question as I can not balance this equation .

Balance this equation

Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    could someone check my answers to see if they are right?
  2. chemistry check

    A) Write a balanced chemical equation for the reaction between sulfuric acid and potassium hydroxide. I got H2SO4 + KOH ---> H2OH + KSO4 B) Write the ionic equation for the reaction. H2 + S2O4-2 + K + OH- ---> H2 + OH + K2SO4-2 …
  3. Chemistry

    Write balanced complete ionic equation for HC2H3O2(aq) + K2CO3(aq)-----> H2O(l)+CO2(g)+KC2H3O2(aq) I put 2H+(aq)+2C2H3O2-2(aq)2K+(ag)+CO3-2(aq)------>H2O(l)+CO2(g)+2K+(aq)+C2H3O2-2(aq) and said it was wrong, but I got this part …
  4. chemistry

    Balance each of the following equations a)CH4+CL2......>CCl4+HCl b)AL(OH)3+H2SO4.....>Al2(SO4)3+H2O c)Fe+H2O......>fe3O4+H2 d)Al4C3+HCl......>AlCl3+CH4 e)C2H6+O2......>CO2+H2O f)P2H4.......>PH3+P4 g)S2Cl2+NH3......>N4S4+NH4CL+S8 …
  5. Chemistry

    Balance this chemical equation. K4Fe(CN)6 + KMnO4 + H2SO4 ---> KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O
  6. chemistry

    a C4H8(g)+â O2(g)⟶ ã CO2(g)+ä H2O(g) balance this equation put a coefficient in a,b,y,d to balance equation please help
  7. chemistry am i right

    Balance and complete equation H2SO4 + Na2CO3 ---> Na2SO4 + H2O + CO2
  8. chemistry

    how to balance this partial equation given below k2cr2o7+h2so4+kI-->k2so4+cr2(so4)3+h2o+I2
  9. chemistry

    how to balance this partial equation given below k2cr2o7+h2so4+kI-->k2so4+cr2(so4)3+h2o+I2
  10. Chemistry

    How do I do these? 1. Balance the equation for the reaction between zinc and hydrochloric acid. Zn + HCl ZnCl2 + H2 2. Balance the equation for the reaction between iron (steel wool) and oxygen (water). Fe + O2 Fe2O3 3. Balance the

More Similar Questions