I think it is a trick question as I can not balance this equation .
Balance this equation
Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2
Balancing chemical equations involves ensuring that the number of atoms for each element is the same on both sides of the equation. Let's go through the steps to balance this equation:
The unbalanced equation is:
Na(CO3)2 + H2SO4 = Na(SO4)2 + H2O + CO2
Step 1: Count the number of atoms of each element on both sides of the equation.
On the left side:
Na: 1
C: 2
O: 6
H: 2
S: 1
On the right side:
Na: 1
S: 2
O: 8
H: 2
C: 1
Step 2: Balance the atoms of elements that appear in the reactants and products first. Start with elements that appear in only one reactant and one product, and then move on to the ones that appear in multiple compounds.
Let's start by balancing sodium (Na) atoms:
Left side: 1 Na
Right side: 1 Na
Next, balance the sulfur (S) atoms:
Left side: 1 S
Right side: 2 S
Now, balance the oxygen (O) atoms:
Left side: 6 O
Right side: 8 O
Then, balance the hydrogen (H) atoms:
Left side: 2 H
Right side: 2 H
Finally, balance the carbon (C) atoms:
Left side: 2 C
Right side: 1 C
Step 3: Adjust the coefficients to balance the remaining atoms.
To balance the carbon (C) atoms, we can multiply the coefficient of CO2 by 2 to have 2 carbon atoms on both sides of the equation:
Na(CO3)2 + H2SO4 = Na(SO4)2 + H2O + 2 CO2
Now, let's recap the balanced equation:
2 Na(CO3)2 + H2SO4 = Na(SO4)2 + H2O + 2 CO2
The equation is now balanced, with the same number of each element on both sides.