HELP PLEASE

posted by .

I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost.
In the book it says
Chemical Equation: CH4 + O2 > CO2 + H2O

Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O

How did this happen?

Thanks.

Oh and what is the main rule for equilibrium and reaction rates?

I know that there are factors for affecting the reaction rates but I'm still so confused.

  • HELP PLEASE -

    the C balances as written, since there is one on each side. That leaves you with

    CH4 + ?O2 > CO2 + ?H2O

    you have 4H on the left, so you will need 2H2O on the right. That gives

    CH4 + ?O2 > CO2 + 2H2O

    That balances the C and H, so now you need 4O on the left, which is 2O2

    CH4 + 2O2 > CO2 + 2H2O

    Usually I start by balancing the atoms that appear the least, letting the others jiggle until they can work themselves out. This one was rather easy, since there were no odd atoms clogging things up. Lots of examples online via google.

  • HELP PLEASE -

    Thank you so much :) So basically I just have to make sure that the atoms have the same number on each side.

  • HELP PLEASE -

    Yes, exactly.

  • HELP PLEASE -

    Fin fit

  • HELP PLEASE -

    My exam was so easy! Thank youuuuuuuuuuuu

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    What is the chemical equation for the combustion reaction between methanol and air?
  2. Chemistry

    mass-mass conversions and mass-mole conversions: what is the difference and how do you do each?
  3. Chemical Equations

    Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. …
  4. Science

    I am learning how to balance a chemical equation but I don't understand it at all. I read that in order to balance the equation, you need to find the number of atoms. How do I do that?
  5. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  6. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right?
  7. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  8. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation …
  9. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  10. help

    Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction?

More Similar Questions