CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound
To determine the IUPAC name of the compound CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3, we need to break down the structure and identify the functional groups and substituents.
1. Start by identifying the main chain, which consists of seven carbon atoms. This corresponds to heptane.
CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3
└───┬───┘└───┬─────┘ └─┬───┘└──────────┬───┘
1 2 3 4 5 6
2. Next, locate and prioritize the functional groups and substituents. The functional groups are listed in the following order of priority: carboxylic acid, anhydride, ester, amide, nitrile, aldehyde, ketone, alcohol, thiol, amine, alkene, alkyne, and alkane.
In this compound, we have:
- Chlorine (Cl) attached to carbon 2
- Ethyl (C2H5) attached to carbon 2
- Methyl (CH3) attached to carbon 3
- Amine (NH2) attached to carbon 4
- Bromine (Br) attached to carbon 5
- Methyl (CH3) group attached to carbon 7
3. Now, assign the appropriate prefixes for the substituents and functional groups. The prefixes indicating the number of identical substituents are as follows: di-, tri-, tetra-, penta-, hexa-, and so on.
Based on this information, we can summarize the substituents and functional groups as:
- 2-chloro (Cl)
- 2-ethyl (C2H5)
- 3-methyl (CH3)
- 4-amino (NH2)
- 5-bromo (Br)
- 7-methyl (CH3)
4. Combine the main chain name, substituents, and functional groups. Use hyphens to separate numbers and dashes to separate words in the substituent names.
The IUPAC name of the given compound is:
2-chloro-2-ethyl-3-methyl-4-amino-5-bromo-7-methylheptane
Remember to double-check the numbering and make sure the names are in alphabetical order (ignoring prefixes like di-, tri-).
Note: It's always a good practice to validate the IUPAC name using reliable chemical software or references.