Chemistry

posted by .

Write an equation for the reaction that takes place when each base is added to water. A) LiOH B) (CH3)2NH.

  • Chemistry -

    LiOH(s) + H2O(l) ==> Li^+(aq) + OH^-(aq)

    dimeNH(l) + H2O(l) ==> dimeNH2^+(aq) + OH^-(aq)

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry II

    If 36.0 mL of 7.0e-4 M HClO4 is added to 19.5 mL of 8.2e-4 M LiOH, what is the pH of the solution?
  2. Chemistry

    an acid base titration is conducted in which 20 ml of LiOH is added to 10ml of .200M HBr to reach the equivilance point. what is the molarity of the LiOH solution?
  3. Chem

    Estimate the equilibrium constant for the weak base (CH3)2NH, if a 1.59×10-2 M aqueous solution of (CH3)2NH has a pOH 2.58 (make an exact calculation assuming that initial concentration is not equal to the equilibrium concentration). …
  4. Chemistry

    I wrote the dissociation or ionization in water for each of the following acids. I just want someone to check if they are right. a) HC3H5O2(aq)<===> H^+(aq)+ C3H5O2^-(aq) b) (CH3)2NH2^+(aq)<===> H^+(aq)+ (CH3)2NH(aq) c) …
  5. Chemistry

    Write an equation for the reaction that takes place when LiOH is added to water.
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  8. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  9. Chemistry

    A precipitation reaction takes place when a water solution of potassium phosphate, K3PO4, is added to a water solution of cobalt (II) chloride, CoCl2 Write a balanced equation for this reaction
  10. Chemistry

    What is basic like NaOH,from the following?

More Similar Questions