AP Chemistry

posted by .

Write a balanced chemical equation for the combustion of trioleylglycerol. molecular formula C57H110O6

  • AP Chemistry -

    2C57H110O6 + 163O2 ==> 114CO2 + 110H2O

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Write a balanced chemical equation for the combustion of trioleylglycerol. The molecular formula is C57H110O6.
  2. Chemistry

    A certain compound contains carbon, hydrogen , and oxygen. When 1.00 grams of this compound are burned in oxygen gas 1.47 grams of CO2 and 0.600 grams of water are formed. When 2.75 grams of the compound are dissolved in 10.0 grams …
  3. Chemistry

    A certain compound contains carbon, hydrogen , and oxygen. When 1.00 grams of this compound are burned in oxygen gas 1.47 grams of CO2 and 0.600 grams of water are formed. When 2.75 grams of the compound are dissolved in 10.0 grams …
  4. Chemistry

    Write a balanced chemical equation (molecular equation). Write a total ionic equation. write a net ionic equation. (NH4)2 SO4(aq)+Na2CO3(aq) -->
  5. Chemistry

    0.717 g of a compound containing carbon, hydrogen, and oxygen is burned and found to produce 1.02 g CO2 and 0.624 g H2O. The molar mass of the compound is 124 g/mol. (a) Write a chemical equation for the combustion of this unknown …
  6. Chemistry

    0.717 g of a compound containing carbon, hydrogen, and oxygen is burned and found to produce 1.02 g CO2 and 0.624 g H2O. The molar mass of the compound is 124 g/mol. (a) Write a chemical equation for the combustion of this unknown …
  7. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  8. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  9. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation …
  10. AP Chemistry

    how much heat is produced when the body metabolizes a gram of trioleylglycerol?

More Similar Questions