chemistry

posted by .

which of the structures are impossible ,give the numbers of bonds that various atoms can form? (a)CH3CH3 CH3 (b)CH3CH=CH2CH2CH3 (c)CH3NHCH3 (d)CH3CCl=CCH2CH3 (e)(CH3)3 CHCH(CH3)2 (f)CH3CHO

  • chemistry -

    I suggest you draw these structures on a sheet of paper and check the bonds. C may have 4, N may have 3 and O may have 2.
    a is impossible but there are two others that won't work, also.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon?
  2. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 …
  3. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.
  4. Chemistry

    1)Which compound below would be expected to have the highest boiling point?
  5. Chemistry

    Which compound below would be expected to have the highest boiling point?
  6. Chemistry

    Which compound below would be expected to have the highest boiling point?
  7. Chemistry

    Which compound below would be expected to have the highest boiling point?
  8. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 …
  9. Chemistry

    In the condensed structure CH3CH2CHCH double bonded to CHCH(CH3)2 ! CH3 What does it mean when the CH3 is in () followed by the 2?
  10. organic chem

    Which are enatiomers? optically active?identical?

More Similar Questions