Chemistry

posted by .

How do I change 3,3,4,4,5,5-hexamethyl-1-hexyne into it's molecular formula

  • Chemistry -

    It looks like C12H22.
    H-CtriplebondC-C(CH3)2C(CH3)2C(CH3)2CH3

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry (Check)

    True or False The empirical formula of a compound is always the same as the molecular compound. My Answear: True The empirical formula for acetylene is CH. The molecular formula is C2H2. Another example: The empirical formula for glucose …
  2. Chemistry

    Please check my answers for the following questions. THANK YOU. 1) The empirical formula of a compound that is 25.9% nitrogen and 74.1% oxygen is.... ANSWER: N2O 2) empirical formula of a compound that consists of 4.80 grams of carbon, …
  3. chemistry

    I need to know if I have th right molecular formula for Sorbito 39.56g C 7.75g H 52.7g O Empirical Formula is CH2O 30.026 amu how I how calculate the molecular mass and how I figure out the melecular formula?
  4. chemistry

    Determining a Molecular Formula from an Empirical Formula 1. A compund has an experimental molar mass of 78g/mol. Its empirical formula is CH. What is its molecular formula?
  5. chemistry

    Determining a Molecular Formula from an Empirical Formula 1. A compund has an experimental molar mass of 78g/mol. Its empirical formula is CH. What is its molecular formula?
  6. Chemistry

    Given the Empirical formula: C6H7N, and a molecular mass of 372.52 g/mol, How do I find the MOLECULAR formula for the compound?
  7. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  8. chemistry

    An unknown sample with a molecular mass of 180.0g is analyzed to yield 40% C, 6.7% H, and 53.3% O. What is the empirical formula and the molecular formula of this compound?
  9. Chemistry

    A carbohydrate P contains 40% carbon,6.67% hydrogen.If P has a relative molecular mass of 60.Determine it; 1)Empirical formula 2)molecular formula [H=1,C=12,O=16]
  10. Chemistry

    A compound of B and H is found to have a mass percent composition of 81.1% Boron. Its empirical formula is B2H5. A mass spectrometry experiment tells us that the molecular mass is 53.3 g/mol. What is its molecular formula?

More Similar Questions