chemistry

posted by .

how do you identify the base in this reaction?
h2o(L) + CH3NH2(aq) yields OH-(aq) + CH3+(aq)

  • chemistry -

    I think that the base always contains hydroxide, aka OH; the original components were water mixed with an ammonium compound ( NH2)Check the chemistry reference tables too, which have tables that identify the bases and acids.

  • chemistry -

    You have a typo, actually an omitted portion, in your post. You should have posted
    H2O(l) + CH3NH2 ==> OH^- + CH3NH3^+
    How do you know which is the base? If you go by the Arrhenius theory the base produces OH^- in solution. In this case it is easier, I think, to use the Bronsted-Lowry theory. The base is the one that takes a proton away from something. In this case, CH3NH2 took a proton away from H2O to form the CH3NH3^+.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    Calculate the volume (mL) of the solute (CH3)2CO and the volume (L) of the solvent H2O that should be added to prepare 1.36 kg of a solution that is 25.7 g (CH3)2CO per 100. g solution. Molar Mass (g/mol) (CH3)2CO 58.05 H2O 18.015 …
  2. Chemistry

    In one experiment, 50.0ml of 0.10M CH3NH2, is mixed with 20.00ml of 0.10 M CH3NH3Cl. The kb of CH3NH2 is 3.70*10^-4. a) write the chemical reaction for the equilibrium which becomes established, using H2O as a reactant. b)Write the …
  3. chemistry

    can you check if i write the reaction right CH3NH2 + HClO4 yields CH3NH3ClO4 then CH3NH3ClO4 yields CH3NH3 + ClO4 then CH3NH3 + H20 yield CH3NH4+ + OH-
  4. Chemistry

    Consider the following data: * NH3(g) yields 1/2 N2(g) + 3/2 H2(g) delta H = 46kJ * 2 H2(g) + O2(g) yields 2 H2o(g) delta H = -484 kJ Calculate delta H for the reaction: 2 N2(g) + 6 H2O (g) yields 3 O2(g) + 4 NH3(g)
  5. Chemistry- HW Check

    I have seven homework problems. I did them but I wasn't sure if I did them correctly. Did I do them correct?
  6. Chemistry

    I am stumped on this one...Please help!!! Write a balanced base ionization reaction for methylamine (CH3NH2) in water. Identify all species as acids and bases and identify the conjuate acid-base pairs.
  7. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  8. chemistry

    consider the following changes at constant temperature & pressure H2O(s) --yields-- H20(l); Delta H1 H2O(l) --yields-- H2O(g); Delta H2 H2O(g) --yields-- H2O(s); Delta H3 Using Hess's law, the sum of the deltas is a. equal to 0 b. …
  9. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  10. Chemistry

    What is basic like NaOH,from the following?

More Similar Questions