chemistry

posted by .

1-Butene (CH2=CHCH2CH3) burns in the presence of O2 to produce CO2 and H2O. Write the balanced chemical equation for this reaction (omit physical states and use condensed molecular formulas).

CH2CHCH2CH3+6O2=4CO2+4H2O

  • chemistry -

    This is ok but you omitted the double bond in CH2=CHCH2CH3. The double bond needs to be there (even though it's a condensed formula). When it's omitted the observer doesn't know if it is a double bond or if you just forget and left out the two H atoms.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    What is the chemical equation for the combustion reaction between methanol and air?
  2. Science/Chemistry

    Write a Balanced equation for the chemcial reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor. C2H2(g) + O2(g) ==> CO2(g) + H2O(g) It isn't balanced. I will leave that for …
  3. chemistry

    I need help with a,b,and c. I tried to balance it but im having a little trouble Ethane gas, C2H6, burns in air and produces carbon dioxide and water vapor. a)write a balanced equation for this reaction. I know this isnt balanced but …
  4. Chemistry

    calculate the theoretical yield (in grams) of the solid product, assuming that you use 1.0 g FeC2O4×2H2O and that oxygen is the excess reactant. FeC2O4×2H2O (s) + O2(g) ---> FeO(s) + H2O(g) + CO2(g) Its balanced equation is 2FeC2O4×2H2O …
  5. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  6. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  7. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  8. Physical Science

    For questions #14 – 17, write an equation for the reaction of magnesium oxide with sodium chloride to produce magnesium chloride and sodium oxide. 14. Show the formulas of the reactants. 15. Show the formulas of the products. 16. …
  9. Chemistry

    Hydrogen sulfide gas burns in the presence of oxygen to produce sulfur dioxide gas and water vapor. Write a balanced chemical equation, including the physical state
  10. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this …

More Similar Questions