chemistry

posted by .

Balance the following chemical equation:

C3H7OH(l) + O2(g) CO2(g) + H2O(g)

  • chemistry -

    C3H7OH + O2 >> CO2 + H2O
    start with the most complicated formula, the leftmost.

    C3H7OH+ O2 >> 3CO2 + H2O
    then the H
    C3H7OH+ O2 >> 3CO2 + 4H2O
    then the O. Start on the right, since you don't want to mess with those coefficents. You have 10 O
    C3H7OH + 5O2>>3CO2 + 4H2O Notice it does not balance because of the OH.
    So, go back and double the C3H7OH.
    2C3H7OH+ O2 >> 6CO2 + 8H2O
    2C3H7OH+ 6O2>> 3CO2+8H2O
    check that

  • chemistry -

    2C3H7OH + 9O2 >> 6CO2+8H2O

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    What is the chemical equation for the combustion reaction between methanol and air?
  2. help...chemistry

    i am stumped on this. please help. Balance the following equation and give the value of the stoichiometric coefficient marked with a question mark. 48KNO3 + _ C12H22O11 ---> ?
  3. chemistry

    Is C7h16 + O2 = 7 CO2 + 8 H2O a balance chemical equation?
  4. Chemistry (URGENT)

    Balance the following equations. 3. C12H22O11 + O2 = CO2 + H2O Answer: C12H22O11 + 12 O2 = 12 CO2 + 11 H2O 8. CH3OH + O2 = CO2 + H2O Answer: 2 CH3OH + 3 O2 = 2 CO2 + 4 H2O I balanced all the others just fine. But I seem to be having …
  5. Chemistry

    Balance the following equation: C6H5COOH + O2 ==> H2O + CO2
  6. Chemistry

    how many moles of oxygen are needed to react with 1.6 moles of isopropyl alcohol, CcH7OH Equation is 2 C3H7OH + 9 02 ->6 CO2 + * H2O
  7. Chemistry

    sorry How many moles of exygen are needed to react with 1.6 moles of isopropyl alcohol, C3H7OH Equation is 2 C3H7OH + 9 02 -> 6 CO2 + 8 H20
  8. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  9. Chemistry

    Balance this chemical equation. K4Fe(CN)6 + KMnO4 + H2SO4 ---> KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O
  10. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this …

More Similar Questions