chemistry

posted by .

list the numbers and types of atoms represented by these chemical formulas.
a.Fe2O3
b.KMnO4
c.CH3
d.NH4NO3

  • chemistry -

    a. 2 iron (III) and 3 Oxygen atoms.
    b. 1 K (potassium), 1 Mn(manganese), 4 O atoms.
    You get the idea.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    How do i list the numbers and types of atoms represented by chemical formulas. Example Fe2O3 The subscipts tell you the number of atoms. For example, in Fe2O3 there are two atoms of Fe and three atoms of O. I don't understand the part …
  2. chemistry

    Compound B is acetylcholine, a neurotransmitter found in the human body. It binds to receptors, leading to nerve stimulation. (in case this post does not show correct, two of the CH3 should be above and below the N^+ , AND THE O should …
  3. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 …
  4. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.
  5. Organic chemistry

    Write equations for the reactions that occur. Put conditions and catalysts over the arrow. 1.CH3COOH + CH3(CH2)7OH 2.C6H14 + KMNO4 + H 3. CH3H12 + KMNO4 + H 4. CH3CHOHCH3 + KMNO4 + H 5. (CH3)3COH + KMNO4 + H 6. (CH3)2C=O + KMNO4 + …
  6. CHEMISTRY

    Predict the products of the following reactions. a)CH3-CH2-CH2-CH3+O2----> B)CH3-CH2-CH2-CH2-CH3+Br2----> c)CH3-CH=CH-CH3+Br3----> D) HEXENE+KMnO4--> E) HEXENE+Br2---->
  7. chemistry

    which of the structures are impossible ,give the numbers of bonds that various atoms can form?
  8. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  9. chemistry

    I can't seem to figure out the name of this organic molecule. I know it's an amine, but that's it. There are two methyls (CH3) attached to a CH, followed by (in order) NH, CH2, CH2, CH2, and CH3. (ignore the ^^^, I had to use them …
  10. Chemistry - Ionic Compounds

    List all possible unit formulas (chemical formulas) that can be constructed by the formation of binary ionic compounds from the following elements. (Separate substances in a list with a comma.) Br (Z = 35), Sr (Z = 38), Ca (Z = 20), …

More Similar Questions