Organic Chemistry I LAB

posted by .

why would 4-methyl-2-pentanone have a lower boiling point that 2-hexanone if they are isomers and their molecular weights are the same?

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. isomers molecular formula

    what are isomers that have the same molecular formula but a different arrangement of atoms called?
  2. chemistry

    If a solution has a lot of particles, is it going to have a low or high boiling point?
  3. Chemistry

    Hexane is a hydrocarbon (a molecule containing only carbon and hydrogen) with a molecular weight of 86.18 g/mol, a density of 0.660 g/mL, and a boiling point of 69C. Pentanol is an alcohol (a hydrocarbon with a "OH" group attached …
  4. Chemistry

    Which of the following statements about boiling points are false: A. the boiling point of 0.1 m KF(aq) is lower than the boiling point of 0.1 m ethanol(aq) B. the boiling point of a 0.5 m aqueous solution of NaOH is the same as the …
  5. ORGANIC CHEMISTRY 2

    Ethanol has boiling of 78.5 while dimethyl ether has boiling point of -24.9;so account for this diffrence in boiling points since they both have the same molecular weight.how can this be explained using diagrams?
  6. organic chem

    Draw the hemiketal obtained by addition of methanol to 3-methyl-2-hexanone This is what I got: 3-methyl-2-hexanone + CH3OH <-> CH3CH2CH(CH3)CH2C(OH)(CH3). But my answer is line angle formula because that's what the professor …
  7. Chemistry: Please check answers

    1. Which of the following compounds is an unsaturated hydrocarbon?
  8. Chemistry

    1. Which of the following compounds is an unsaturated hydrocarbon?
  9. O chem

    In lab we reacted 4-Methylcyclohexanol with sulfuric acid to give 4-Methylcyclohexene. We would expect 4-Methylcyclohexanol to only yield one product; however, the reaction produces isomers. This is not a case of a hydride shift or …
  10. Chemistry

    When comparing the boiling points of two compounds,one is a gas and the other is a liquid,is there anything like the liquid will have a lower boiling point than the solid?

More Similar Questions