chemistry

posted by .

An explosive whose chemical formula is C3H6N6O6 produces water, carbon dioxide, and nitrogen gas when detonated in oxygen. write the chemical equation for the detonation reaction of this explosive.

  • chemistry -

    C3H6N6O6 + O2==> H2O + CO2 + CO2 + N2
    You should be able to balance this.
    2C3H6N6O6 + 9O2 ==> 6H2O + 6CO2 + 6CO2 + 6N2

  • chemistry -

    your carbon atoms aren't equal and i didn't split up my carbon dioxides however it should change anything balancing wise.
    2C3H6N6O6 + 3O2==> 6h20 +6CO2(or 3CO2 +3CO2) + 6N2
    C=6 C=6
    H=12 H=12
    N=12 N=12
    O=18 O=18
    Hope this helps!

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Write a balanced chemical equation for nitrogen gas reacts with oxygen gas to produce nitrogen dioxide gas
  2. Chemistry

    Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical …
  3. Chemisry

    Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical …
  4. chemistry

    Write word equations for the following chemical reactions. a. Pure copper can be produced by heating copper(II) sulfide in the presence of diatomic oxygen from the air. Sulfur dioxide gas is also produced in this reaction. b. Water …
  5. Chemistry

    Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an …
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  8. Chemistry

    1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of …
  9. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water …
  10. Chemistry

    1. Hydrogen gas combines with oxygen gas to yield water. if 15 g O2 is present in the reaction, compute how much water will be produced. 2. Ten (10)grams methane gas combines with oxygen gas to form water and carbon dioxide. How much …

More Similar Questions