CHEMISTRY

posted by .

which one of the following reactions represents the balanced chemical equation for the formation of water from hydrogen gas and oxygen gas?

a. 2H(g) + O(g) a H2O(I)
b. H2(g) +o(g) a H2O(I)
c. 2 H2(g) + O2(g) a 2 H2O(I)
d. 2 H(g) + 1/2 O2(g) a H2O(I)

  • CHEMISTRY -

    See above.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Science/Chemistry

    Write a Balanced equation for the chemcial reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor. C2H2(g) + O2(g) ==> CO2(g) + H2O(g) It isn't balanced. I will leave that for …
  2. Chemistry

    give the balanced equation for: Liquid nitric acid decomposes to reddish brown nitrogen dioxide gas, liquid water, and oxygen gas. the equation i got was HNO3 --> NO2+ H2O+ O2 is that right?
  3. Chemistry

    The electrolysis (decomposition) of water produces hydrogen gas at the rate of 30.0 mL/min. A) Write a balanced chemical equation for this reaction and include phase designations. 2H2O(aq)---> 4H2(g)O2(g) Is whatever I've done above …
  4. Are my answers correct? Chem

    I really need help with balancing these equations: Can you check if my answer are correct?
  5. Chemistry

    Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an …
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and …
  8. Chemistry

    1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of …
  9. Science (chemistry)

    Write a balanced chemical equation and state the reaction type for each of the following reactions: a.) nitrogen gas reacts with hydrogen gas forming ammonia (NH3) b.) carbonic acid breaks down to form carbon dioxide gas and water …
  10. chemistry

    Hydrogen and oxygen gas combine explosively to produce water. Write a balanced chemical equation for this process. If 10 moles of hydrogen reacted with oxygen, what volume of liquid water could be produced?

More Similar Questions