What is the IUPAC name of the following compounds?
CH3
I
CH3CHCH2CH2CHCH2CH3
I
CH2CH3
To determine the IUPAC names of the given compounds, we need to number the longest carbon chain and identify any substituents.
For the first compound:
1. The longest carbon chain contains 7 carbons, so the parent chain will be heptane.
2. There is a methyl group attached to the second carbon, so it is named 2-methylheptane.
3. There is an iodine (I) atom attached to the third carbon, so it is named 3-iodo-2-methylheptane.
Therefore, the IUPAC name for the first compound is 3-iodo-2-methylheptane.
For the second compound:
1. The longest carbon chain contains 6 carbons, so the parent chain will be hexane.
2. There is an iodine (I) atom attached to the second carbon, so it is named 2-iodohexane.
3. There is an ethyl group attached to the fourth carbon, so it is named 4-ethyl-2-iodohexane.
Therefore, the IUPAC name for the second compound is 4-ethyl-2-iodohexane.
To determine the IUPAC name of a compound, we need to follow a set of rules provided by the International Union of Pure and Applied Chemistry (IUPAC). Let's break down the given compound into smaller parts and apply the rules step by step.
The compound can be written as:
CH3-CH(I)-CH2-CH2-CH(I)-CH3-CH2-CH3
Step 1: Identify the longest carbon chain.
Start by identifying the longest continuous chain of carbon atoms. In this case, we have a chain of 7 carbon atoms, so the root name will be heptane.
Step 2: Identify and number the substituents.
The substituents are the functional groups or side chains attached to the main carbon chain. In this compound, we have two methyl groups (CH3) and two iodine atoms (I) as substituents.
Number the carbon atoms in the main chain to give the substituents the lowest possible numbers. In this case, the substituents can be placed on carbon atoms 2 and 5.
The compound now looks like this:
CH3-CH(I)-CH2-CH2-CH(I)-CH3-CH2-CH3
Step 3: Assign locants to the substituents.
Since we have two substituents of the same type (methyl groups), we need to assign locants (numbers) to distinguish between them. In this case, we use the numbers 2 and 6 for the methyl groups.
The compound is now:
CH3-CH(I)-CH2-CH2-CH(I)-CH3-CH2-CH3
Step 4: Write the complete name.
Putting all the pieces together, we get the following IUPAC name for the compound:
2,6-diiodoheptane
Therefore, the IUPAC name of the given compound is 2,6-diiodoheptane.