CHEMISTRY

posted by .

OH

CH3-CH=C-CH-CH3

CH3

The OH is a single bond connected to the third Carbon and The CH3 is a single bond connected to the 4 Carbon HOW would name that?

  • CHEMISTRY -

    I would name it as
    3-hydroxy-4-methyl-2-pentene

  • CHEMISTRY -

    OH CH4 CH2 CH CH CH CH3 CH3
    CH5 CH4 CH5 CH4 CH CH CH 5 CH5
    CH1 CH3 CH2 CH2 CH2 CH3 CH3 CH2
    CH5 CH5 CH5 CH4 CH5 CH5 CH4 CH5

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry question

    this is considered to have asymmetrical carbons :ch3ch2ch(chlorine group is connected on bottom)Ch3 why isn't this one: ch3ch2ch (methyl group attach to it) ch3?
  2. chem

    The average bond enthalpy for a C=C double bond is 614kj/mol and that of a C-C single bond is 348kj/mol . Estimate the energy needed to break the pi bond in 2-butene. CH3 CH3 CH3 H \ / \ / C=C ------> C=C / \ / \ H H H CH3 Cis-2-butene …
  3. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane?
  4. Chemistry

    IGNORE MY FIRST POST. I CORRECTED THIS ONE Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2-dimethylpentane?
  5. Chemistry

    Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon?
  6. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 …
  7. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.
  8. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 …
  9. Chemistry

    Name the following compounds 1. CH3-CH=CH-CH2 l Cl 2. CH3-CH-C=(tripple bond)C-CH3 l CH3 3. Cl Cl l l CH = C-CH3 4. Complete the following reactions and name the products a. CH2-CH=CH3+Cl2>>>> b. CH3-C=C-CH3+Br2 >>> …
  10. CHEMISTRY PLEASE HELP

    Write an isomer of structure for a), b) and c) and name them. *(N.B- ! rep. a bond) a) CH3 ! CH3-CH2-C-CH2-CH3 ! CH3 CH3 ! b) CH3-CH2-CH-CH-C(TRIPLE BOND)CH ! CH2 ! CH3 c) 3,3,4-trimethyl-1-pentene

More Similar Questions