Chemistry

posted by .

I am currently balancing chemical equations. A few of them I am not sure if I correctly balanced or not, so could you check them over so I don't continue to do them wrong?

C3H8+O2 yields CO2+H2O. I balanced it as 1C3H8+5 O2+4H2O. If this isn't right, could you explain what's correct and why?

4Fe+3O2 yields 2 Fe2O3 is how I balanced Fe+O2. Is this right?

Thank you for your help.

  • Chemistry -

    C3H8+O2 yields CO2+H2O. I balanced it as 1C3H8+5 O2+4H2O. If this isn't right, could you explain what's correct and why?
    I think you omitted a 3CO2. It should be C3H8 + 5O2 ==> 3CO2 + 4H2O
    You don't need to place the 1 in front of C3H8. If we write C3H8, it is understood to be 1 unless some other coefficient is place there.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    Write the balanced camical equation for the complete combustion of propane C3H8, a fuel used in gas grills (carbon dioxide and water are products). This is the WRONG answer that I got... 2(C3H8) + 7(02) -> 3(CO2) + 8(H20) Can anybody …
  2. chemistry

    Hi can you help me balance these equations?
  3. Chemistry

    1. Al + Pb(NO3)2 ----> Al(NO3)3 + Pb 2. FeS + O2 ----> Fe2O3 + SO2 3. C3H8 + O2 ----> CO2 + H2O I need some help balancing these equations. Thank you very much!
  4. Chemistry

    here I have a (hopefully) balanced equation. Would you mind pointing out my errors, and explaining the right way to fix them?
  5. Chem

    Balancing equations? NaOH + H3PO4 ----> Na3PO4 + H2O C3H8 + O2 ----> CO2 + H2O
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  7. Chemistry

    Consider the burning of LPG (propane C3H8)which produces carbon dioxide (CO2) and water vapor (H2O). The balanced chemical equation involving the reaction is C3H8+5O2= 3CO2+4H2O Suppose 1.5 moles of C3H8 will be used, assume the following: …
  8. AP Chemistry

    Calculate the moles of CO2 formed when 4.2 mol of C3H8 react with 20.6 mol O2. Answer in units of mol. So, the balanced equation is C3H8 + 5 O2 ==> 3 CO2 + 4 H2O . I thought the answer would be 12.36 mol, but when I type it in it's …
  9. Science

    Are these equations balanced or unbalanced 6. 2AlN Yields 2Al+N2 Balanced 7.Mg(OH)2+2HCl Yields MgCl2+2H2O Balanced 8. K+H2O Yields H2+KOH Unbalanced
  10. chemistry

    Write a balanced chemical equation for the neutralization reaction between aqueous hydrochloric acid and aqueous calcium hydroxide. Be sure the formulas are written correctly before balancing, and include phases. HCl+H2CaO2 im not …

More Similar Questions