chem

posted by .

The average bond enthalpy for a C=C double bond is 614kj/mol and that of a C-C single bond is 348kj/mol . Estimate the energy needed to break the pi bond in 2-butene.


CH3 CH3 CH3 H
\ / \ /
C=C ------> C=C
/ \ / \
H H H CH3
Cis-2-butene Trans-2-butene

  • chem -

    Think about this. A single bond C-C is a sigma bond. The double bond is a sigma bond + a pi bond. So would the difference between energy of double bond and single bond be the pi bond?

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chem Urgent Help

    Plz explain in detail.... i tried to search on internet but i am confused with co-efficents.. how to set up the equaiton .. plz help me ?
  2. Chem

    Bond enthalpy is the energy required to break a mole of a certain type of bond. O=O = 495 kj/mol S-F = 327 kj/mol S=O = 523 kj/mol Use average bond enthalpies to estimate the enthalpy delta H (rxn) of the following reaction: 2SF4 + …
  3. CHem help pkz

    Bond enthalpy is the energy required to break a mole of a certain type of bond. O=O = 495 kj/mol S-F = 327 kj/mol S=O = 523 kj/mol Use average bond enthalpies to estimate the enthalpy delta H (rxn) of the following reaction: 2SF4 + …
  4. help plz

    Bond enthalpy is the energy required to break a mole of a certain type of bond. O=O = 495 kj/mol S-F = 327 kj/mol S=O = 523 kj/mol Use average bond enthalpies to estimate the enthalpy delta H (rxn) of the following reaction: 2SF4 + …
  5. Chemistry

    Using the bond entalpies ∆H: C---C: 348kJ C=C: 612 kJ C—C (triple bond) : 960 kJ C---H: 412 kJ H---H: 436 kJ Calculate the calculate the value of ∆H of reaction for H2C=CH2(g) + H2(g) → CH3—CH3(g)
  6. chemistry

    1998 scientists using a special type of electron microscope were able to measure the force needed to break a single chemical bond. If 2.0 x 10^-9 N was needed to break a C-Si bond, estimate the bond enthalpy in kJ/mol. Assume that …
  7. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 …
  8. Chemistry

    Please explain. The average bond enthalpy for the C-H bond is 412 kJ mol^-1. Which process has an enthalpy change closest to this value ?
  9. CHEMISTRY

    Please explain. The average bond enthalpy for the C-H bond is 412 kJ mol^-1. Which process has an enthalpy change closest to this value ?
  10. CHEMISTRY PLEASE HELP

    Write an isomer of structure for a), b) and c) and name them. *(N.B- ! rep. a bond) a) CH3 ! CH3-CH2-C-CH2-CH3 ! CH3 CH3 ! b) CH3-CH2-CH-CH-C(TRIPLE BOND)CH ! CH2 ! CH3 c) 3,3,4-trimethyl-1-pentene

More Similar Questions