Chemistry

posted by .

Hey Everyone I was wondering how I could write the condensed structural formula for the following organic chemicals:
1. 2,3-dimethyl-2-butene

2. 4-ethyl-2-hexyne

3. 3,3,6-trimethylnonane

4. 3-ethyl-4-prophylheptane

5. 3-octanol

6. 2-methyl-2-pentene

7. 5-methyl-1-hexene

8. 2,2,4,5-tetramethylhexane

9. propanoic acid

10. 2-pentyne

Thank you so much.

  • Chemistry -

    A lot of questions for one post. What don't you understand about writing the formulas of these compounds? 3-octanol is CH3CH2CHOHCH2CH2CH2CH2CH3.
    2-pentyne is
    CH3C(triple bond)CCH2CH3.
    Check my thinking.

  • Chemistry -

    would 1. be CH3C(CH3) Double bond C(CH3)CH3

  • Chemistry -

    or CH2 double bond C(CH3)CH(CH3)CH3

  • Chemistry -

    The basic structure is 2-butene; therefore, the double bond must go AT the 2 carbon so it's between the 2 and 3 C. 1-butene would be CH2(double bond)C etc..
    So your first answer is correct.

  • Chemistry -

    Thank you

  • Chemistry -

    1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

  • Chemistry -

    1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

  • Chemistry -

    1. CH3C(CH3)=C(CH3)CH3
    2. CH3C(triple bond)CCH(C2H5)CH2CH3
    3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3
    4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3
    5. CH3CH2CHOHCH2CH2CH2CH2CH3
    6. CH3C(CH3)=CHCH2CH3
    7. CH2=CHCH2CH2CH(CH3)CH3
    8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3
    9. CH3CH2COOH
    10. CH3C(triple bond)CCH2CH3

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Organic Chemistry

    How do I draw the condensed formula for: 1. 2,3-dimethyl-2-butene 2. 4-ethyl-2-hexyne 3. 3,3,6-trimathylnonane 4. 3-ethyl-4-propylheptane 5. 3-octanol
  2. Organic Chemistry

    How do I draw the condensed formula for: 1. 2-methyl-2-pentene 2. 5-methyl-1-hexene 3. 2,2,4,5-tetramethylhexane 4. propanoic acid 5. 2-pentyne
  3. chemistry

    Which of the compounds below exhibit geometric isomerism (cis-, trans-)?
  4. Organic Chemistry

    2-methyl-2hexanol is reacted with sulfuric acid at around 800C. The two products formed are 2-methyl-1-hexene (19%) and 2-methyl-2-hexene (81%). Show the chemical equation for this reaction. Explain fully why 2-methyl-2-hexene is the …
  5. Organic chemistry

    In Hydration of 2-Ethyl-1-Butene which is the major product and which is the minor product?
  6. Ferdinand Marcos University

    What are the condensed structure of each of the following: a.)2-pentene b.)1chloro 3 metyl 2 -pentene c.)3 methyl 1 butyne d.)2,3dimethyl pentane e.)2 ethyl 1 methyl hexane
  7. Ochem

    Which Alkene is capable of stereoisomerism: 1-pentene, 2-methyl-1-pentene, 2-methyl-2-pentene, 2-pentene, or 2,3-dimethyl-2-butene?
  8. CHEMISTRY PLEASE HELP

    Write an isomer of structure for a), b) and c) and name them. a) 3,3-dimethylpentane b)3-methyl-4-ethyl-1-hexyne c)3,3,4-trimethyl-1-pentene
  9. chemistry

    Outline the following synthesis: a) 2 – methyl propene -> 2-methyl-2-propanol. b) 3 –ethylpentene -> carbon dioxide, water and 2-ethylbutanoic acid. c) 2 methyl-2-pentene -> 2-chloro-2-methylpetane and 3-chloro-2-methylpentane …
  10. chemistry

    Write the condensed structural formulas for the following alcohols."" Correct the incorrect names."" 4-methyl-1-pentanol 2-methyl-2-butanol 3-ethyl-1-butanol 2, 2-diethyl-4-pentanol 3-ethyl -2-hexanol IS THERE ANY WRONG NAMES?

More Similar Questions