Chemistry

posted by .

What is the chemical equation for the combustion reaction between methanol and air?

CH4 + O2 ==> CO2 + H2O.

All hydrocarbons produce CO2 and H2O when they are combusted in air. The above equation isn't balanced. I assume you can do that? If not, ask OR take a shot at it and I can tell you if it is correct.

Whats CH4? Isn't methanol CH3OH?

Well, you are SO right and I am SO confused. Of course methanol is not CH4 (methane). The products still are the same. Trust me, that's right. :-)).
CH3OH + O2 ==> CO2 + H2O

The equation is not balanced.

2 CH3OH + 3 O2 → 2 CO2 + 4 H2O
So would that be right?

yes, that is balanced.

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. Chemistry

    write a balanced equation for the combustion of benzene. All hydrocarbons, like benzene are, are the same. Add O2. C goes to CO2 and H goes to H2O. C6H6 + O2 ==> CO2 + H2O I will let you balance it. Let me know if you have a problem …
  2. chemistry 1

    When butane undergoes complete combustion , the products are CO2 and H2O C4H10(g) + O2(g)-> CO2(g) + H2O(g) What is the value of the coefficient for oxygen when this equation is balanced
  3. chemistry

    During combustion, methine yeilds carbon dioxide and water. the unbalanced equation for this reaction is : CH4(g)+O2(g)>CO2(g)+H2O(i) what will the mole ratios for the balanced equation be?
  4. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas …
  5. chemistry

    3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant?
  6. Chemistry

    If 0.50L of gaseous CH4 is burned at STP, what volume of O2 is required for complete combustion?
  7. Science

    The combustion of methane in a laboratory burner is represented by the following equation: CH4 + 2 O2 > CO2 + 2 H2O Given the following three thermochemical equations: C + H2 > CH4 H=-74.87kJ C + O2 > CO2 H= -393.5 2 H2 + …
  8. help

    Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction?
  9. chemistry

    The combustion of 1.210 g of a mixture of CH4 and C2H6 gives 3.372 g of CO2 I have to determine the composition of the mixture (mastic %) and molar fraction of CH4 in the mixture CH4 + C2H6: CO2 + 2H2O C2H6 + O2: CO2 + H2O CH4 + C2H6 …
  10. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this …

More Similar Questions