organic chemistry!

posted by .

Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural formulas for the following as well..I don't think most of them are right...

1) CH3CH2CH2CH(CH3)CH3 (2-propylpentane)

2) CH3CH(C2H5)CH2CH3 (3-ethylbutane)

3)CH3CH2CHClCH2CH2CH2CH2Cl
(dichlorooctane)

4)CH3CH2CH2CH2OH (propylbutanol)

5) CH3CH2CH2CH2COOH
(propylpentanoic acid)

6) CH2=C(CH3)CH2CH(CH3)CH3
(2,4-dipropylpentene)

7) (CH3)2CHCl (chloropropane)

8) CH3C(CH3)2CH2C(CH3)2CH2CH2CH3
(4,6-tetramethylheptane)

9) CH3C(CH3)2CH=C(CH3)CH2CH3
(2,4-tripropylhexane)

10) CH3C(triple bond)CCH3 (methylbutyne)

Please let me know if I am doing this right..thanks..



1. 2-methylpentane
3. 1,4-dichloroheptane
6. 2,4-dimethylpentene
7. (not sure about this one) t-chlorobutyl
9. 2,4-trimethylhexene

-CH3 substituent is methyl not propyl.

number 9: it is an alkene, so it should have a "ene" on the end, not "ane"

Yes if it is an alkene it should have an "ene" at the end not an "ane".

  • organic chemistry! -

    here's what i got..

    1. 2-methylpentane
    2. 2-ethylbutane
    3. 1,5-dichloroheptane
    4. butanol
    5. pentanoic acid
    6. 2,4-dimethylpentene
    7. 2,2-chloropropane
    8. 2,2,4,4-tetramethylheptane
    9. 2,2,4-trimethyl-3-hexene
    10. 2-butyne

    hope this helps!! even though, i'm sure you're done with this worksheet by now.
    <3

  • organic chemistry! -

    thanks a ton! You saved me.

  • organic chemistry! -

    I LOVE U

  • organic chemistry! -

    1. 2-methylpentane
    2. 3-methylpentane
    3. 1,5-dichloroheptane
    4. 1-butanol
    5. Pentanoic Acid
    6. 2,4-dimethyl-1-pentene
    7. 2-chloropropane
    8. 2,2,4,4-tetramethylheptane
    9. 2,2,4-trimethyl-3-hexene
    10. 2-butyne

  • organic chemistry! -

    i HAVE A QUESTION/
    WHAT IS THIS
    i-PrCl ????

  • organic chemistry! -

    why is number8 2,2,4,4

Respond to this Question

First Name
School Subject
Your Answer

Similar Questions

  1. chemistry

    what are 4 chemical properties of organic compounds?
  2. Chemistry

    Compound 1 / Compound 2 / O " CH2 = CH - CH - OH + CH3 - CH - CH2 - C ' ' ' CH3 CH3 OH i) Identify any functional groups in Compounds 1 and 2 and name them. ii) Complete the equation for reaction 1 by drawing the abbreviated structural …
  3. Chemistry

    Compound 1 Compound 2 O || CH2=CH-CH-OH + CH3-CH-CH2-C | | | CH3 CH3 OH | | ?
  4. Science

    What is the difference between organic and inorganic compounds?
  5. biology

    identify what all organic compounds have in common,and list the four principal classes of or organic compounds
  6. 9th grade SCIENCE

    I have to list 5 different organic compounds; list different types for each; name; structure; properties; and uses. I am a bit confused as to what an organic compound actually is. I know it must contain a carbon, but would vegetables …
  7. Chemistry

    For each definition, find a corresponding term from the following list: alkane,alkene, alkyne, alcohol, ether, aldehyde, ketone, carboxylic acid, ester, amine, fuctional group, isomers. a. Organic compounds with identical molecular …
  8. Chemistry

    Draw all the possible condensed structural formulas for the organic compounds with 6 carbon atoms that have a 4-carbon chain. [I don't know how to draw condensed structural formulas with a branch on it or how this type of structure …
  9. OChem

    1. if and when boiling points can be used to determine the purity of organic compounds. 2. if and when boiling points can be used to identify organic compounds. 3. when can fractional distillation be used to separate organic compounds
  10. SCIENCE

    1. Multiple choice: why is it uncommon to draw lewis diagrams for ionic compounds?

More Similar Questions