Questions Asked on
November 3, 2018

  1. Social studies

    What factors helped the economies of the Muslim empires prosper?

    asked by thepersonwhoneedshelp
  2. world History

    Which option accurately describes the role of trade during the Age of Discovery? 4. Explorers such as Ferdinand Magellan sought to trade for coffee and tea from the Inca Empire. 1. Explorers such as Amerigo Vespucci sought to trade for guns from China. 2.

    asked by Honey
  3. History

    Which most accurately describes consequences of the Renaissance in Europe? A. The Renaissance led to the Catholic Church having a monopoly on literacy and interpretation of the Bible. B. The Renaissance gave rise to the Protestant Reformation and reduced

    asked by Fish
  4. social studies

    what was Xuanzang's accomplishment?

    asked by thepersonwhoneedshelp
  5. social studies

    What was Muhammad's role in establishing and spreading islam?

    asked by thepersonwhoneedshelp
  6. World history

    Which religion was dominant in the Ottoman Empire during the Middle Ages?

    asked by Honey
  7. Chemistry

    Which contains more solute particles a 0.10 M aqueous solution of methanol (CH3OH) or a 0.10 M aqueous solution of table salt (NaCl)? Are we supposed to go M*L=moles*(6.022*10^23 solute particles)

    asked by Felix
  8. Social studies

    Which of the following was the Delhi sultanate? A. it was the government of the Mongols in india B. it was the government in the Gupta Empire C. It was the government of the Chola empire D. it was the government of the Muslim Turks in india

    asked by thepersonwhoneedshelp
  9. Chemistry

    Hydroxyapatite, Ca10(PO4)6(OH)2Ca10(PO4)6(OH)2 , has a solubility constant of Ksp = 2.34×10−592.34×10−59 , and dissociates according to Ca10(PO4)6(OH)2(s) --> 10Ca2+(aq) + 6PO4^3-(aq) + 2OH-(aq) Solid hydroxyapatite is dissolved in water to form a

    asked by TS
  10. Science

    Which of the following is an example of a nonpoint source of freshwater pollution A. Pesticide runoff from farm fields B. Leaking toxic waste landfill C. Sewage treatment plant D. Factory waste piped into a stream*

    asked by Caleb
  11. math

    two observers P and Q, 75 metres apart observes a kite (k) in the same vertical plane from the same side of the kite. The angle of elevation of the kote from P and Q are 35° and 95° respectively find the height of the kite to the nearest metre?

    asked by ayomide
  12. social studies

    By what means did Zhou rulers keep control over all the different regions of their kingdom? A. by keeping a strong army ready to put down any rebellion B. by treating the people with kindness and respect C. by starting a civil service based on the ideas of

    asked by unknown
  13. social studies

    need help now ms sue Why did the ancient Chinese make loud noises at festivals and during holiday celebrations? A. to show loyalty to the emperor B. to celebrate their blessings C. to awaken the spirits of their ancestors D. to chase away evil spirits

    asked by unknown
  14. History

    This is for a portfolio that is way overdue, so if I can get some help it'd be great. In what present-day countries can the sites of your civilizations be found? Chosen civilizations: Ancient Egypt, Mesopotamia Thanks :3

    asked by Vixen - Connexus
  15. physics

    A car travels 3km due North, then 5km East.Represent these displacements grafically and determine the resultant displacement

    asked by Abdulhakim
  16. History

    Why did Santa Anna decide to attack the Alamo? A. It had a supply of gold. B. It was an important strategic location. C. It was his family's ancient homeland. D. It would ensure a glorious victory.

    asked by Wednesday_my_dudes
  17. statistics

    Problem 2. Hypothesis test between two coins5 points possible (graded)Alice has two coins. The probability of Heads for the rst coin is , and the probability of Heads for the second is . Other than thisdierence, the coins are indistinguishable. Alice

    asked by andi
  18. physics

    A ball of mass 0.5kg is dropped from a height of 10m and rebound with a velocity 1/3 of that before impact. The height reached after rebound is?

    asked by Kehinde Emmanuel
  19. Texas History

    Who wrote a letter from the Alamo? Describe the letter. What was he asking for in the letter? How many Mexican soldiers did he say were holding them under siege? Who was the leader of the Mexican troops and what did he demand? All I have is that William

    asked by ILTHSM_
  20. math

    salesman is paid a commission of 2% on goods sold worth over Ksh 100 000. He is also paid a monthly salary of Ksh 12 000. In a certain month, he sold 360 handbags at Ksh 500 each. Calculate the salesman earnings that month Total earned = salary +

    asked by kd
  21. Mathematics

    How to prove that the {The integral with limit a to b *(the integral with limit x to b f(t)dt}dx=integral with limit a to b (x-a)f(x)dx Help..

    asked by Buh
  22. Civic education

    Mention ways by which government can protect the interests of their followers

    asked by Edward francisca.
  23. math

    The sum of Lisa's age and Myra's age is 19. In 10 years, Lisa will be 5 years older than Myra. How old is each girl now?

    asked by Alice
  24. Texas History

    Was it a victory or a defeat, how many Texans died, were the Texans outnumbered, and how the Battle of the Alamo inspire the Texans? I already have the first question answered. I'm not sure about the other questions.

    asked by ILTHSM_
  25. science

    An aeroplane flies horizontally at 80m/s in still air. If the aviator wishes to fly due south and the wind is blowing from the south-east at 30m/s, 1. what course must he steer. 2. how long will it take him to arrive at his destination 200km away.

    asked by Alfred
  26. Math

    A g.p has 8 terms.If the sum of first 4 terms is 45 and the sum of the last 4 term is 720, find the common ratio and the first term.

    asked by subash
  27. math

    9/1-7/11 with work thank you i dont understand how i get the mixed number 8 4/11

    asked by somayee
  28. Math

    Ms. Jones borrows 3.120M for 5.5% interest compounded monthly. What is the periodic payment needed after 15yrs?

    asked by Kat
  29. Science

    1. How do machines make work easier? 2. How do you calculate work (what is the formula for work?) 3. What is the formula for mechanical advantage? 4. How does friction impact work?

    asked by Khaliyl R Testman
  30. science

    What is the molecular structure of water? What are the physical and chemical properties of water?

    asked by somayee
  31. math

    line a is parallel to line b and m ∠ 18 = 42. Find m ∠ 20.

    asked by 2 + 2 =
  32. Math

    A man will deposit 6750 in a fund at the end of each 6 months for 10 yrs. Find the size of the fund at the end of 3 yrs if it is invested at 4% compounded semi annually.

    asked by Lopee
  33. Math

    Granda's soup company packages soup that serves 4 in cylindrical cans having a base diameter of 8cm and a height of 10cm. It wants to introduce the soup in single serving cans. If the company keeps the height of the new can at 10cm, what should its new

    asked by John
  34. Math

    What is pi

    asked by Hayy
  35. Math

    Mr Smith paid $30,000 for a rectangular lot 1,200 feet wide and 1,600 feet long. What is the approximate cost per square foot? Please show work so I can understand the problem... Thank you

    asked by John
  36. Math - Algebra

    What is the value of the greatest of four consecutive integers if the least minus twice the greatest equal 8? Please show the work so I can understand how to complete the problem - thank you

    asked by John
  37. history

    Because every day Americans vote on representatives who in turn vote on legislation, rather than Americans voting on issues directly, our system of government is known as a _____________. republic nation constitutional monarchy democracy The 3/5ths

    asked by lydia
  38. Chemistry

    Thallium(I) hydroxide is a strong base used in the synthesis of some organic compounds. Calculate the pH of a solution containing 2.57 g TlOH per liter. I got 1.44 but I'm pretty sure that's wrong?

    asked by maath
  39. Physics

    A tennis ball machine fires a ball vertically upwards at time t=0 at 19.6 m/s. Assume that air resistance is negligible and take g=9.8 m/s^2. Calculate the displacement and velocity of ball at t=1 s.

    asked by Chernet
  40. Math

    In a concert hall, 60% of the seats were taken. 520 seats were empty. What is the total number of seats in the concert hall?

    asked by Gary
  41. Math

    Find the net single premium for a 50,000 policy issued to a 35 y/o woman using 5 yr term.

    asked by Hou
  42. Math

    To provide 250,000, Marlou decided to place equal deposit in a fund at the end of each 6 months. A money is invested at 6% converted semi annually. Find the periodic deposit into the sinking fund at the end if 5 years

    asked by Clammy