Questions Asked on
November 14, 2017

  1. Maths

    Lynn invites some friends for lunch. She needs to cater for 24 people. She decides to make pancakes. How much milk does Lynn need to use

  2. Calculus

    In a 21 meter race between a turtle and a hare, the turtle leaves 8 minutes before the hare. The hare, by running at an average speed of 0.5 meters per hour faster than the turtle, crosses the finish line 4 minutes before the turtle. What are the average

  3. math

    The bearing of A and B from a port p are 225 degree and 116 degree respectively.ship A is 3.9 km from ship B on a bearing of 258 degree. Calculate the distance of ship A from p

  4. Maths

    A student spent 2 /9 of his pocket money on beverage and 1 /4 on books. What? fraction

  5. Math

    In a class, 2/7 of the pupils are girls. 1/2 of the girls and 1/3 of the boys in the class wear glasses. If 10 boys wear glasses, how many of the girls wear glasses?

  6. Math

    A playground is being designed where children can interact with their friends in certain combinations. If there is 1 child, there can be 0 interactions. If there are 2 children, there can be 6 interactions. If there are 3 children, there can be 15

  7. Physics

    Fig.19 shows a crane lifting a car of mass 850 kg at constant velocity through a height of 12m in a time of 40s. The crane has a working efficiency of 60%. i) Calculate the tension in the lifting cable (in N) ii) Calculate the total input power required by

  8. Math

    1.The actual distance between two cities is 135 km the map scale is 1 cm:100 km. Find the map distance. A)13.5 B)1.35////My answer//// C)0.135 D)1350 2. On a map of New Mexico, 1 cm represents 45 km. The distance from Albuquerque to Santa Fe is 2 cm. Find

  9. Math

    A printer can print 68 lines per minute. How many lines can it print in an hour?

  10. Can someone help me SS

    How can the constitution be amended?? I don't understand?

  11. Physical Science

    Hi! Thanks for checking my question out! ____ 1. Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? (1 point) a) CH4 + O --> H2O + CO2 b) CH4 + 4O --> 2H2O + CO2 c) CH4 + O2

  12. Algebra

    Find the volume of the rectangular prism with the dimensions 11 by 9 by 3. 23 in 297 in 318in 159in I think the answer is c 318 in.

  13. physics

    What is the average useful power output of a person who does 5.50×106 J of useful work in 6.50 h? Working at this rate, how long will it take this person to lift 1850 kg of bricks 1.20 m to a platform? (Work done to lift his body can be omitted because it

  14. math

    Sarah bought 18 eggs from the store. How many dozen eggs did she buy? (1 dozen = 12) 1+1/2** 1+1/3 1+1/4 1+1/6

  15. Chemistry

    Ytterbium, atomic number, 70 is the first element in the periodic table to have the first four shells full. work out the number of electrons in the fourth shell/ level of ytterbium? Please show all working out with no abbreviations and please help

  16. Calculus

    If egg yolks have a pH of 64 then what is the pH of egg whites if they are 63 times more alkaline

  17. Math

    I the question is simple but I haven't done fractions in a while. So check my answer please. Are and equivalent fractions? A. No B. Yes, because both fractions are divisible by 2.**** C. Yes, because the difference between the denominator and numerator in

  18. Chemistry

    A compound is 85.6% carbon by mass. The rest is hydrogen. When 10.0 g of the compound is evaporated at 50.0 ∘C, the vapor occupies 6.30 L at 1.00 atm pressure. What is the molecular formula of the compound?

  19. Math

    The table shows how many miles Jack ran per week for weeks one through nine. x y 1 3 2 5 3 6 4 9 5 10.5 6 13 7 15 8 16 9 19 Question: a. Use the table to plot the points. b. Describe the correlation, including whether it is strong or weak. c. Draw a line

  20. Chemistry

    At room temperature, 20° C, water (H2O) is a liquid and oxygen (O2) is a gas. Based on kinetic molecular theory, which answer best explains the states of the two fluids? aThe particles in the liquid have greater kinetic energy than the particles in the

  21. New Mexico State History

    Where did the most immigrants to the United States come from prior to the Civil War? Please help!

  22. Math helppp

    Sin 8theta -sin 10theta= cot 9theta (cos 10theta - cos 8 theta)

  23. As physics

    A cyclist moves along a horizontal road. She pushes on the pedals with a constant power of 250W. The mass of the cyclist and bicycle is 85kg. The total drag force is 0.4V^2, where v is the speed of the cyclist. i) Calculate the energy provided by the

  24. UWI

    Problem The data entry clerk is requirTom’s Paper Company Ltd wants to produce a payroll register using a program.ed to enter data for each employee, which comprises of: the employee number (integer), the employee last name (string), the hours

  25. math

    Question 7 The first three terms of a geometric sequence are as follows. 10,30,90

  26. Science

    1. what is a single replacement reaction A. A reaction in which two or more substances react to form a single substance*** B. A reaction in which one element takes place the place of another element in a compound. C. A reaction in which a compound breaks

  27. Math (Helping my brother)

    Kyle types college reports for $2.15 per page. He also charges $5 to cover the cost of supplies. Write an expression for total earnings for typing a report of p pages. Then evaluate the expression for a 28-page report. A) 2.15p + 5; $60.20 B) (2.15 + 5)p;

  28. English

    1. He no more runs fast. 2. He can no more fast. 3. He is no more a baby. 4. He runs fast no more. ------------------------- What about the word order of 'no more'? #1,2,and 3 seem to be correct. What about #4? Can we put 'no more' at the end of a

  29. yoyo

    At room temperature, 20° C, water (H2O) is a liquid and oxygen (O2) is a gas. Based on kinetic molecular theory, which answer best explains the states of the two fluids? a The particles in the liquid have greater kinetic energy than the particles in the

  30. physics

    when a tennis ball is served, it is a contact with the racket for a time that is typical 0.005 seconds. find the force needed to serve a 60.0 gram tennis ball moving with a velocity of 30.0m/s

  31. physics

    How much work is done by the boy pulling his sister d = 25.0 m in a wagon as shown in figure below? Assume no friction acts on the wagon and he pulls with a force of 65.0 N and at an angle θ = 31.0°.

  32. physics

    Two children push on opposite sides of a door during play. Both push horizontally and perpendicular to the door. One child pushes with a force of 16.4 N at a distance of 0.590 m from the hinges, and the second child pushes at a distance of 0.470 m. What

  33. World geography

    Which term below does not describe a world climate region? A: tropical B:polar C:continental D:inland In a humid continental climate region, to what conditions would plants and animals have to be adapted? A:cool summers and very cold winters B: mild

  34. physics

    Two workers are sliding 450 kg crate across the floor. One worker pushes forward on the crate with a force of 380 N while the other pulls in the same direction with a force of 380 N using a rope connected to the crate. Both forces are horizontal, and the

  35. science

    1. The breaking down or disintegration of substances such as rocks and minerals by physical, chemical, or biological processes is called- A Erosion B Weathering*** C Climate D Deposition 2. When particles carried by water, ice, or wind are dropped in

  36. chemistry

    I think it is a trick question as I can not balance this equation . Balance this equation Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2

  37. science

    At room temperature, 20° C, water (H2O) is a liquid and oxygen (O2) is a gas. Based on kinetic molecular theory, which answer best explains the states of the two fluids? aThe particles in the liquid have greater kinetic energy than the particles in the

  38. Chemistry

    bromine has two isotopes Br,79 and Br-81 the relative atomic mass of bromine is 79.9 calculate the percentage or br 79 atoms in a sample of bromine show all working out with all equations used and no abbreviations please

  39. Physics

    A hula Hoop (I=1/2MR^2) rolls without sliding along the floor. The ratio of its translational kinetic energy to its rotational kinetic energy (about an axis through its center of mass) is: A. 1 B. 2 C. 3 D. 1/2

  40. Consumer Math

    Your car insurance is paid quarterly( every 3 months). If your payment is $163.92, How much should your estimated monthly expense be? A. $40.00 B. $55.00* C. $110.00 D. $220.00

  41. Civics practice history

    Which of the following provides the definition of a nation?

  42. Quantitative Aptitude

    6y=3=3 2y=2=2 9x=2=2 7x=2=2 5x= 12y= 13x= 6y=

  43. Chemistry Help

    For the reaction 2HI(g) H2(g) + I2(g), Kc = 0.0198 at 721K. What is the HI concentration at 721K if [H2] = 0.120 M and [I2] = 0.0150 M? I'm getting .303 M but that's not one of the options.

  44. Algebra

    Dylan has 765 cards in his baseball card collection. He sells 153 of the cards. What is the percent of decrease in the number of cards in the collection?

  45. Math help

    i JUST need help with this question. 16. Elizabeth and Sara were at a carnival. They each got a ticket for the Ferris wheel. Ella got a snow cone, and Margaret got a cotton candy. Ella had a certificate for $5.50 off the cost. Margaret paid the rest, which

  46. Math

    You earn 10 points for every coin you collect in a video game. then you find a star that triples your score. a. write an expression for the number of points you earn from the coins. b. write and simplify an expression for the total number of points you

  47. Ela

    How are troulble with the telvesion by Robert macneil and no promise in the wind Irene hunt alike

  48. physics

    A car with a 65cm diameter wheel travels 3.0km. How many revolutions does the wheel make in this distance?

  49. Math

    Dylan has 765 cards in his baseball card collection. He sells 153 of the cards. What is the percent of decrease in the number of cards in the collection? i'm Lost I've been trying for about a good 20 minutes

  50. HELP

    5-(7+6)2

  51. Social Studies

    What did King George III do during the american revolution? How did loyalists and patriots feel about him?

  52. Chemistry Help

    For the reaction 2HI(g) H2(g) + I2(g), Kc = 0.0198 at 721K. What is the HI concentration at 721K if [H2] = 0.120 M and [I2] = 0.0150 M? I'm getting .303 M but that's not one of the options.

  53. Physics

    A tetherball apparatus consists of a ball attached to a 2.10 m rope that is attached in turn to the top of a 3.10 m tall pole. The ball is struck such that it moves horizontally around the pole. Immediately after the ball is struck, it moves at 5.57 m/s,

  54. math

    If a scientists is looking at a circle of 1.15 millimeters in diameter, how much of the circle can he see in centimeters?

  55. Ed Tech Connexus

    1.in Microsoft®️ execel graphs are refered to as? a. sparklines b. illustrations c. tables d. charts 2. What is one of the strengths of line graphs? a. line graphs show percentage of a whole b. line graphs show change over time c. line graphs compare

  56. Physics

    With her bare hands and her arms rigidly extended, a girl catches a 0.16kg baseball coming directly at her at speed of 25m/s. She shouts, “Ouch!’ because the ball stings her hands. She learns quickly how to move her hands with the ball as she catches

  57. Math

    Which digit(s) makes 3,71[_] divisible by 3? I don't need help with the answer but what is [_] or is the _ for the missing number?

  58. English

    1. He made a promise with her. 2. He made a word with her. 3. He kept his promise with her. 4. He kept his word with her. 5. He made/kept/broke an appointment with her. ------------------------ Can we use all the words such as promise, word, appointment in

  59. Math

    Carolina runs 3 1/2 miles in 22 1/4 Minutes. how many miles does she run per minute A.) 3/22 mike per minute B.) 62/221 mile per minute C.) 14/89 mike per minute D.) 4/39 mike per minute

  60. math 7/8 grd

    d+s ˃ -3 d˃-7 find s the answer supposed to be 4, but I think it is not correct, because depending on d it might be pretty much anything.. any thoughts?

  61. science

    A powerpoint about four landforms

  62. Math

    Nasreen is designing an obstacle course that includes two ladders leaning against a pole. In order for the ladders to fit in the obstacle course, one ladder must span 1.6 m horizontally and the other must span 5 m horizontally. She already has one 4.3-m

  63. physics

    A 77.6 kg ice skater is skating along in a straight line (in the positive direction) at 10.3 m/s when he bends down and scoops up his 27.4 kg doggy sitting still on the ice. What will be the new velocity of the dog-n-skater?

  64. GSPRITE

    1.what does economy have to do with money?explain.2.how does geography impact people.3.name a person who had impact on the world/society? Explain how.4.name two types of technology that have changed the world and explain how.5. identify 2 groups of people

  65. physics

    Calculate the force needed to bring a 1070–kg car to rest from a speed of 89.0 km/h in a distance of 110 m (a fairly typical distance for a non-panic stop). Suppose instead the car hits a concrete abutment at full speed and is brought to a stop in 2.34

  66. physics

    Suppose a 300–g kookaburra (a large kingfisher bird) picks up a 77.0–g snake and raises it 2.70 m from the ground to a branch. How much work did the bird do on the snake? How much work did it do to raise its own center of mass to the branch?

  67. Science

    Which of the following functions like a fulcrum in a lever? A:tendons connecting a muscle to a bone at a joint. B:ligaments connecting bones at a joint. C:two muscles working as a pair to move a joint. D: two bones meeting at a joint. I think the answer is

  68. physics

    In the nail puller shown in the figure below you exert a force 53.2 cm from the pivot and the nail is 1.50 cm on the other side. What minimum force must you exert to apply a force of 1380 N to the nail to pull the nail up?

  69. New Mexico State History

    How did the constitution most likely encourage immigration? A. By guaranteeing individual rights and freedoms B. By opening the nation to unlimited immigration C. By enshrining the density of Manifest density D. By promising land to all new citizens Please

  70. Pre algebra

    Expression in simplest form that represents the perimeter of a polygon that is 8cm 9x 8cm 9x

  71. physics

    When opening a door, you push on it perpendicularly with a force of 55.4 N at a distance of 0.728m from the hinges. What torque are you exerting relative to the hinges? (Does it matter if you push at the same height as the hinges?)

  72. algebra

    if f(x) = 5x + 4 find f(1)

  73. physics

    A supertanker (mass = 1.57E+8 kg) is moving with a constant velocity. Its engines generate a forward thrust of 7.47E+5 N. Determine the magnitude of the resistive force exerted on the tanker by the water.

  74. Spanish

    Write a short paragraph explaining some details about school practices and/or activities in schools in the Spanish-speaking world. I am a bit confused about what they mean for the activities, do they want after school Spanish activities or what?

  75. Science

    If a substance is a mineral, how could you identify what type of mineral it is? help me!!

  76. Reading

    3. Read the following sentence. The interactable child could not be persuaded o follow the rules. The lating root -tract- means "to draw"or "to pull" Given the meaning, what can you conclude is is the best definition for the word intractable as it is used

  77. English

    1. He never failed to keep his word. 2. He never failed to keep the word. 3. He never failed to keep a word. 4. He made a word with her. 5. He had a word with her. -------------------------------------- I could see the pattern such as break one's word,

  78. math 7/8 grd

    d+s ˃ -3 d ˃ -7 find s it says the answer is 4 (s=4) but it seems not ok because depending on d the number can be pretty much anything

  79. Social studies

    What are major differences between ancient Aksum and modern day Ethiopia???? Need help fast!!!!!!

  80. scince

    Which of the following is not an example of a physical property of a substance? density combustion solubility freezing point thx

  81. Chemistry

    If you dilute 19.0 mL of the stock solution to a final volume of 0.350 L , what will be the concentration of the diluted solution?

  82. physics

    A supertanker (mass = 1.57E+8 kg) is moving with a constant velocity. Its engines generate a forward thrust of 7.47E+5 N. Determine the magnitude of the resistive force exerted on the tanker by the water.

  83. Studying

    Hey guys, I would appreciate it if y'all took some time to answer this for me. Thanks ahead of time!! I am involved in many difficult High School courses, and I also am a team member of the school academic team, and I was wondering if any of you had any

  84. science

    When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration, expressed as a percent by mass? 4.8% NaBr 5.5% NaBr 5.8% NaBr 6.2% NaBr

  85. calculas for economics

    If the demand function=9000-30p and the cost function=90000+30x then find break even point

  86. physics

    A car with a 65cm diameter wheel travels 3.0km. How many revolutions does the wheel make in this distance?

  87. U.S.

    During his presidency, Thomas Jefferson cut prices on land and encouraged westward settlement. What was Jefferson's motive for doing these things? He was seeking to cut military spending. He had a vision of a more agrarian society. He wanted to increase

  88. Math/calculus

    Prove Sin 8theta -sin 10theta= cot 9theta (cos 10theta - cos 8 theta)

  89. Physics

    A charged capacitor,C=10e-6 F, with an initial stored energy of 3.5J, is discharged across a resistor, R. The charge on the capacitor drops to 40% of its maximum value in time, t=8.2s, from the instant the switch is closed (t=0). Find the current through

  90. Math

    Mary wants to buy some new shoes that cost $95. She also wants to buy some packages of socks. Each package of socks costs $8. She has a total of $127 dollars. Write and solve an equation to find how many packages of socks she can buy

  91. Geography

    Which phrase is an example of a biome? Suburban neighborhood Mediterranean climate Mississippi river Coniferous forest Which statement about wind is not true ? Wind direction is affected by the earths rotation Winds at about 30° north and south latitudes

  92. Statistic

    the life span of a calculator manufactured by the intel corporation has a normal distribution with a mean of 54 months and a standard deviation of 8 months. The company gurantees that any calculator that start malfunctioning within 36 months of the

  93. Chemistry

    Calculate the molecular mass of sulphur if 35 gram of sulphur dissolves in 100 gram of CS2 to produce a solution that has a boiling point of 49.48°C

  94. SCIENCE

    When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration, expressed as a percent by mass? 4.8% NaBr 5.5% NaBr 5.8% NaBr 6.2% NaBr

  95. geometry

    I don't want the answer I want to be taught how to solve it. Okay so the question is diameter=25in. A=(3.14)(12)^2 Then there is a circle with a line through it and it says 14yd. Okay so I am assuming I solve the area first A=(3.14)(12)^2=452.16 But after

  96. Math Unit 3

    1. Complete the paragraph proof Given: ∠A and ∠B are complementary, and ∠B and ∠C are complementary Prove: ∠A ≌ ∠C By definition of complementary angles, m∠A + _____ = 90° and m∠B + m∠C+ _______. Then, m∠A + m∠B = m∠B + m∠C by

  97. Physics

    A 17 kg crate is placed on a horizontal conveyor belt. The materials are such that μs = 0.44 and μk = 0.21. A) What is the maximum acceleration the belt can have without the crate slipping? B) If acceleration of the belt exceeds the value determined in

  98. English

    1. I have a talking dog. 2. I have a dog that is talking. 3. I have a dog which is talking. 4. I have a dog who is talking. [These are example sentences. #1 can be changed into the others. Can we use 'who' as in #4 when the antecedent is an animal?]

  99. History

    which economic impact did the crusades have on medieval europe?

  100. chem

    When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration, expressed as a percent by mass? 4.8% NaBr 5.5% NaBr 5.8% NaBr 6.2% NaBr

  101. science

    When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration, expressed as a percent by mass? 4.8% NaBr 5.5% NaBr 5.8% NaBr 6.2% NaBr

  102. Geometry

    Complete two column proof. Given: x/6+2=15 Prove: x=78 x/6+2=15 A:______ x/6=13 B:______ x=78 C:_______ A:a. Given b. Subtraction Property of Equality c. Division Property of Equality B:a. Given b. Addition Property of Equality c. Multiplication Property

  103. Bible Study

    How did Christianity develop?

  104. Physics

    A 20.0-kg crate sits at rest at the bottom of a 20.0 m -long ramp that is inclined at 40 ∘ above the horizontal. A constant horizontal force of 290 N is applied to the crate to push it up the ramp. While the crate is moving, the ramp exerts a constant

  105. history

    How did muckrakers of the 19th century compare to modern day journalists?

  106. Physics

    A force is applied to a 22.5 kg object causing it to move at a constant velocity of 4.2 m/s with a coefficient of friction of 0.44. Suddenly, the applied force is removed, causing friction to be the only force acting on the object. How long will it take

  107. English

    It seems difficult, but I'll give it a try. ------------------------------------ In this sentence, what does 'it' refer to in 'give it a try'?

  108. Math

    A jazz band sells 31 large boxes of fruit and 74 small boxes of fruit for a fundraiser. a. Write and simplify an equation using distributive property to find the profit. b. A large box of fruit costs $9 and a small box of fruit costs $4. What is the Jazz's

  109. algebra

    Given the following functions f(x) and g(x), describe the changes (horizontal shifts, vertical shifts, etc.) to the graph of g(x) with respect to the graph of f(x). * f(x) = |x| g(x) = -|x+3| - 2

  110. Bible Study

    what does AD stand for?

  111. English

    Thank you for your help. 1. He made a promise. 2. He made an appointment. 3. He made a word. 3-2. He gave his word. 3-3. He made his word. [#3 is wrong. #3-3 is wrong.(?) All the others are right. Is that right?] 4. He kept his promise. 5. He kept his

  112. As physics

    From the list of compounds below identify the molecules (find out the no. of molecules): 1) Propanone C3H6O Mr:58 2) Chromium Trioxide Cr2O3 Mr: 152 3) Rubidium Carbonate Rb2CO3 Mr: 231 4) Neon Ne Mr:20.2 5) Nitrophenol C6H5NO3 Mr: 139 6)

  113. Math

    a. For the first company, express in words the amount the cab company charges per ride and per mile. Charges per ride $3.00 per mile $0.50 b. Write an equation in slope-intercept, point-slope, or standard form. Explain why you chose the form you did. Don't

  114. math

    Can someone help me figure this out? You earn 10 points for every coin you collect in a video game. Then you find a star that triples your score. a. Write an expression for the number of points you earn from the coins. b. Write and simplify an expression

  115. History

    Q14. Describe the fighting during the American Revolution in Georgia with the correct terms: The Battle of Rice Boats started in 1776 when British soldiers arrived in Georgia to buy supplies. Governor James Wright took advantage of the arrival of the

  116. science

    as magma cool,it forms ? rock by the process of ?.

  117. Mathematics

    Does anyone have an idea? A jazz band sells 31 large boxes of fruit and 74 small boxes of fruit for a fundraiser. a. Write and simplify an equation using distributive property to find the profit. b. A large box of fruit costs $9 and a small box of fruit

  118. Physics

    A physics student kicked a soccer ball toward an aprtment building 40.8 meters from her. The velocity of the ball was 40 m/s^2 @30 degrees. At what approximate height did the ball hit the building?

  119. Chemistry

    Hi! Thanks for checking my question out! ____ 2. Which of the following takes place during a redox reaction? (1 point) a) Electrons are gained only. b) Electrons are lost only. c) Electrons are both gained and lost. d) Electrons are neither gained nor

  120. English

    1. He no longer lives here. 2. He doesn't live here any longer. 3. He doesn't live here anylonger. 4. He no more lives here. 5. He doesn't live here any more. 6. He doesn't live here anymore. ------------------------------ Are they all grammatical? I can

  121. physics

    A car with a 65cm diameter wheel travels 3.0km. How many revolutions does the wheel make in this distance?

  122. math

    A giant football field is made for the floor of the gym. The length of the gym is 90 feet. Using this same scale, determine the width of the paper football field. How do I solve this if it says that the dimensions are 160 ft? by 360 ft. and the end zone is

  123. Trigonometry

    In an explosion, a piece of debris is tossed 99 meters N 45 W. what is the displacement in the north and west directions. I'm not really sure what it wants when it asks for displacement so I also don't know how to get it.

  124. math

    The number of boxes on a truck varies directly with the time since the workday began. At 3 hours after the workday began, there are 207 boxes on the truck. How many boxes should we expect there to be on the truck hours after the workday began? Show the

  125. HISTORY

    Describe the fighting during the American Revolution in Georgia with the correct terms: The Battle of Rice Boats started in 1776 when British soldiers arrived in Georgia to buy supplies. Governor James Wright took advantage of the arrival of the redcoats

  126. History

    . What happened to Governor James Wright after the passage of the Stamp Act?

  127. Math

    Can someone help? The way the question is worded is confusing me. You earn 10 points for every coin you collect in a video game. Then you find a star that triples your score. a. write an expression for the number of points you earn from the coins. b. write

  128. math

    I have a table and was given an equation of best fit - the table is about the growing US population. My equation of best fit is y = 106.7236(1.0124)^x I found my y intercept and the population in 2013. Now it is asking when will the US population break 400

  129. algebra 1

    find the cost of sending 25 text messages.

  130. Algebra

    Mr. Jones brought a use car for $2400 and sold it for $2700. What was the percent of profit for Mr. Jones in selling the car?

  131. language arts

    Please help!!!! I don't need the answer, i just need help understanding this. In "Life Without Gravity," the author provides many ideas and details about living in microgravity. What do you consider the most important idea in "Life Without Gravity"? In an

  132. social studies

    what does the excerpt say about Washington's views on political parties

  133. P.E

    what type of medical professional would you visit if you broke your leg

  134. accounting

    Replenished the $200.00 petty cash fund. Receipts were submitted for the following:office supplies, $35.00, store supplies, $50.00, and miscellaneous, $42.00. A cash count shows $72.00 in the petty cash box. Do you start with 200.00 , then subtract total

  135. social

    How can you say the present constitution is prepared according to the people's will and aspiration?

  136. Hardy Weinberg: Biology

    Can someone explain how to answer these questions given the different variables given? I have a test soon. Dr. Martin Brenner and his team have built a space ship which can travel at the speed of light (186,000 miles per second) and travel to parallel

  137. MATH

    I am a proper fraction. The sum of my numerator and my denominator is 1 less than a perfect square. The difference of my denominator and my numerator is 1 more than a perfect square. The product of my numerator and my denominator is 1 less than a perfect

  138. Algebra

    A computer store buys a computer for $24 fixes it up and sells it for $91.20. What is the percent of increase in the price?