Questions Asked on
February 17, 2013

  1. science

    A tire 0.500 m in radius rotates at a constant rate of 200 rev/min. Find the speed and acceleration of a small stone lodged in the tread of the tire ( on its outer edge ).

  2. DYNAMICS

    A car has an initial speed of 25m/s and a constant deceleration of 3m/s^2. Determine thewvelocity of the car when t=4s. What is the displacement of the car during the 4-s time interval? How much time is needed to stop the car?

  3. Physics

    A science student is riding on a flatcar of a train travelling along a straight horizontal track at a constant speed of 10.0 m/s.The student throws a ball into the air along a path that he judges to make an initial angle of 60.0 degrees with the horizontal

  4. maths-urgently needed

    Integrate ( x^2cosx)/(1+sinx)^2 dx with limits from 0 to pi/4

  5. maths

    1) A chemistry teacher requires 250 milligrams of a chemical for an experiment. He has 30 grams of the chemical. How many times can he carry out the experiment? 2) A bottle contains 1.5 litres of cola. Hannah drinks 300 ml of the cola and Ben drinks 450

  6. PHY

    . Four identical metal spheres have charges of qA = –8.0 µC, qB =–2.0 µC, qC = +5.0µ C, and qD = +12.0µ C. (a) Two of the spheres are brought together so they touch, and then they are separated. Which spheres are they, if the final charge on each

  7. Trig

    Verify the identity. cos 4x + cos 2x = 2 - 2 sin^2(2x) - 2 sin^2 x

  8. DYNAMICS

    A particle travels along a straight line with a velocity v=(12-3t^2) m/s, when t is in seconds. When t=1s, the particle is located 10m to the left of the origin. Determine the accelaration when t=4s, the displacement from t=0 to t=10s, and the distance the

  9. biology

    People with a lactose intolerance are able to take products such as Lactaid that contain the lactase enzyme with their meals. These products can be taken in pill form. Considering the fact that the pill form of the enzyme would have to travel through the

  10. Statistics

    The life spans of three randomly selected tires are 31,950 miles, 36,050 miles, 34,000 miles. Using the empirical rule, find the percentile that corresponds to each life span.

  11. Trigonometry

    Verify the identity algebraically. TAN X + COT Y/TAN X COT Y= TAN Y + COT X

  12. Science(applied physics)

    At time t=0,a 1kg ball is thrown up from the top of a tall tower with velocity Vo=18i+24j(m/s). a:calculate the components of th velocity at t=6s. b:Calculate the kinetic energy of the ball at t=6s.

  13. poetry

    Read the following poem and answer questions that follow: Life, death,-death, life; the words have lead for ages Our thought and consciousness and firmly seemed Two opposites; but now long-hidden pages Are opened, liberating truths undreamed' Life only is,

  14. chenistry

    25ml of a solution of na2c03 having a sepcific gravity of 1.25g solution of hcl containing 109.5g of the acid per litre for complete neutralization. Calculate the volume of 0.84N h2s04 that will be compltetly neutralized by 125g of na2c03 solution. In

  15. Physics

    What is the gravitational force between two 5.00 kg masses that are 10.0 cm apart from center to center? (G = 6.67 × 10-11 N m2/kg2)

  16. Trigonometry

    State the quadrant in which θ lies. 1.) CSC θ is greater than 0 and TAN θ is less than 0. 2.) SEC θ is greater than 0 and SIN θ is less than 0.

  17. math

    during a triathlon, Sharon swims 1/4 of the total route and cycles 3/5 of the remaining route. she runs the rest of the route. if she runs 3,600 meters, find the total distance of the triathlon route. show your work.

  18. Chemistry

    Lauryl alcohol is obtained from coconut oil and is used to make detergents. A solution of 5.00 g of lauryl alcohol in 100.0 g of benzene freezes at 4.2 oC. What is the approximate molar mass of lauryl alcohol. Refer to the text book for the boiling point

  19. Physics

    A bicycle wheel of radius 0.30 m is spinning at a rate of 60 revolutions per minute. What is the centripetal acceleration of a point that is 0.11 m from the outer edge of the wheel?

  20. Math Statistics

    The life span of three randomly selected tires are 34,700 miles, 43,000 miles, 39,000 miles. Using the empirical rule, find the percentile that corresponds to each life span.

  21. Trig

    Three circles with radii of 4, 5, and 6 cm, respectively, are tangent to each other externally. Find the angles of the triangle whose vertexes are the centers of the circles.

  22. math

    Tashana has 16 coins that total to $1.85. She has only nickels, dimes and quarters. How many of each coin could she have?

  23. Physics

    An elevator's cable can handle a tension of 95,500N. Assuming the car has a mass of 2950 kg and it is carrying a full load of passengers whose combined mass is 3750 kg, what is the minimum time required for the elevator to rise 50.0 m from rest?

  24. Physical Science

    A force of 60N used to push a chair across a room does 300J of work in half a minute. How far does a chair move?

  25. Biology

    How is the anaerobic energy system not entirely anaerobic?

  26. Physics

    A circular conducting coil with radius 3.40 cm is placed in a uniform magnetic field of 1.090 T with the plane of the coil perpendicular to the magnetic field. The coil is rotated 180° about the axis in 0.222 s. (a) What is the average induced emf in the

  27. math

    ) The circle graph below gives the inventory of the women's department of a store. Coats $49,737 Dresses $47,208 Skirts Lingerie $9273 $5058 Slacks Socks $15,174 Blouses $2529 $5901 What is the total inventory?

  28. Science

    The vapor pressure of water at 25 oC is 23.8 torr. Calculate the vapor pressure of a solution prepared by dissolving 35.0 g of urea [(NH2)2CO] in 75.0 g of water at 25 oC.

  29. physics

    In open heart surgery a much smaller amount of energy will defibrillate the heart. (a) What voltage is applied to the 5.00 µF capacitor of a heart defibrillator that stores 35.0 J of energy? kV (b) Find the amount of stored charge. mC

  30. finance

    Assume investors expect a 2.0 percent real rate of return over the next year. If inflation is expected to be 0.5 percent, what is the expected nominal interest rate for a one-year U.S. Treasury security?

  31. math

    Y varies direct proportion with x.if x=5 then y=12,thus find the value of y when x=7.5

  32. Spanish

    Answer the following question in Spanish..que pides muchas veces como Plato principal

  33. Probability & Statistics

    32% of women consider themselves fans of professional baseball. You randomly select six women and ask each if she considers herself a fan of professional baseball.

  34. chem

    H2S(aq) + NiSO4(aq) →

  35. math

    find the present value using the present value formula. Achieve $ 225,500 at 8,95% compounded continuously for 8 years, 135 days.

  36. chemistry

    A solution contains 0.02755 g of a protein in 25.0 mL of solution. The osmotic pressure is 3.22 torr at 298 K. What is the molecular weight of the protein?

  37. Maths

    Three circles are placed on a plane in such a way that each circle just touches the other two , each having a radius of 10 cm.find the area of region enclosed by them

  38. Chemistry

    2A + B2 + C --> A2B + BC Run # Initial Rate (M-1s-1) (A)o (B)o (C)o 1 1.6 x 106 1.2 M 1. x 10-2 M 1.0 M 2 1.6 x 106 2.4 M 1. x 10-2 M 1.0 M 3 3.2 x 106 1.2 M 2. x 10-2 M 1.0 M 4 6.4 x 106 1.2 M 1. x 10-2 M 2.0 M What would be the rate-law expression of the

  39. Chemistry

    In a given 1st order reaction A ---> products, the initial concentration of A is 0.40 M. What will be the concentration of A after 15 seconds if the half-life of the reaction is 3 seconds?

  40. Chemistry

    Cyclopropane rearranges to form propene: CH2CH2CH2 --> CH2=CHCH3 by first-order kinetics. The rate constant is k = 2.74 x 10-3 s-1. The initial concentration of cyclopropane is 0.290 M. What will be the concentration of cyclopropane after 100 seconds?

  41. business

    1 for a large company stock/mutual fund would you expect the betas to be positive or negative for each of he factores in a fama french multifactor model? 2 What do you observe abouth the bata coefficients for the different mutual funds? comment on any

  42. Finite Math

    How long will it take $800 to earn $18 at 6% simple interest?

  43. Life orientation

    What according to the BCEA Act applies with regard to the contravention that you've identified

  44. math

    The lengths of the three sides of a triangle are in the ratio 4:5:3. Find the length of each side if the perimetre of the triangle is 1.08?

  45. chemistry

    gaseous hydrogen and fluorine combine in the reaction above to form hydrogen fluoride with an enthalpy change of -540kJ. What is the value of the heat of formation of HF(g)

  46. Statistics

    These are the only ones that I am having problems with. Please help.. 8.You are given the sample mean and the sample standard deviation. Use this information to construct the 90% and the 95% confidence intervals for the population mean. Interpret the

  47. Physics

    A small object of mass 2.60 g and charge -17 µC "floats" in a uniform electric field. What is the magnitude and direction of the electric field?

  48. biology

    substrate concentration and pH affect enzyme activity. Is there another environmental condition you think could affect enzyme activity How would you test your hypothesis?

  49. life orientation

    name the three different systems of media ownership that can be found worldwide.name a country where each system can be found.

  50. Trig

    The diagonals of a parallelogram intersect at a 42◦ angle and have lengths of 12 and 7 cm. Find the lengths of the sides of the parallelogram. (Hint: The diagonals bisect each other.)

  51. ap calc

    a particle moves along the x-axis so that its velocity at any time t is equal to or > 0 is given by v(t)= (2pie-5)t-sin(piet) a.find the acceleration at any time t. b.find the minimum acceleration of the particle over the interval [0,3] c.find the maximum

  52. Chemistry!

    The heat lost or gained by a system is related to its temperature change by a property called its heat capacity. The molar heat capacity of metals at or above room temperature equals 24.92 J K-1mol-1. The temperature of a block of copper metal (molar mass

  53. Math

    A heat exchanger is used to warm apple cider using steam as the heat source. The cider is heated from an initial temperature of 4°C to a final temperature of 65°C. The steam enters the heat exchanger as 50% quality steam and exits as water condensate at

  54. physics

    A stone is thrown horizontally at 30.0 m/s from the top of a very tall cliff. (a) Calculate its horizontal position and vertical position at 2-s intervals for the first 10.0s. (b) Plot your positions from part (a) to scale. Then connect your points with a

  55. math

    In a group of 100 people 40 own a cat, 25 own a dog and 15 own a cat and a dog. Find the probability that a person selected at random from the group: a) owns a dog or a cat. b) owns a dog or a cat, but not both c) owns a dog, given that he owns a cat d)

  56. calculusiii

    he paraboloid z = 4 − x − x2 − 2y2 intersects the plane x = 4 in a parabola. Find parametric equations in terms of t for the tangent line to this parabola at the point (4, 2, −24). (Enter your answer as a comma-separated list of equations. Let x,

  57. physics

    the ends of a light string are tied to two hooks A and Bin are ceiling which 100 cm apart horizontally,so that the length of string of string between hooks is 140 cm.A 650 g of mass is then attached by a second length of string to a point C on the first.80

  58. physics

    A 1.50-V battery supplies 0.244 W of power to a small flashlight. If the battery moves 2.53 1020 electrons between its terminals during the time the flashlight is in operation, how long was the flashlight used?

  59. Algebra

    Natalie earns $2.50 for each CD she sells and $3.50 for each DVD she sells. Natalie sold 45 DVDs last year. She earned a total of $780 last year selling CDs and DVDs. Write an equation that can be used to determine the number of CDs (c) Natalie sold last

  60. Chemistry

    Currently studying for an lab exam. Just have a few question about a typical Iodine Clock reaction lab. In an typical Iodine Clock reaction lab what would be the state of effect of an increase in the initial concentration of persulfate ion and the increase

  61. US History

    Under Andrew Jackson's presidency who got the most power and from whom?

  62. pre cal

    If (a, b) is a point on the unit circle that corresponds to the angle t, then tan(t) equals:

  63. science

    How do I make an acrostic that has to do with the word Wavelength?

  64. Algebra

    A cone has a radius of 15 cm and a volume of 540 cm3. Find the volume of a similar cone with a radius of 10 cm. A. 54 cm^3 B. 240 cm^3 C. 16 cm^3 D. 360 cm^3 I think its D but by the process of elimination...don't know how to figure it out really...?

  65. Chemistry

    A 62g piece of ice at 0 degrees celcius is added to a sample of water at 9 degrees celcius. All of the ice melts and the temperature of the water decreases to 0 degrees celcius. How many grams of water were in the sample

  66. world history

    What are some changes and continuities in the demography of North America from 600-1750?

  67. science

    A ski jumper launches from a ski jump that is oriented parallel to a hill. The jump has a vertical drop of 50 m and the coefficient of friction μ between the skier and the jump is 0.05. The launch point is 5 m above the hill and there is a small lip at

  68. Chemistry

    At equilibrium, the concentrations in this system were found to be [N2]=[O2]=0.100 M and [NO]=0.400 M. N2 (g) + O2 (g) --> 2NO (g) If more NO is added, bringing its concentration to 0.700 M, what will the final concentration of NO be after equilibrium is

  69. Life orientation

    Describe the life/behaviour and explain 5 factors that contribute to hiv/aids

  70. english

    Please i need help... is this article biased or not biased and why? thank you very much:) OTTAWA — Nearly 15 years after a senior Mountie warned the RCMP it needed to tackle pervasive workplace harassment, the national police force must show it takes the

  71. Chemistry

    Given a very concentrated glycercol solution. Dilute it to 7.5 fold dilution. How do I do this ?

  72. Math

    Define the function f(x)=2x/1−x^2. Find the number of distinct real solutions of the equation f^(5)(x)=x. Details and assumptions f^(n)(x) denotes the function f applied n times. In particular, f^(5)(x)=f(f(f(f(f(x))))).

  73. Linear Algebra

    A company separates iron, zinc, and kryptonite from ore by the floatation separation process, which has three steps: oiling, mixing, and separation. These steps must be applied for 4, 5, and 1 hour respectively to produce one unit of iron; 4, 4, and 1 hour

  74. Trigonometry

    Verify the identities. 1.) √1-COSθ/1+COSθ= 1+SINθ/SINθ 2.) SEC X SIN(π/2-X)= 1 3.) CSC X(CSC X-SIN X)+SIN X-COS X/SIN X + COT X= CSC²X 4.) CSC^4 X-2 CSC²X+1= COT^4 X 5.) CSC^4 θ-COT^4 θ= 2 CSC²θ-1 6.) TAN^5 X= TAN³X SEC²X-TAN³X 7.) COS³X

  75. Business Math

    If Wilma borrows $5,000 from her brother (at 5% interest per year) and the loan matures in 10 years, how much will she have to pay annually to pay the loan off in 10 years? How much will she have to pay annually to pay the loan off in four years?

  76. Trigonometry

    Verify the identity algebraically. This problem is very intriguing and awesome at the same time. It's wonderfully amazing! 1.) TAN³α-1/TAN α-1= TAN²α + TAN α + 1

  77. math

    Let |ϕ⟩=a|0⟩+b|1⟩ where a and b are nonnegative real numbers. We know that if we measure |ϕ⟩ in the standard basis, the probability of getting a 0 is 925. What is |ϕ⟩?

  78. languagge/french

    what are some winter sports written in french like for example skiing is "ski du faire". please help

  79. programming

    I need to figure this problem out, I am using visual studio C#. • Powers - Write an application that displays a tables of squares and cubes of an integer from 1 to an upper limit. The user should enter the upper limit and press the calculate button. The

  80. Quantum Physics

    Suppose that a qubit is in the state |ψ> = a |0> + √ (1-a^2)|1> where a [-1,1] . If we first perform a standard basis measurement on this qubit and then perform a |u>, |u⊥> -basis measurement where |u> = b |0> + √ (1-b^2)|1> for some b [-1,1] , what

  81. TUck everlasting/Natalie babbit

    WHat are the symbols in Tuck Everlasting?

  82. Math

    Express the non linear equation in its linear form; y=nx^(1/2)+kx

  83. SP HS High school

    A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then released.Calculate the speed of the bob when the pendulum passes through the mean position.

  84. MATH- Algebra 2

    Solve the Given Equations 1. 5/2y+6+1/y-2=3/y+3 2. 5/a-5-1=a/a-5 3. 2/x^2+x-12-6/x+4=2/x-3 4. 65-n/n=4+5/n 5. a/a-2+2/3=2/a-2 6. x-1/3+x+2/4=1/6 7. 5/3x-1/9=1/x 8. 3/3x-2=4/2x+1 9. 3/x+3-1/x-2=5/2x+6

  85. Physics

    A cannon is mounted on a truck that moves forward at a speed of 5 m/s. The operator wants to launch a ball from a cannon so the ball goes as far as possible before hitting the level surface. The muzzle velocity of the cannon is 50 m/s. What angle from the

  86. chemistry 11

    what conclusion can you make from the ratio of moles of copper to moles of iron in this reaction fe+cucl2---> fecl2+ cu

  87. math

    You are planning to build a walkway that surrounds a rectangular garden that is 10ft by 9ft. The width of the walkway around the garden is unknown, but it will be the same on every side.

  88. Tuck Everlasting/Natalie Babbit

    WHat are the symbols in this book. Tree Wheel Water Toad

  89. science

    A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then released.Calculate the speed of the bob when the pendulum passes through the mean position.

  90. Physic science

    If a man requires a mirror of 0.9m as to see the whole of himself in the mirror when he is standing 2m away from the mirror. How much mirror does he require when he now stands 6m from the mirror?

  91. College Algebra

    This is my question 2x^2-8x=-25 I cant seem to figure out how to solve for x?

  92. maths-urgently needed

    If a+b+c=0 then prove that a^4+b^4+c^4=2(a^2b^2+b^2c^2+c^2a^2)

  93. Quantum Physics

    Suppose we have two qubits in the state α|00⟩+β|11⟩. (a) If we measure the fi rst qubit in the sign basis, what is the probability of seeing a +? (b) What is the resulting state of the second qubit in that case?

  94. physics

    Romeo takes a uniform 13.7-m ladder and leans it against the smooth (frictionless) wall of the Capulet residence. The ladder's mass is 23.2 kg and the bottom rests on the ground 3.43 m from the wall. When Romeo, whose mass is 70 kg, gets 88.3 percent of

  95. chemistry

    Pt, (H2) 1atm | CH3COOH 0.1 M, CH3COONa 0.15M || NaBr 0.1M, AgBr(S) | Ag write the cathodic, anodic and final reactions.

  96. Finite Math

    Kathy borrowed $800 at 6% interest. The amount of interest paid was $144. What was the length of the loan?

  97. Chemistry

    The decomposition of N2O5(g) --> NO2(g) + NO3(g) proceeds as a first order reaction with a half-life of 30.0 seconds at a certain temperature. If the initial concentration [N2O5]0 = 0.400 M, what is the concentration after 120 seconds?

  98. diff eq

    solve 2y^2(y'')+2y(y')^2=1

  99. physics

    A pendulum bob of mass 50g hangs in a steady state by athread from the roof of a car as it accelerates horizontally.the angle between the thread and the vertical is 10 degrees. Find the acceleration of the car.

  100. Chemistry

    Is this right?: Energy is absorbed in order to break bonds because bond breaking requires energy. Or are these two statements completely separate?: "energy is absorbed when bonds break" and "breaking bonds require energy"

  101. physics

    A pendulum bob of mass 50g hangs in a steady state by athread from the roof of a car as it accelerates horizontally.the angle between the thread and the vertical is 10 degrees. Find the acceleration of the car.

  102. economics

    which product experience a larger change in price?

  103. Physics

    A block of mass 3 kg is at rest on an incline. The coefficient of state friction between the block and incline is 0.34. What is the maximum angle of the incline such that the block will not slide down the plane?

  104. Life orientation

    Which two labour laws protect the employee against discrimination in the work place?

  105. Science(applied physics)

    At time t=0,a 1kg ball is thrown up from the top of a tall tower with velocity Vo=18i+24j(m/s). a:calculate the components of th velocity at t=6s. b:Calculate the kinetic energy of the ball at t=6s.

  106. Chemistry

    Explain why a mixture formed by mixing 100 mL of 0.1 M acetic acid and 50 mL of 0.1 M sodium hydroxide will act as buffer

  107. Phyics

    How far does a 5-kg block with an initial speed of 3 m/s slide up a frictionless 28° incline plane?

  108. pre-calculus

    I need help with soving this problem. G(u) =4-3u-u^2; Find G(-2u)

  109. Chemistry

    What mass of precipitate will form if 1.50 L of concentrated Pb(ClO3)2 is mixed with 0.750 L of 0.170 M NaI? Assume the reaction goes to completion.

  110. math

    Consider the general quadratic eqaution in standard form, ax^2 + bx + c = 0. Let a = 1 and the roots be r1 and r2. Expand (x - r1) (x - r2). Write both algebraic expressions for and descriptions in words of b and c in terms of r1 and r2.

  111. MATH- Algebra 2

    Solve each quadratic in form equation. 1. 4y^4+9=13y^2 2. x-3x^1/2+2=0 3. (x-5)^2+2(x-5)-35=0 4. (x-2)^2-3x-2)+2=0 5. 2(x^2-5)^2-13(x^2-5)+20=0 6. 2x^2/3+5x^1/3-6=0 7. 6x^2/3-5x^1/3-6=0 8. x^-2+4x^-1=12 9. x^4-8x^2+7=0 10. x^4-2x^2-35=0 can someone please

  112. physical science

    a scientist found a fossilized bison. using Carbon-14 dating, she found that the fossil was about 45,840 years old. Carbon-14 has a half-life of 5730 years. how many half-lives have passed?

  113. Chemistry

    Determine the direction of the following reaction from the relative strengths of acids and bases: H2S(aq) + C2H3O2-(aq) yields Hc2H3O2(aq) + HS-(aq) The book says this will favor the reactants. I'm confused...shouldn't this be neutral because both

  114. math

    The area of a rhombus is 84 sqm.,if its perimeter is 40 m. ,then find its altitude.

  115. Finance

    Would anyone be able to help me out please? You buy 100 shares of XYZ at $40per share.XYZ pays an annual dividend of $2 and offers an automatic dividend reinvestment plan.Assume that the dividend will remain constant over the next 5 yrs and that the stock

  116. MATH- Algebra 2

    x^2-6>-5x 6x^2-5x+1

  117. Math

    Find the margin of error for c,s, and n. C= 0.90, s=2.3, n=36? Please help asap....

  118. math

    The lengths of the three sides of a triangle are in the ratio 4:5:3. Find the length of each side if the perimetre of the triangle is 1.08?

  119. physics

    two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far end of the steel is at 100 degrees celcius amd that of copper is at 0 degrees celcius.determine the temperature at the junction

  120. physics

    two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far end of the steel is at 100 degrees celcius amd that of copper is at 0 degrees celcius.determine the temperature at the junction

  121. physics

    two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far end of the steel is at 100 degrees celcius amd that of copper is at 0 degrees celcius.determine the temperature at the junction

  122. Life orientation

    In 10-15 lines critically discuss 5ways in which the human or environmental problem impacts on the community.provide relevant sources to support your claims

  123. chemistry

    How do I do a limiting reactant equation? The questions my teacher gave me are confusing and nothing we ever learned in class.

  124. Chemistry/Physics

    I'm not sure how to do this. Determine the actual ratio of 18O:16O for the following substances. a) Snow falling in Greenland at a temperature of -20 degrees C b) Water vapor in equilibrium with VSMOW c) Pore-water from sediments in the North Atlantic

  125. math/algebra

    f(x)=-x^2+2 the maximum y-value is y= ------------------------------------ x^2+14x=-8 what value should be added to both sides of the equation? the answer should be an integer or simplified fraction. ---------------------------------------- y=x^2+6x-2 use

  126. Physics

    An elevator's cable can handle a tension of 95,500N. Assuming the car has a mass of 2950 kg and it is carrying a full load of passengers whose combined mass is 3750 kg, what is the minimum time required for the elevator to rise 50.0 m from rest? 4.74 s

  127. US History

    How did the Indian Removal Act and the resultant Trail of Tears create conflict and unity in the United States?

  128. chemestry

    Explain the physical significance of van der waals,parameters ?

  129. science

    Why does the current not flow to the gyre's center but instead flows in a clockwise circular path about a gyre in the the Northern Hemisphere

  130. chemistry

    what is molality ?

  131. chemistry

    what is molality ?

  132. Trig Identities

    Proving identities: 1) 1+ 1/tan^2x = 1/sin^2x 2) 2sin^2 x-1 = sin^2x - cos^2x 3) 1/cosx - cosx = sin x tan x 4) sin x + tan x =tan x (1+cos x) 5) 1/1-sin^2x= 1+tan^2 x How in the world do I prove this...please help... I appreciateyour time thankyou soo

  133. Chemistry

    58% Ca3 (PO4) 2 how many phosphorus are in 10 kg bones? Ca3(po4)2+SiO2+C=CaSiO3+P4

  134. Solubility/English

    Ok so I have this procedure to rewrite in past tense passive voice please help me out here I have alot ofthings to do with this lab...your help isgreatly appreciated. Thankyou! 1) Set up a hot-water both by placing th 250/400mL beaker, about two-thirds

  135. chemistry

    Effect of temperature on surface tension an viscosity ?

  136. chemistry

    what is real gas ?

  137. fundamental accounting principle II

    How do I explain to a customer about the $6000. loss reported on the sale of its investment of common stock that the customer has 40% interest. When the 2010 income statement reported earning form all investments were $126,000. On January 2011 the company

  138. chemistry

    under what condition del(h) becomes del(u)

  139. Calculus

    find the shortest distance between y= X+10 and Y=6√X

  140. Chemistry

    If I have 50 mL of Lead(II) Nitrate, it is possible for me to calculate how many mole is 1 mL of the substance? Thanks

  141. Finite Math

    Find (a) the final amounts and (b) the total interest earned on the original investment. 1. $4500 is invested at 7.5% compounded annually for 6 years.

  142. Physics

    Calculate the net charge on a substance consisting of a combination of 7.5 multiplied by 1013 protons and 3.5 multiplied by 1013 electrons. Answer in units of C

  143. Ellison

    Divers know that the pressure exerted by the water increases about 100 kPa with every 10.2 m of depth. This means that at 10.2 m below the surface, the pressure is 201 kPa; at 20.4 m below the surface, the pressure is 301 kPa; and so forth. If the volume

  144. Geography

    Can someone tell me what this question means: Which of these rivers flows entirely within the Northern Hemisphere? Amazon - Parana - Uruguay - Orinoco - Negro. I don't get the question. Thanks

  145. Chemistry

    I'm trying to write a sentence like this: Exothermic reactions have a negative enthalpy change value because the enthalpy of the reactants are greater than the enthalpy of the products since the reactants have weaker bonds.... Why do weaker bonds have

  146. english

    Please i need help... is this article biased or not biased and why? thank you very much:)i am very confused.. OTTAWA — Nearly 15 years after a senior Mountie warned the RCMP it needed to tackle pervasive workplace harassment, the national police force

  147. reading

    from the perspective on the black passenger what possible beginning hooks (or sentence that would make people want to read the essay) and possible endings. idk what to write please help

  148. maths

    a hiker walk due east at 4km per hour and a second hiker starting from the same point walks 55 degree north-east at the rate of 6km per hour. H ow far apart will they be after 2 hours. this is my ques but .i am having problem that if the hiker walks 55

  149. Statistics

    Community Hospital had 23,652 admissions. Of these, 1569 were readmissions. What is the hospital's readmission rate?

  150. reading

    the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a beginning hook also known as a sentence that makes people want to read it. i choose the black passenger so i need help on creating a sentence and a

  151. chemistry

    A helium-filled balloon contains 143 mL of gas at a pressure of 0.99 atm. What volume will the gas occupy at standard pressure?

  152. biology

    30. Enzymes function most efficiently at the temperature of a typical cell, which is 37 degrees Celsius. Increases or decreases in temperature can significantly lower the reaction rate. What does this suggest about the importance of temperature-regulating

  153. physics

    A 21.0-g metal cylinder is placed on a turntable, with its center 85 cm from the turntable's center. The coefficient of static friction between the cylinder and the turntable's surface is ìs = 0.83. A thin, massless string of length 85 cm connects the

  154. Computers

    Name three problems that can arise when data becomes mixed up.

  155. english

    What is the error in the sentence? Try and find a suitable replacement for the discontinued model.

  156. math

    solve the simultaneous equations; log x base 2-log y base 4=4, log (x-2y)base 2=5

  157. ALGEBRA 2

    the airline cost for x thousand passengers to travel round trip from nyc to atlanta is given by C(x)= radical 0.3x+1 where C(x) is measured in millions of dollars and x> 0. find the airline's cost for 15,000 passengers (x=15) to travel from new york to

  158. algebra

    Read the article about Body Mass Index (BMI) on page 151 of Elementary and Intermediate Algebra. Use the formula given using pounds and inches for finding the BMI at the end of the first paragraph in order to find the four intervals the article mentions:

  159. CRT205

    Option 1: Article Review Choose one newspaper editorial and one magazine article from the lists provided by your instructor and write a 250- to 350-word response to the following: • What rhetorical devices are found in each article? • Based on their

  160. french

    est qui si la balla tu qu ci du basket ball.du imagrtion la fanes

  161. Math

    Which property of the real number is illustrated by the following (17*7)*12=17*(7*12

  162. College Algebra

    Suppose that the length of a rectangle is 21 inches and the width is 4 more than one third of the length?

  163. ALGEBRA 2

    the airline cost for x thousand passengers to travel round trip from nyc to atlanta is given by C(x)= radical 0.3x+1 where C(x) is measured in millions of dollars and x> 0. find the airline's cost for 15,000 passengers (x=15) to travel from new york to

  164. reading

    the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a sentnce that would ,make the people want to read it. and a possible ending

  165. ALGEBRA

    use the pythagorean theorem to find b when a=14 and c=y (triangle) b=

  166. english

    Please i need help... is this article biased or not biased and why? thank you very much:)i am very confused.. I KNOW WHAT BIASED IS AND NON BIASED.. BUT I JSUT DON'T KNOW WHICH ONE THE ARTICLE IS..! OTTAWA — Nearly 15 years after a senior Mountie warned

  167. college chemistry

    Assuming that 9.0\% of the energy output of a 65W lightbulb is visible light and that the average wavelength of the light is 550 {\rm nm}, how many photons are emitted by the lightbulb each second?

  168. Math - Please Help

    A chunk of oak firewood has a mass of about 2.85 kg and has a volume of 4100 cm^3. Determine the density of oak in g/cm^3.

  169. Physics

    The Royal Gorge bridge over the Arkansas River is 310.0 m above the river. A 59.0-kg bungee jumper has an elastic cord with an unstressed length of 62.0 m attached to her feet. Assume that, like an ideal spring, the cord is massless and provides a linear

  170. trig

    cos^(2) 20 degrees + sin^(2) 20 degrees +pi/2

  171. Sociology

    philosophers suggest arguments should be won by? a. the best argument b. a coin flip c.the person who feels most strongly about the issue d. vilence

  172. Computer Literacy

    HOw has the definition of computer literacy changed over time? I don't know any thing about computers

  173. phy

    . Show that 480 W of power is expended by a weightlifter when lifting a 60-kg barbell a vertical distance of 1.2 m in a time interval of 1.5 s.

  174. English 225

    Which of the following editing techniques helps keep screen direction constant?

  175. math problem

    1/3, 3/5,5/7,7/9,9/11,....If the pattern continues ,what is the 100th fraction in the sequence?

  176. Algebra

    invest $ 3000 and save $100 each month. Write a rule to represent the total amount of money invest into your account as arithmetic sequence. How much money will you have invested after 12 month?

  177. chemistry

    25ml of a solution of na2c03 having a specific gravity of 1.25g ml required 32.9ml of a solution of hcl containing 109.5g of the acid per litre for complete neutralization. Calculate the volume of 0.84N heso4 that will be compltetly neutralized by 125g of

  178. Algebra class!

    You and your date go out for a fancy dinner. The bill comes to $105 and you want to leave a 15% tip. Without using a calculator, determine how much money you should leave for the tip. To find the answer I ……. Describe an alternate way to find the tip

  179. English

    Why do you gandhi considered the champaran episode to be a turning-POINT IN HIS LIFE?

  180. physics

    What voltage is applied to the 5.00 µF capacitor of a heart defibrillator that stores 35.0 J of energy? In kv.

  181. math problem

    The diameter of a circle is increased by enough to increase the circumference by 20%. By what % is the area of the circle increased ? ( Hint: Try a number like t=5.)

  182. physics

    610 C passes through a flashlight in 0.510 h. What is the average current?

  183. Physics

    A spring, (spring constant of 400 N/m) is displaced .75 m from its equilibrium position. An 8-kg mass is connected to the spring and it is allowed to oscillate horizontally with Simple Harmonic Motion. What is the Kinetic Energy of the mass?

  184. geography

    Can you check my answers please? 1. What sea is found directly south of China? The South China Sea 2. What continent is next to the smallest in land area? Europe 3. What are the names of the original thirteen states? New York, New Hampshire, Massachusetts,

  185. math

    during a triathlon, Sharon swims 1/4 of the total route and cycles 3/5 of the remaining route. she runs the rest of the route. if she runs 3,600 meters, find the total distance of the triathlon route. show your work.

  186. physics

    Equal 0.400-kg mass of lead and tin at 60 degrees celsius are placed in 1kg of water at 20 degrees celsius. a) what is the equilibrium temperature of the system? b)if an alloy is half lead and half tin by mass, what specific heat would you anticipate for

  187. Algebra 117

    what are the pros and cons of graphing

  188. physics

    (a) A defibrillator passes 11.0 A of current through the torso of a person for 0.0300 s. How much charge moves? C (b) How many electrons pass through the wires connected to the patient? electrons

  189. Chemistry

    find the molarity of 150. g H2SO4 solute dissolved into 900. g H2O solvent

  190. Physics

    We have a qubit in the state |ϕ⟩=3√2|0⟩+12|1⟩, which we want to measure in the {cosθ|0⟩+sinθ|1⟩,sinθ|0⟩−cosθ|1⟩} basis. In order for the two possible outcomes to be equiprobable, what should be the value of θ in degrees? (Answer

  191. geography

    Thank you for my last post! Can you check my last two answers please? 1. What is the capital of the country whose western border is Haiti? Santo Domingo, Dominican Republic 2. What three countries have larger land areas than the United States? Russia,

  192. Physics

    Now note that the following becomes good approximations as θ→0: sinθ≈θ sin2(π4−θ)≈12−c⋅θ (where c is some constant.) Use these approximations to estimate the probability of success of the two measurements as x→0 (as a function of x and

  193. Physics

    Suppose we have two qubits in the state α|00⟩+β|11⟩. (a) If we measure the first qubit in the sign basis, what is the probability of seeing a +? (b) What is the resulting state of the second qubit in that case? Use a and b to denote α and β

  194. Physics

    A two-qubit system was originally in the state 34|00⟩−5√4|01⟩+14|10⟩−14|11⟩, and then we measured the first qubit to be 0. Now, if we measure the second qubit in the standard basis, what is the probability that the outcome is 0? unansweredA

  195. Physics

    What is the inner product of 13√|0⟩+2√3√|1⟩ and |+⟩? Rewrite 13√|0⟩+2√3√|1⟩ in the sign basis.

  196. AP English 11

    I have to write a paper for english, i keep getting bad grades and i use the paper rater sight always to make sure i do my best. it shows i get a 95 and my teacher gives me 30-20 points less and i don't under stand what im doing wrong. i need help on my

  197. invest

    You budget $100 for parking each month. Each day you use the downtown parking lot, it costs you $5. Write a rule to represent the amountof money left in your monthly budget as an arithmetic sequence. How much money is left in your budget after you have

  198. math

    can i get help on 4 over 9 plus 3 over 4... in simplest form

  199. ap calc

    a particle moves along the x-axis so that its velocity at any time t is equal to or > 0 is given by v(t)= (2pie-5)t-sin(piet) a.find the acceleration at any time t. b.find the minimum acceleration of the particle over the interval [0,3] c.find the maximum

  200. Geometry

    a baseball diamond is a square wiht 4 right angles and all sides congruent. wrte a two column proof to prove that eh distance from first base to third base is the same as the distance from home plate to second base. write a two column proof to prove that

  201. Physics

    Work is done on an object of mass 2kg to increase its kenetic energy to 18J. Calculate the speed of the object.

  202. Math - Please Help

    A right circular cone has a volume of 140 in^3. The height of the cone is the same length as the diameter of the base. Find the radius and height.

  203. chemistry

    how much pb can be isolated from 3.5kg of pbco3?

  204. DYNAMICS

    A car has an initial speed of 25m/s and a constant deceleration of 3m/s^2. Determine thewvelocity of the car when t=4s. What is the displacement of the car during the 4-s time interval? How much time is needed to stop the car? How do i get the

  205. computer

    Assume you have a computer that contains 2GB of memory. It contains four memory slots. Each slot can contain 128 MB, 256 MB, 512MB, 1 GB, or 2GB memory modules. Currently, each slot contains a 512MB memory module. What combinations of memory modules will

  206. chesmistry

    Serine exists in its zwitterion form at a pH of 5.7. Draw the structural formula for the same. Explain the manner in which the structural formula of polar and non-polar amino acids would vary

  207. Math for Management

    A hospital performs 3 types of operations. The first type takes 30 minutes, and they charge $1000 for it. The second type takes 1 hour, and they charge $1500 for it. The third operation takes 2 hours, and they charge $2000 for it. The hospital can schedule