Questions Asked on
September 22, 2011

  1. physics

    A jet plane lands with a speed of 110 m/s and can decelerate uniformly at a maximum rate of 4.1 m/s2 as it comes to rest. Can this plane land at an airport where the runway is 0.80 km long? Answer this by calculating. Answer in units of km

  2. Spanish

    doy a la profesora los libros de español. Amelia pregunta a nosotras si queremos ir al cine. El empleado busca trabajo a sus primas en el almacén. Julio quiere traer un televisor nuevo a sus padres. Los clientes dicen a nosotros que todo está muy caro.

  3. chemistry

    Calculate the grams of substance required to prepare 250mL of 5%(wt/vol) NaNO3

  4. math,word problem(algebra)

    The length of a piece of cloth is 8y m.Mr Lim cut 7 m from it to sew some cushion covers.Then,he cut 3y m to sew a curtain.The remaining material was cut into 4 equal pieces.How long was each piece in terms of y? please help me to complete this&thanks for

  5. chemistry

    A mixture of carbon and sulphur has a mass of 9.0 g. Complete combustion with excess oxygen gives 22.6 g of a mixture of carbon dioxide and sulphur dioxide. Find the mass of sulphur in the original mixture

  6. physics

    a student drops a ball from a window 3.5m above the sidewalk. the ball accelerates at 9.80m/s^2. How fast is it moving when it hits the sidewalk.

  7. chemistry

    Cu+ S2- what name does that make an how do you solve it? is it CuS2 copper sulfide?

  8. physics

    if two lightning bolts hit exactly the same place, act exactly the same time in one frame of reference, is it possible that observers in other freames will see the bolts hitting at different times or at the different places? explain.

  9. Math

    a teacher asked her students to think of a number, multiply by 5, and subtract the product from 20 , then she asked them to multiply the resulting difference by the number they first thougt of a) use function notation to express the final answer in terms

  10. geometry

    Use a straightedge to draw line XY. Then construct line RS so that RS = 2XY

  11. math

    Find f(3) and f'(3), assuming that the tangent line to y=f(x) at a=3 has the equation y=5x+2

  12. Financial management

    On December 31 of last year, Wolfson Corporation had in inventory 400 units of its product, which cost $21 per unit to produce. During January, the company produced 800 units at a cost of $24 per unit. Assuming that Wolfson Corporation sold 700 units in

  13. chemistry

    Which of the following species exhibits resonance if all the formal charges are minimized? a. OF2 b. N2 c. PCl5 d. ClO3- e. BrF3 plz help me out here. its really urgent!!!

  14. chemistry

    Lithium iodide has a lattice energy of -7.3x10^2kj.mol and heat of hydration of -793kj.mol. Find the heat of solution for lithium iodide.

  15. math

    Yancy collects plastic banks. He has three different banks: a pig, a cow, and a horse. How many ways can Yancey arrange his banks on a shelf?

  16. Physics

    If vector a has a magnitude of 29 units and points in the positive y direction. when vector b is added to a the resultant is 24 units in the negitive y direction, what is the magnitude of b?

  17. Chemistry

    How many degrees Centigrade is 125 degrees Fahrenheit? How many degrees Fahrenheit are there in 373 degrees Kelvin? I don't know how to solve this;

  18. statistics

    If the mean of a set of data is 21.00, and 6.00 has a z score of –1.50, then the standard deviation must be

  19. Physics

    An arrow is shot at a 30 degree angle with the horizontal. It has a velocity of 49m/s. The acceleration of gravity is 9.8 m/s2. How high will the arrow go?

  20. Physics

    An arrow is shot at a 30 degree angle with the horizontal. It has a velocity of 49m/s. The acceleration of gravity is 9.8 m/s2. How high will the arrow go?

  21. chemistry

    a 2kg block of iron is given 10kj of energy and its temperature rises by 10c. what is the specific heat capacity of iron?

  22. geometry

    Rafael wrote the statements shown in the chart. Statement 1 Description If a point lies outside a line, then exactly one plane contains both the line and the point. Statement 2 Description If two points lie in a plane, then the line joining them lies in

  23. Chemistry

    I don't quite understand these questions.. Please help, thank you! 1. What happens Qualitatively on both the Macroscopic and Atomic Levels when Zinc, Iodine and Water are mixed? Does a Reaction occur? 2. If a Reaction does take place, are the Physical and

  24. algebra

    what is the exponent of 289

  25. math

    What is the opposite of a professional eater? 12 spaces, letters- H O S M G C R I E B V W X A L N

  26. math

    Find the dy/dt for each pair of functions y=x^2-5x , x=t^2+3

  27. hw

    concentrated sulfuric acid has a density of 1.84 g/ml. calculate the mass in grams of 1.00 liter of this acid. how to solve this?

  28. math

    Make a tally chart for the number of students in the third-fourth-and fifth grade classes: 26,25,27,27,26,28,27 I don't understand how to find the answer.

  29. chemestry

    1.0000 g of hydrate of stannic chloride with unknown formula is heated to 100C (celsius) for 30 minutes. The remaining anhydrous salt weighted 0.7836g. What is the formula of this hydrate? thanks

  30. Chemistry

    Calculate Delte G Knot for H20(g) + 1/2 O2 H2O2(g) at 600. K, using the following data: H2(g) + O2(g) H2O2 (g) K = 2.3 X 10^6 at 600. K 2H2(g) + O2(g) 2H20(g) K= 1.8 X 10^37 at 600. K

  31. Physics

    An antelope has traveled 1.60 km at avg speed of 67.0 km/h. The antelope speed during the first half of the distance is 88km/h. Find the antelope's avg speed during the second half of the run.

  32. Calculus

    Form a polynomial, f(x) with real coefficients having the given degree and zeros. Degree: 4 ; Zeros: 4i and 5i Really need help! don't know where to start.

  33. math

    circle the better benchmark to estimate the number of players on a baseball team. 10 or 100

  34. physics

    A bike accelerates from 0.0m/s to 4.0m/s in 4s. what distance does it travel?

  35. math

    56 books were put on 2 shelves w/ 1 shelf having eight less books than the other shelf. How many books were on each shelf?

  36. pre-calculus

    st andrews golf course in st andrews scotland is one of the oldest courses in the world. it is an 18-hole course that consists of par-3 holes, par-4 holes and par-5 holes. a golfer who shoots par at the old course at st andrews has a total of 72 strokes

  37. Physics

    In a movie, a stuntman places himself on the front of a truck as the truck accelerates. The co efficient of friction between the stuntman and the truck is 0.65. The stuntman is not standing on anything but can “stick” to the front of the truck as long

  38. math

    an object is launched from ground level with an initial velocity of 400 feet per second. To the nearest tenth off a second, how long does it take the object to reach a height off 650 feet?

  39. physics

    Two cars are traveling along a straight line in the same direction, the lead car at 26 m/s and the other car at 40 m/s. At the moment the cars are 49 m apart, the lead driver applies the brakes, causing the car to have a deceleration of 1.5 m/s^2. How long

  40. english

    kendall pitches for his school basebal team.Every game he pit kendall pitches he strikeouts per

  41. calculus

    A power station is on one side of a river that is 0.5 mile wide, and a factory is 5.00 miles downstream on the other side of the river. It costs $15 per foot to run overland power lines and $23 per foot to run underwater power lines. Estimate the value of

  42. Geometry

    Angle 1 is supplementary to angle 2. If m

  43. chemistry

    1. 30.0 ml of ethyl alcohol(density=0.790g/ml)are added to a graduated cylinder that weighs 44.28 grams. what will be the mass of the graduated cylinder plus the alcohol(in grams)? 2. what is the volume (in ml)of a liquid(density=2.07 g/ml)weighing

  44. science 8th grade

    I have toy with the density of 2.o g/cm3 ,I put it into tub with water density of 2.0 g/cm3 will the toy float or sink?

  45. information technolgy

    Hi I need help trying to create a code to encrypt and decrypt a message in netbeans.I know what to do but I cant get it to encrypte and decrypte.Can you please help me.

  46. math

    The distance between the pivot point and the marking point of a compass when drawing a circle - my answer is the radius. Is this right?

  47. physics

    A motorboat accelerates uniformly from a ve- locity of 6.2 m/s to the west to a velocity of 1.7 m/s to the west. If its acceleration was 3.4 m/s2 to the east, how far did it travel during the acceleration? Answer in units of m

  48. Geometry

    Two supplementary angles are in the ratio 7:11. Find the measure of the smaller angle.

  49. chemistry

    analyze and explain the buffer system in buffered aspirin(carboxyic acid)

  50. Math

    Which of the following shows estimating 287 + 491 by using compatible numbers?

  51. geometry

    What is the perimeter of PQR with vertices P(–2, 9), Q(7, –3), and R(–2, –3) in the coordinate plane?

  52. geometry

    is it possible that the points a, b,c are collinear but AB + BC not equal AC

  53. English

    1. His ambition to become the world champion was understandable. (Waht is the part of speech of 'to become the world champion'? Is it a noun phrase or an adjective phrase?) 2. He has only one aim, to make a lot of money. 3. He has only one aim to make a

  54. Calculus

    What is the average rate of change I would like to know how does the formula f(2.1)-f(2)= 12.3 how did they get that answers

  55. Algebra

    "A line perpendicular to x + 3y = 5 passes through (1, -1). What is the equation of the line in standard form?"

  56. government

    Discussion Questions: Imagine you live during the time when the U.S. Constitution was written. Decide whether you are an Antifederalist or a Federalist. Then state why you have chosen to be an Antifederalist or Federalist and try to convince your

  57. English- poetry

    Can anyone find any poetic devices in this poem? (metaphors, similes, personification, etc) AMBITION BY DES WALSH Once upon a time A poor man Named Marcus Sat all day Hoping for food Outside a kitchen door At night he would think Of the golden sands Where

  58. Chemistry

    What is the strongest intermolecular force exhibited in each? Covalent molecules, Ionic compounds, polar covalent molecules. This is my answer: Covalent: London forces Ionic: Ion-dipole Polar Covalent: Dipole- Dipole Is this correct?

  59. Math 116a

    7X+4>-13 or 9x+4>-23 The solution of the compound inequality is ? I am totally lost!!!!!!!!

  60. chemistry

    a 2kg block of iron is given 10kj of energy and its temperature rises by 10c. what is the specific heat capacity of iron?

  61. math

    Bryce has a handful of pennies and nickels.he counts the change and finds 4 times as many pennies than nickels.He has total of 72 cents.How many pennies does he have Can't find a equation

  62. English

    I am writing a paper on Theme and Metaphor in the book a farewell to Arms could someone help on what would be a good Thesis statement as an opening?

  63. chemistry

    at the sea side the sun shines equally on the sand and sea. assuming the both absorb the same amount of energy, why is the sand a lot hotter than the sea

  64. introduction to psychology

    survey results may be inaccurate due to:

  65. GCSE mathematics

    in the diagram,AB=AC and angle ABC=34

  66. Physics

    A small parachute is dropped from a cliff. it falls at a constant speed rate 2 m/s. A small rock is dropped 20.0 seconds later. how far will the rock drop before it passes the parachute?

  67. Math 116 A

    Solve 3(3-8x)+5

  68. introduction to psychology

    one of the controverises concering animal research involves:

  69. Physics

    In mathematical language, Newton's Law of Gravity expresses the force of gravity, F, between two objects in the following way: F= (GMm)/r^2 where M is the mass of one object, m is the mass of the other object, r is the distance between the two objects, and

  70. math

    90 children were at a picnic on the beach. 3/5 of the boys and 5/8 of the girls were swimming. If 35 children were not swimming, how many boys were swimming?

  71. Chemistry

    I don't understand one of my homework questions i'm really stuck. please help! How will the equilibrium: Heat + CH4(g) + 2H3S(g)= CS2 (g) + 4H2 (g) be affected by the following: a) A decrease in temperature. b) The addition of H2. c) The removal of some

  72. physics

    A batted baseball leaves the bat at an angle of 35.0 degrees above the horizontal and is caught by an outfielder 370 ft. from home plate at the same height from which it left the bat.

  73. Language

    Complete the puzzle below with words that fit the meaning and end in the tch pattern. a)move with slight,quick jerks _ _ itch b)rough, quickly done drawings _ _ etch c)large, irregular spot or stain _ _ otch d)support or brace with a forked top_ _utch

  74. Math a

    7X+4>-13 or 9x+4>-23 The solution of the compound inequality is ? I am

  75. math

    circle the better benchmark to estimate the number of photos on an album page. 5 or 25

  76. Comp 156

    What steps are included in the prewriting phase of essay writing? How does prewriting affect the success of an essay?

  77. Algebra II

    I need to write a polynomial in SIMPLEST FORM having roots 2,-2 and 4. I have to gt rid of the parentheses by multiplying everything out.Did I do it correctly? (x-2)(x+2)(x-4)original problem 1.x^2 + 2x-2x=x^2-4) 2. (x^2-4)(x-4) 3. x^3-4x^2-4x+16=0

  78. Pre-Calc

    Determine whether the function is even, odd, or neither. f(x)= 7x^(3/4) How do you do this with a fraction?

  79. geometry

    Wendy drew line segment LM. She used a compass and straightedge and constructed a bisector on segment LM that crosses it at O. Which other construction uses the same steps as the ones Wendy took? A:an angle bisector B:a congruent angle C:a pair of parallel

  80. physics

    a bike first accelerates from 0m/s to 5.0m/s in 4.55, then continues at this constant speed for another 4.5s. what is the total distance traveled by the bike?

  81. geometry

    Jason makes two pictures. Picture 1 is made with the help of a pencil and picture 2 is made with the help of a pencil, compass, and protractor Which statement best compares the two Answer: A:Picture 1 is a drawing because it does not use measuring tools

  82. physics

    the car travels at 20m/s when the driver sees a child. It takes 0.8s to react, then steps on the brakes and slows at 7.0m/s^2. How far does the car go before it stops?

  83. Math

    Find the zeroes of the function algebraically. f(x)= ã-7x-2

  84. Physics

    A 358-kg boat is sailing 15.9° north of east at a speed of 1.80 m/s. Thirty seconds later, it is sailing 36.6° north of east at a speed of 3.68 m/s. During this time, three forces act on the boat: a 29.7-N force directed 15.9° north of east (due to an

  85. Math

    Find the zeroes of the function algebraically. f(x)= ã-7x-2

  86. math (radicals)

    the answer to this expression is -9-4√5 the expression is (2+√5)/(2-√5) i cant figure out how it got there

  87. chemistry

    1. Is there a way to put energy into Zinc Iodide in order to Regain the Elements, Zinc and Iodine? If there is a Way, How does it Happen? 2. What are the Identities of the substances found after electrolysis and heating? I don't understand these questions.

  88. calculus

    Differentiate with respect to x (3x^2-5ax+a^2)^4

  89. statistics

    Each of 25 adult women was asked to provide her own height (y), in inches, and the height of her father. The scatterplot below displays the results. Only 22 of the 25 pairs are distinguishable because some of the (x, y) pairs were the same. The equation of

  90. Calculus

    use the intermediate value theorem to determine whether there is a zero f(x) = -3^3 - 6x^2 + 10x + 9 ; [-1,0]

  91. critical thinking

    how would a poet describe a snowstorm

  92. Math

    for h(x)=5-4x, determine the input for x when the output of h(x) is -11

  93. TIP manila

    what happen when ethanol mixed in methanol. ethanol mixed in acetone. acetone mixed in methanol. methanol mixed in water.

  94. Physics

    The projectile motion is fired with velocity of magnitude vo at the angle feta. Find feta for which the maximum elevation of the projectile is twice its range

  95. nursing

    What is the nurse’s role in data collection, patient privacy, and ethical treatment of human subjects?

  96. Physics

    The projectile motion is fired with velocity of magnitude vo at the angle feta. Find feta for which the maximum elevation of the projectile is twice its range

  97. chemistry

    A 500.0 ml sodium iodide (Nai) solution contains 31.7g of Nal. what is the molar concentration of the solution?

  98. word processing

    unscramble the letters amtbdionn

  99. Physics

    A shell is fired with velocity having horizontal and vertical components ux, uy. At the highest point of it's path the shell explodes into two fragments of mass m1, m2, which separate in a horizontal direction. The explosion generates kinetic energy E.

  100. Managerial finance

    Larissa has also provided the following information. During the year, the company raised $40 million in new long-term debt and retired $22.8 million in long-term debt. The company also sold $30 million in new stock and repurchased $36 million. The company

  101. Math

    Everyone in Mrs. Bowman's art class has 8 jars of paint ecept Jerome, who has 10. There are 74 jars of paint in the room. How many students are there in Mrs. Bowman's art class?

  102. math

    circle the name of the greastest place-value position in which 5,398 and 5,379 are different. is it ones, tens, hundreds, or thousands?

  103. Math Help

    According to statistics gathered as part of a research project by a group of statistics students on the college campus, 376 out of the 439 deaths attributed to lightning strikes were male. If all of the names of the deceased were placed into a drum and one

  104. science

    uniform magnetic field is from west to east,electrons enter from north to south,so what is the direction of force acting on electron?

  105. Chemistry

    I don't understand one of my homework questions i'm really stuck. please help! How will the equilibrium: Heat + CH4(g) + 2H3S(g)= CS2 (g) + 4H2 (g) be affected by the following: a) A decrease in temperature. b) The addition of H2. c) The removal of some

  106. Physics

    One end of a cord is fixed and a small 0.470-kg object is attached to the other end, where it swings in a section of a vertical circle of radius 2.50 m as shown in the figure below. When θ = 21.0°, the speed of the object is 4.70 m/s. At this instant,

  107. pre calculus

    find the bounds on the real zeros????? f(x) = x^5 - 5x^4 +8x + 2

  108. Algebra

    A runner wants to run 11.6 km. She knows that her running pace is 8.1 miles per hour. How many minutes must she run?

  109. English

    Thank you very much. Can you please check these sentences for me? 1.People said that he lived in London. He was said to live in London 2.People say that he lives in London. He is said to live in London 3.People said that he had lived in London. He was said

  110. Math

    Maria is three times as old as her brother.In 4 years,Maria will be twice as old as he will be then.How old is Maria's brother now?

  111. math

    EXPLAIN how you picked the addends for the sum of 17

  112. Biology

    This is a choose the best answer question: The location of protein synthesis in eukaryotic cells is the a)nucleus. b)cytoplasm. c)plasma membrane. d)Golgi apparatus. d)vacuole. Ok so I know that the sites for protein sythesis are the ribosomes and there

  113. physics

    a cannonball is fired with initial speed v0 at an angle 30 degrees above the horizontal from a height of 40m above the ground. the projetile strikes the ground with a speed of 1.2v0. find v0.

  114. chemistry

    If the density of an element is 6 g/ml, how much space (in milliliters) should a sample of it displace if it has a mass of 2.4 grams?

  115. Physics

    A parallel-plate capacitor is designed so that the plates can be pulled apart. The capacitor is initially charged to a potential difference of 80 Volts when the plates are 1.0 mm apart. The plates are insulated so that the charge cannot leak off. What is

  116. Physics

    A car travels in a flat circle of radius R. At a certain instant the velocity of the car is 24 m/s west, and the total acceleration of the car is 2.5m/s^2 53 degrees north of west. Find the radial and tangential components of the acceleration of the car at

  117. Physics

    The stored electrical energy of a 800-ƒÊ F capacitor charged to 1.20~104 Volts is converted to thermal energy by discharging the capacitor through a heating element submerged in 711.6 g of water in an insulating cup. What is the increase in temperature

  118. Math 116 A

    7X+4>-13 or 9x+4>-23 The solution of the compound inequality is ? I am totally lost!!!!!!!!

  119. physics

    Traumatic brain injury such as concussion results when the head undergoes a very large acceleration. Generally, an acceleration less than 800 m/s2 lasting for any length of time will not cause injury, whereas an acceleration greater than 1000 m/s2 lasting

  120. Science

    If an object has a volume of 22 liters and a mass of 35 kilograms what's the objects density?

  121. algebra

    A scale used for a model car is one inch for every 2.5 feet. If the car is originally 7.25 feet long, how long will the model car be?

  122. physics

    A 322-kg boat is sailing 14.4° north of east at a speed of 1.86 m/s. Thirty seconds later, it is sailing 38.4° north of east at a speed of 3.72 m/s. During this time, three forces act on the boat:

  123. Science

    If an object has a volume of 22 liters and a mass of 35 kilograms what's the objects density?

  124. Science

    If an object has a volume of 22 liters and a mass of 35 kilograms what's the objects density?

  125. math

    what is input output in 3rd grade math

  126. nursing

    How do mean, median, mode, and standard deviation differ from one another? Support your answers with specific examples

  127. Pysics

    Find the acceleration of the block of mass M = 5.26 kg in the figure below. (Take m = 4.06 kg.)

  128. science

    In which two seasons do most collisions with deer, moose and bears occur? PLS HELP

  129. Social studies

    What physical factors played a rolled in developing the geography of the four mayor natal regions of Texas

  130. business communication

    Select the best choice. If commas are unnecessary, select D, "No commas needed."

  131. VECTORS

    I already drew a vector diagram for 50m [E] + 32m [W] The way I drew it: 5cm going East, then starting from the end point, 3.2 cm going west. But now it says determine the resultant of the vector. How do I determine that?

  132. chemistry

    Given handbook std enthalpies of formation at 298K for C5H10 (liq)=-105.9 kJ/mol and C5H10 (g)=-77.2 kJ/mol, estimate the normal boiling point of cyclopentane. I calculated delta H (vap or rxn) to be +28.7 kJ/mol. I am not sure how to proceed from here.

  133. 7 th grade math

    if all my grades are above an 80 how will a 38 affectn my grade.

  134. Math/Algebra

    dan is 12 inches taller than jay. use X for jay's height. which expression shows dan's height?

  135. Civics

    Why did the Great Britain raise taxes on the British colonists after 1763?

  136. writing

    coast in a sentence

  137. 6th grade social studies

    what is world culture

  138. math

    Jenny threw darts at the board and scored 100. How many darts did she throw,where did they land?40,39,24,17,16 you can use a number more than once!

  139. physics

    A box sits on a horizontal wooden board. The coefficient of static friction between the box and the board is 0.22. You grab one end of the board and lift it up, keeping the other end of the board on the ground. What is the angle between the board and the

  140. Physics

    An air track glider, 8.0 cm long, blocks light as it goes through a photocell gate. The glider is released from rest on a frictionless inclined track and the gate is positioned so that the glider has traveled 96 cm when it is in the middle of the gate. The

  141. English

    Did I revise this passage correct? Heroes come in all shapes and sizes. Women and men, adults and children. However, one hero looked quite different from what you might imagine. Living in Czechoslovakia after World War II and name Antis. This hero was a

  142. Physics

    A drag racer crosses the finish line of a 400.0-m track with a final speed of 104 m/s. (a) Assuming constant acceleration during the race, find the racer’s time and the minimum co efficient of static friction between the tires and the road. (b) If,

  143. Vectors, please check drawing

    Could you check to see if Ive done this right? h t t p : // imageshack . us/photo/my-images/269/vectoriz . j p g /

  144. Algebra 2

    Using Equations The second angle of a triangle is three times the first and the third is 12 degrees less that twice the first. Find numbers for angles. I do not understand how to solve this equation.

  145. Math 116a

    Graph and write the interval notion? 9

  146. Physics

    Stan takes a trip, driving with a constant velocity of 81.5 km/h to the north except for a 22 min rest stop. If Stan's avg velocity is 66.80 km/h to the north, how long does the trip take?

  147. college physics

    The person in the drawing is standing on crutches. Assume that the force exerted on each crutch by the ground is directed along the crutch, as the force vectors in the drawing indicate. If the coefficient of static friction between a crutch and the ground

  148. logic

    g --> h ~h v k g k --> w Prove: W

  149. Math 116

    Solve 3(3-8x)+5

  150. physics

    An airplane needs at least 145 meters of runway to take off. If the plane starts from rest and accelerates uniformly to a take-off speed of 170 km/hr then what is its acceleration in meters/second? How long does it take for the plane to become airborne?

  151. Chemistry help pliz

    Explain (using equations) how a solution of 1.0 mol dm^-3 in both CH3COOH and CH3COONa is resistant to changes n pH when we add either small amounts of acid or small amount of base (such solution is called a buffer)

  152. geometry

    Solve for the variable using the given information. given : GM = 28 GE - 3x+9 EM - 8x-25

  153. Physics

    A car accelerates from 0 to 60 miles per hour in 6.5 seconds. Determine the distance traveled in this time and the acceleration. Assume constant acceleration.

  154. Geometry(High School)

    How could you model two angles with a common vertex and a common side that are not adjacent angles?

  155. biology

    Lack of iron in the photic zone of the open ocean restricts the size of plankton populations. Iron is what kind of factor for marine plankton?

  156. English- poetry

    Can anyone find any poetic devices in this poem? (metaphors, similes, personification, etc) AMBITION BY DES WALSH Once upon a time A poor man Named Marcus Sat all day Hoping for food Outside a kitchen door At night he would think Of the golden sands Where

  157. Arrays and Expanded Algorithm

    How do you determine the product using an array.

  158. Social Studies 9

    Make a list of the measures that Charles I used to avoid calling parliament. Beside each entry explain which classes of society would be the angriest about these measures and why. Came straight from the crossroads textbook :a meeting of nation.

  159. physics

    In diving a depth of 735m, an elephant seal also moves 600m due east of his starting point. What is the magnitude of the seal's displacement

  160. Biology

    This is a choose the best answer question: The location of protein synthesis in eukaryotic cells is the a)nucleus. b)cytoplasm. c)plasma membrane. d)Golgi apparatus. d)vacuole. Ok so I know that the sites for protein sythesis are the ribosomes and there

  161. world hhistory

    the expansion of agriculture can be traced across sub saharan africa through the spread of the language group

  162. BioChemistry

    I had to calculate the conjugate base/acid ratio of phenol red in a phenol red solution prepared with a buffer I made and the base/acid ratio of just the phosphate buffer I made. I need to understand why these ratios are different. Can anyone help?

  163. Algebra

    If the formula R = -0.037t + 50.1 can be used to predict the world record in the 400 meter dash t years after 1925, for what years will the world records be 48.1 seconds or less?

  164. Math

    What is the definition of a solving equation?

  165. Physics

    A tortoise can run at a speed of 20 cm/s and a hare can run exactly 20 times as fast. In a race, they both start at the same time but the hare stops to rest for 2.00 mins. The tortoise wins by 20.0 cm. How long does the race take? What is the length of the

  166. English

    Cara underwent microlaryngoscopy and bronchoscopy along with flexible bronchoscopy by the pulmonary department and bilateral myringotomy tube placement. I struggle with capitalization... Is pulmonary department capped? Thanks

  167. Physics

    Emily takes a trip, driving with a constant velocity of 79.5 km/h to the north except for a 22 min rest stop. If Emily's average velocity is 68.8 km/h to the north, how long does the trip take?

  168. science

    A florist wants to see if product x will extend the life of cut flowers so that they last longer. What is the independent variable

  169. physics

    A car travels up a hill at a constant speed of 45 km/h and returns down the hill at a constant speed of 70 km/h. Calculate the average speed for the round trip.

  170. Calculus

    The number of people who donated to a certain organization between 1975 and 1992 can be modeled by the equation D(t)=-10.61t^(3)+208.808t^(2)-168.202t+9775.234 donors, where t is the number of years after 1975. Find the inflection point(s) from t=0 through

  171. English

    Could you please check these sentences, please? Thank you I've got short, wavy, dyed blond hair. I've got a round face, heavy eyebrows, oval eyes, a large mouth and a small nose. I'm friendly and sensitive. I'm quite serious and clever. I'ma bit shy but

  172. physics

    A car travels up a hill at a constant speed of 45 km/h and returns down the hill at a constant speed of 70 km/h. Calculate the average speed for the round trip.

  173. physics

    A car travels up a hill at a constant speed of 45 km/h and returns down the hill at a constant speed of 70 km/h. Calculate the average speed for the round trip.

  174. logic

    g --> h ~h v k g k --> w Prove: W

  175. Prcts chemistry

    Calculate the pH of 0.0115M acetic acid solution at 25 degrees celcius with Ka = 1.75*10^-5

  176. English

    Please check: 1. If a river is represents your thoughts is that an analogy or conventional symbol. I think it is an "analogy" but if it is a conventional symbol please explain why. 2.If in a story. in a brief intro, we learn about two friends and it sets

  177. physics

    if you walk for 46 minutes at a speed of0.91 meters per second, how far will you have traveled? convert to km

  178. calculus

    Sin2pieover13plus cos squared pie over 13 equals.

  179. Algebra

    1.What is the nature of th roots of f(x) = x^2 + 4x+16-I think it is two conjugate complex roots because it is -2+-2isquare root 3? 2.Nature of roots of f(x) = X^2 + 2x+1 it would be one double root,correct? I get confused with doing these sometimes, just

  180. physics

    A person walks 41° north of east for 3.77 km. How far would another person walk due north and due east to arrive at the same location?

  181. calculus

    Sin2pieover13plus cos squared pie over 13 equals.

  182. Math Urgent

    Two surveyors with two-way radios leave the same point at 9:00am., one walking due south at 2 mi/hr and the other due west at 5 mi/hr. How long can they communicate with one another if each radio has a maximum range of 10 miles?

  183. Math

    Natalie has 138 DVDs and 419 CDs. If you were to estimate the sum of the DVDs and CDs, what sentence could you write? Then find your estimated sum.

  184. CHEMISTRY

    Show that an object with a mass of 8.00kg can have the same kinetic energy as an object with a mass of 32.0kg

  185. Dynamics

    Problem 13.185 A 9.13 kg sphere A of radius 90 mm moving with a velocity magnitude v(0)= 2 m/s strikes a 830 g sphere B of radius 40 mm which is hanging from an inextensible cord and is initially at rest. Sphere B swings to a maximum height h after impact.

  186. Math

    Miguel has 325 baseball cards and 272 football cards. He said that he has 597 cards in all. Is his answer reasonable? Explain using estimation.

  187. Mathematics

    For example, let's say you had a beautiful clock that was always one minute late. It was too beautiful to throw away, so you decided to keep it. How slow/late would this clock be behind of all the other clocks in total for 1 year? 2 years? I got 365

  188. physics

    34.0 km/h, speeds up at a constant rate of 3.9 m/s2. What velocity does it reach 6.8 s later?

  189. algebra <>+ complete each statement

    can you check if these are right (24 -8) / 4 ? 24 -8 /4 i got < 3 x (4-2)x5 ? 3 x 4 -2x5 i got: > (22+8) /2 ? 22 + 8 /2 i got: < 20 /2 + 8 x 2 ? 20 / (2+8) x 2 i got : > 11 x 4 -2 ? 11 x (4-2) i got : > (7x3) - (4x2) ? 7x3 - 4 x 2 i got: =

  190. Math

    Sun-Yi estimated 270 + 146 and got 300. Is her estimate reasonable? Explain.

  191. algebra II

    I need to write a polynomial in SIMPLEST FORM having roots 2,-2 and 4. I have to gt rid of the parentheses by multiplying everything out.Did I do it correctly? Also, someone said yes, but I'm wondering if it suppose to have anything else done to it-it

  192. calculus

    Find equations for the lines that are tangent and normal to the graph of y = sinx + 3 at x = pi

  193. Calculus

    Find (dy/dx) for the equation (7x+8y/9x-4y)=4. a. (dy/dx)=(-29/24) b. (dy/dx)=(43/24) c. (dy/dx)=(29/24) d. (dy/dx)=(-43/24) e. (dy/dx)=4

  194. Math

    Given the following LP model (represented abstractly with decision variables X and Y), find the optimal solution using the ‘graphing’ approach. Minimize 5X + 2Y Subject to: 4X + 2Y >= 80 3X + 4Y = 45 2X - Y >= 0 And non-negativity, of course. Your

  195. Physics

    A projectile is fired from the origin with an initial velocity V₁=100m/s at an angle θ₁=30⁰. Another is fired from a point on the x-axis at a distance x₀=60m from the origin with initial velocity V₂=80m/s at an angle of θ₂. It is desired to

  196. math

    using limits...finding the tangent line of the square root of x when x=2

  197. Spanish

    Is this how I say the boy is going to stand up? El muchacho va a levantarse.

  198. Science

    Please help Thank you. Do you think we should have a special tax or a onetime payment that all people make to help improve air quality? Or should this be something that our government should budget on their own? Please answer in 100 words or more Thank

  199. geography

    How many degrees are there between the equator and the southern tip of Greenland? My answer is 60 degrees. Is this correct? Can you also give me a better map to find this on?

  200. pre calculus

    solve in real number system x^3 + 5x^2 - 12x = 14 =0

  201. math

    4 x - (3 -x) = 7 ( x - 3) +10 how do i solve this problem step by step?

  202. chemistry

    what is the volume (in ml)of a liquid(density=2.07 g/ml)weighing 130.grams?

  203. English

    e.g. I'm here on the ORBIS plane,"the flying eye hospital." (In this sentence, why is quotation marks used? What is the difference between with quotation marks and without quotation marks?)

  204. chemistry

    concentrated sulfuric acid has a density of 1.84 g/ml. calculate the mass in grams of 1.00 liter of this acid.

  205. Science

    Please Help Thank you. If you had to argue the benefits of wind energy, what would they be? and What are the risks? can you please answer these question in 120 words or more Thank you.

  206. math

    23x17 in expanded algorithm

  207. geography

    Before I try to look for the correct answer, can you tell me if this question looks right? I was wondering if my teacher meant to put something other than 20 degrees N and 10 degrees N? Question - Name five countries in Africa that have coastlines on the

  208. English

    I left out the following two sentences. Thank you very much. 1) My sister is in her second year a university. 2) My sister just entered her second year of university degree in medicine in Turin.

  209. math

    -3+x/1=-3

  210. calculus

    An object is moving along the graph of f (x)= x2 . When it reaches the point (2,4) the x coordinate of the object is decreasing at the rate of 3 units/sec. Give the rate of change of the distance between the object and the point (0,1) at the instant when

  211. physics

    Any object that moves through the air (or space) under the influence of gravity is...?

  212. Math help!!

    Solve 3(3-8x)+5

  213. chemistry

    What is the maximum amount of ethanol (in grams) that can be produced when 0.30 kg of ethylene (C2H4) and 0.029 kg of steam are placed into the reaction vessel?

  214. Calculus

    The area of a circle is changing at a rate of 2 in.^(2)/sec. At what rate is its radius changing when the radius is 9 in.? a. (9/2)in./sec. b. (2/9)in./sec. c. (2/9pie)in./sec. d. (1/9pie)in./sec. e. (1/9)in./sec.

  215. geometry

    ab is parallel to cd are cut by transversal ef find m

  216. Math

    Use compatible numbers to estimate. 329 + 64 =

  217. math

    2-4n=10 please show how you get the answer thanks

  218. Chemistry

    What is the strongest intermolecular force exhibited in each? Covalent molecules, Ionic compounds, polar covalent molecules. This is my answer: Covalent- dipole-dipole forces Ionic- ion-dipole forces Polar Covalent- electrostatic forces Is this correct?

  219. chemistry

    Calculate the volume of 0.05 kg of bromine. (D=3.12 g/ml)

  220. Physics

    Highway speed limit increased from 55 mi/h to 65 mi/h, how much time is saved on a 435 mile trip if you travel at the new speed limit?

  221. chemistry

    Calculate the volume of 0.05 kg of bromine. (D=3.12 g/ml)

  222. Physics

    Car travels up hill at a constant speed of 50 km/h and returns down the hill at a constant speed of 65 km/h. Calculate the avg speed for the round trip in km/h.

  223. English

    to settle an argument.. is it correct to hyphenate She will be placed into a short-leg walking cast? I say yes! Thank you !

  224. social studies

    during which war was the Emancipation Proclamation issued£¿

  225. history

    Answer the following BODIE ISLAND INFO: When it was built? How tall is it? Where is it positioned? Who owns it? How much did it cost to have it built? Has the location changed? What does it look like? What is its history? PLEASE ANSWER ASAP!!!

  226. math

    I've saved $9.00 to buy something.That is 1/6 the amount I need how do I figure out how much the coat costs?

  227. chemistry

    Suppose this block is dropped into 25.0ml of water. What will be the new volume reading? Help me please . I dot get it!!

  228. math

    Use compatible numbers to estimate. 212 + 347 = 83 + 34 =

  229. chemistry

    what is the volume (in ml)of a liquid(density=2.07 g/ml)weighing 130.grams?

  230. Physics

    An air track glider, 8.0 cm long, blocks light as it goes through a photocell gate. The glider is released from rest on a frictionless inclined track and the gate is positioned so that the glider has travelled 96 cm when it is in the middle of the gate.

  231. Algebra 116 A

    What kind of interval notion do you get for this 9

  232. chemistry

    concentrated sulfuric acid has a density of 1.84 g/ml. calculate the mass in grams of 1.00 liter of this acid.

  233. math

    robby runs for 5 minutes . he walks for 10 minutes . he runs for 7 minutes. he walks another 4 minutes .he runs again for 8 minutes and walk againfor 3 minutes .what is the range of minutes robby runs?

  234. calculus

    Assume that x and y are differentiable functions of t. Find dy/dt using the given values. xy=x+4 for x=4, dx/dt=-5 a. 0.20 b. 3.75 c. 1.25 d. 5.00 e. -0.25

  235. geometry

    U=(a,b,c,d,e,f,g,h,i,j,k) A=(a,c,d,f,g,i) B=(b,c,d,f,g) C=(a,b,f,i,j) Determine the following A'square B'

  236. physics

    At highway speeds, a particular automobile is capable of an acceleration of about 1.6 m/s2. At this rate, how long does it take to accelerate from 76 km/h to 118 km/h

  237. Math

    For what value of theta with -pi/2

  238. Chemistry

    What is the frequency of radiation that has a wavelength of 13 \mu m, about the size of a bacterium?

  239. phl/251

    need to write an example metaphor for a "place" and a "event"

  240. math

    name the position of the first digit of the quotient. then find the first digit. 3 divide by 579

  241. physics - 1

    By algebraic manipulation of the first two kinematic equations for one-dimensional motion: 1) vf = vi + at 2) xf = xi + (vi)(t) + (1/2)(a)(t)^2 Obtain the other two kinematic equations : 3) vf^2 - vi^2 = 2ax 4) xf = xi + (1/2)(vi + vf)t

  242. mathemactics

    what is the answer of 5\6 of 42pounds

  243. math

    talk math explain how you can tell without dividing a 3-digit number divided by a 1-digit will have a quotient of 2 or 3 digits.

  244. math

    x/4+2=1 -3+x/1=-3 please show steps thanks

  245. math

    Round to the nearest hundred to estimate the sum. 76 + 487 =

  246. pre calculus

    given points (0,0) (0,5) vertical asymptote of (-1,1) and horiz (2,1) how do I find the equation??????

  247. regarding registration

    i haven't recd confirmation mail

  248. phl/251

    What are contrasting metaphors for marriage?

  249. chemistry

    the density of ehter is 0.789 g/mL. Find the mas in kilograms for 475mL of ehter

  250. Math

    Starting from the formula cos^2(x)+ sin^2(x)=1, prove that tan^2(x)+1 =sec^2(x).

  251. Calculus

    Use interval notation to indicate where f(x) is continuous. f(x)= 7x^8-5x^4+4

  252. critical thinking

    Please check my work. I have no one here to help thank you. 9. Explain what techniques you would use to present your ideas on this topic and persuade others effectively. If I were to represent any ideas in the argument, I would consider using

  253. math pre-algebra

    1.x/4+2=1 2.-3+x/1=-3 please show steps thanks

  254. Chemistry

    What is the frequency of radiation that has a wavelength of 13 \mu m, about the size of a bacterium?

  255. Math

    What is the classify system of Y=-3 and X=2

  256. math

    What Is The Integration Of (0)?

  257. Math

    What is the classify system of Y=-3 and X=2

  258. Precalculus

    Instead of graphing the arc length against the height, Olivia decides to make graphs of Paul's x - and y - coordinates against time. Suppose paul walks 1 meter per second. How would Olivia's graph compare to her graph of arc length against the height?

  259. ap world

    what are some similarities between the foraging and urbanized societies?

  260. math

    An angle who's vertex is in the center of a circle? I am having a very,very hard time finding the word that fits this definition!! HELP! PLEASE! I usually do not have to get help with my Math.

  261. english literature

    can anyone tell me a good example of poem which uses connotation. thanks

  262. Math

    Solve 3(3-8x)+5

  263. math

    In a class of 28 sixth graders, all but one of the students are 12 years old. Which two measurements are the same for the students ages? What are those measurements.

  264. Science 6th grade

    how can granite and slate peices be held together?

  265. English

    Before writing a recommendation report to the CEO, Dee and Carlos distribute a survey to everyone in their company to determine which new benefits employees are most interested in. What part of the writing process does this activity represent?

  266. Math 116

    9/10th (3+8x)+3greater or equal to 15 what is the solution to this?

  267. Algebra II

    I need to write a polynomial in SIMPLEST FORM having roots 2,-2 and 4. I have to gt rid of the parentheses by multiplying everything out.Did I do it correctly? Also, someone said yes, but I'm wondering if it suppose to have anything else done to it-it

  268. pre-algebra

    x/4+2=1 show step

  269. geography

    Thank You for the map Ms. Sue Here is my answer to the question - Name five countries in Africa that have coastlines on the Atlantic Ocean and lie between 20 degrees N and 10 degrees N - Sierra Leone, Liberia, Guinea, Senegal, and Cote D'Ivoire. Am I wrong

  270. math

    a container holds 250 mL. How many liters does it hold

  271. chemistry

    what would be the vapor pressure of water in a solution wiith 23.7g NaCl dissolved in 500mL of water at 50degrees centigrade

  272. Mrs.SueALGEBRA order of operation problems

    Can you please check if i have these right? 3 + 15 - 5 x 2 = 8 5 x 6 + 2 x 4 = 38 48 / 8 -1 = 5 68 - 12 / 2 /3 = 66 6 (2 + 7 ) = 54 25 - (6x4) = 1 3 [ 9 - (6 -3)] -10 = 8 60 / (3 +12) = 4 4-2 + 6 x 2 = 14 18 / (5 -2) = 6 16 +24 / 30 -22 = 5 2[4 (9 -7 ) + 1

  273. math

    use the bus shelter method to work out 1/8 as a decimal

  274. Physics - Vectors

    A jet travels from Vancouver to Calgary for 1000 km, then turns [N] and travels another 200km toward Edmonton. Draw a scale diagram. Find the displacement of the jet from Vancouver. I just don't get how to draw this out.

  275. Credit Policies and Procedures

    Can someone please show me the formula to do an amortization schedule on paper? I have an 8 year loan, for 21,700 with a 6.5% interest rate.

  276. English

    I have a question about a figure of speech: The Truth must dazzle gradually Or every man be blind What figure of speech is "Or every man be bling" Would it be synedoche metonymy metaphor litotes personification I know its not personification or synedoche

  277. accounting 1

    jim smith had trouble finding a job, so he decided to start his own sole proprietorship by the name of designers, inc. jim is a web site designer and here are the results as of the end of the first year of his business.br accounts payable =$12,100br

  278. math

    Number of People You Have Known Who Were Victims of Homicide # of Victims Frequency 0 3944 1 279 2 97 3 40 4 30 Find the median. Note that the “4 or more” category is not problematic for it. I know that the median is the middle number. I got 1.5 but

  279. math

    a teacher asked her students to think of a number, multiply by 5, and subtract the product from 20 , then she asked them to multiply the resulting difference by the number they first thougt of a) use function notation to express the final answer in terms

  280. Math

    Explain how you would use a number line to round 148 to the nearest ten.

  281. math help asap

    what is the solution to 2x+9greater or less then 5 and 2x-13greater or equal to -9.

  282. math

    for h(x)=5-4x, determine the input for x when the output of h(x) is -11 i have tried to answer this question so many times , but i cant figure it out

  283. Science

    find the density of the two rocks. The jagged rock has a mass of 56 grams. this rock therefore has a density of ?

  284. math

    t = 4x+ t Help

  285. statistics

    A basic statistics course had a total of 25 students which included 15 female (F) students whose distribution by major was 4 in Bio (B), 6 in COM (C), 3 in ECO (E), and 2 in PSY (P). In addition, the course had 10 male (M) students whose distribution by

  286. Grammar

    I'm not sure if this is a run-on sentence. Stock prices rose slightly yesterday. The TSE average up 16.9 points and the Canadian Exchange index up 3.2.

  287. physics

    A force is applied to a 1.3 kg mass and produces 4.2 m/s 2 acceleration. What acceleration would be produced by the same force applied to a 7.5 kg mass? Answer in units of m/s

  288. maths urgent

    The average mass of half the number of crabs in a basket is 350g, the average mass of the remaining crabs is 300g. If the total mass iof the crabs in the basket is 13kg, how many crabs are there in the basket?

  289. math

    On a board game if you landed on red you move ahead 1 space,land on blue you move ahead 2 spaces,and land on orange you move back 1 space. If you took 30 spins where would you expect to land relative to where you started?

  290. calculus

    State which of the conditions are applicable to the graph of y = f(x). (Select all that apply.) lim x→infinity f(x) = −infinity lim x→a+ f(x) = L lim x→infinity f(x) = L f is continuous on [0, a] lim x→infinity f(x) = 0 f(a) is not defined lim

  291. geography

    The five countries are Senegal, Guinea, Guinea-Bissau, Gambia, and Mauritania.

  292. science

    What is the density of 57g and a volume of 6mL

  293. CHEM

    Calculate the pH of a .7 M solution of ammonium chloride

  294. Computer Science

    Suppose that a String variable str has already been defined and holds some String. In the box provided below, write a statement that changes str to all lower case characters, and then copies the result back to str.

  295. CHEM

    Calculate the pH of a .7 M solution of ammonium chloride

  296. biology

    With regard to bringing solutes into the cell across the plasma membrane, discuss the advantages and disadvantages of diffusion, facilitated diffusion,active transport,and endocytosis.

  297. chemistry

    1. 30.0 ml of ethyl alcohol(density=0.790g/ml)are added to a graduated cylinder that weighs 44.28 grams. what will be the mass of the graduated cylinder plus the alcohol(in grams)?

  298. Science

    I really do need help finding Science Fair Ideas. Hellppppppp Meeee!!!! Oh yeah I'm in 5th grade!! I need help finding Science Fair Ideas.

  299. algebra help bad!!!!

    Solve 2x+9 greater or equal to 5 and 2x-13greater or equal to 9 what is the solution? I have x=-2 and x=2 how do I write this {x x> what?

  300. CHEMISTRY LAB urgent assistance

    1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH) Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this relationship show that pH = pKa + log [base]\[acid] urgently need assistance

  301. Physics

    An aircraft has a landing velocity of 50 ms-1 and decelerates uniformly at 10 ms-2Calculate: (a) the time taken to reach 15 ms-1 (b) the distance travelled during this time (c) the velocity of the car when it was 100 m from the start point

  302. Math

    Natalie has 138 dvds and 419 cds. If you were to estimate the sum of the dvds and cds, what sentence could you write? Then find your estimated sum. My answer is 140 + 420 = 560 is this right..

  303. Finance in Healthcare

    Understanding the difference between fixed and variable costs, what area of a health care facility or physician practice do you think would have a greater amount of variable costs than fixed? What would you suggest to lower the fixed costs for the same

  304. physics

    If a car moves at 36km/h accelerate uniformly at 4m/s calculate it velocity in 2 seconds.

  305. physics

    A ball, initially at y = 0, is thrown straight down and takes 1.40 s to move 13.8 m in the - y direction. Calculate the initial velocity of the ball.

  306. math

    Jill ley took out a loan to pay for education for $60,000. would be repay back in 8 years with the interest of 6% what will be jill pay back at the end of the loan is:

  307. physics

    a dog runs down his driveway with an initial velocity of 4.0 m/s. the dog then accelerates at 2.5 m/s^2 for 5.0 s. what is the final velocity of the dog?

  308. math

    4 children are taken off the chart. 2 children are removed from 4 - legged snake,and the others from duck-billed chicken. how many like duck-billed chicken?

  309. world history

    The Mongols have a terrible reputation in history as pillagers who destroyed all that met their path. How does this depiction of the Mongols compare with the same people who brought the Pax Mongolia? i don't understand what this question is asking me to

  310. Math

    Sales made last year by Lane's Appliance Store are listed below. The first number tells how many employees made the sales amount. Two sales employees earned in the range of $130,001-$150,000. Six sales employees earned in the range of $110,001-$130,000.Ten

  311. geometry

    exprimer que le côté bc en fonction de a

  312. English

    Can you check my answers. Label the simple subject(SS) and simple predicate(SP) 1. The artists had less wall space to paint on. artists=SS had=SP 2. Soon beautifully colored stained glass filled the windows. glass=SS filled=SP

  313. Brainteaser

    77777777777777777 6652137

  314. geometry

    the solution set of x+1=x is

  315. English

    1. His ambition to become the world champion was understandable. 2. Our teacher, Henry Evans, complies this dictionary. 3. We heard the news that his team had won. 4. The idea of helping poor people in underdeveloped country was normal. 5. He had only one

  316. PHYSICS

    190 MJ OF ENERGY ARE NEEDED TO MELT 500KG OF ALUMINUM AT 660 DEGREES CELCIUS. CALCULATE THE SPECIFIC LATENTHEAT OF ALUMINUM

  317. science

    Which 1 is an experiment? reading a blood pressure gauge, examining an x ray or taking prescription medicine? Thank you

  318. physics

    With an average acceleration of -.56 m/s2, how long will it take a cyclist to bring a bicycle with an initial speed of 13.3 m/s to a complete stop?

  319. Math 116

    would the graph of 8x+5y=35 be consistant or non consistant? I think consistant

  320. Math 116

    How do you graph X=2 and y=-3 what is the order pair if any?

  321. Physics

    An arrow is shot at a 30 degree angle with the horizontal. It has a velocity of 49m/s. The acceleration of gravity is 9.8 m/s2. How high will the arrow go?

  322. English

    1. Our teacher, Henry Evans, complies this dictionary. 2. Our teacher, Henry Evans complies this dictionary. 3. Our teacher Henry Evans complies this dictionary. (Are they all grammatical? Would you check the use of 'comma'?

  323. Math 116A

    Solve 3(3-8x)+5

  324. Math 116 a

    9

  325. Calculus

    Can someone help me to evaluate these two integrals? INT dx/(x^2*sqrt(x^2-25)) and INT (from 0 to 1) -5*sqrt(x^2+1) dx