Post a New Question

chemistry - ozone

57,668 results

Ozone is known to cause respiratory problems in humans and to damage plants. However, the ozone layer also protects Earth. Explain the locations ozone can be found, how ozone is helpful, how it is harmful, and what causes the depletion of the ozone layer.

explain the locations ozone can be found, how ozone is helpful, how is it harmful,what causes the deposition of the ozone layer

Which answer best describes an O_3/ozone molecule: 1. Each atom in ozone is connected to another atom by 1.5 bonds. 2.The double bond in ozone switches back and forth between the two outer oxygen atoms. 3.An ozone molecule contains one single bond and one double bond. I want ...

hey everyone out there im new to this forum so please be nice. hahaha :D as the subject says this is about ozone cracking. well my friend is doing a research assignment, and shes talking about ozone cracking. she has done your homework and found out that ozone cracking, ...

Chemistry 2
Chlorine atoms contribute to the destruction of the earth's ozone layer by the following sequence of reactions: Cl + O3 --> ClO + O2 ClO + O --> Cl + O2 Where the O atoms in the second step come from the decomposition of ozone by sunlight: O3 --> O + O2 What is the ...

chemistry - ozone
hi, can anybody tell me the molecules that destroy ozone? i need a fair few molecules to write in my homework...thanks! The main species responsible for destroying ozone in the stratosphere is Cl atoms. Br atoms are also very effective but there aren't many around. Collisions ...

What are the chemicals that cause ozone depletion. Provide information on their structures, how they are made, and how they react with ozone in the stratosphere. Also describe where these chemicals are found in industry and in household products.

Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers was determined experimentally. For the D(h...

College Algebra
Ozone occurs at all levels of Earth's atmosphere. The density of ozone varies both seasonally and latitudinally. At a given city, the density D(h) of ozone (in 10^−3cm/km) for altitudes h between 20 kilometers and 35 kilometers was determined experimentally. For the D(h...

It is found that ozone reaction in water nearly follows first-order kinetics in ozone concentration decreases by 50% in 12 minutes (t1/2 = 12 min). A water supplier wants to inject ozone into a pipe bringing water to thee water treatment plant to pre-disinfect the influent. ...

Write an equation to represent the oxidation of I- to I2 in acidic solution, with ozone as the oxidizing agent. I know ozone will be reduced to H2O, but I am not sure how to figure out the acidic solution. Thank you!

When air pollution is high, ozone (O3) contents can reach 0.60 ppm (ie., .60 mol ozone per million mol air). How many molecules of ozone are present per liter of polluted air if the barometric pressure is 755 mm Hg and the temperature is 79 degrees F? I converted temperature ...

Free radicals are also important in many environmentally significant reactions. For example, photochemical smog, which forms as a result of the action of sunlight on air pollutants, is formed in part by the following two steps. X NO2 NO  O O  O2 O3 UV light  Ozone damages ...

OZONE stuff
When is the Antarctica ozone hole expected to recover almost completely? How do you know this?

Describe ozone creation and loss in the ozone layer. Does one occur more than the other?

The protective action of ozone in the atmosphere comes through ozone's absorption of UV radiation in the 230 to 290 nm wavelength range. What is the energy, in kilojoules per mole, associated with radiation in the wavelength range?

Calculate the pressure of 4.80g of ozone, O3, in a 2.45 L flask at 25 degrees C. Assume that the ozone completely decomposes to the molecular oxygen. 2O3(g) --> 3O2(g) Calculate the pressure inside the flask once the reaction is complete.

physical science
what is the importance of ozone in the stratosphere for your health?what will happen to us when ozone depletion becomes more serious?

How many kJ of energy are released when 2 moles of NO reacts with an excess of ozone O3? How many kJ of energy are released when 44.9 g of NO react with an excess of ozone O3? What is the ΔH for the reverse reaction?

The atmosphere contains about 6.8×1013 moles of ozone. If this amount of ozone gas is compressed into a thin layer around the globe (the radius of Earth is 6370 km) at STP (Standard Temperature (0°C) and Pressure (1.0 atm.)), how thick will the layer be in millimeter? One ...

Ozone, a gas found in the upper stratosphere and lower mesosphere, would burn our throats if we tried to breathe it. ozone is composed of

Science 8 A
5. Which of the following types of pollution cannot be attributed to car and truck emissions? A. Acid rain B. Sedimentation C. Ozone D. Photochemical smog I think it is Ozone.

How many moles of ozone does the atmosphere hold? For a sense of scale,compare the amount to the total carbon dioxide emitted annually from fossil fuel burning, cement production and deforestation (7900 Tg/C). Given with the facts the amount of ozone is equivalent to a 3mm ...

Chemistry 105
Ozone is depleted in the stratosphere by chlorine from CF3Cl according to the following set of equations: CF3Cl+UV light-->CF3+Cl Cl+O3-->ClO+O2 O3+UV light-->O2+O ClO+O-->Cl+O2 What total volume of ozone measured at a pressure of 22.0 mmHg and a temperature of 220...

Chemistry Ozone layer
what is the ozone layer made out of because on differnt websites it says different things and i thought it was made out of the three types of oxygen O2 O3 and i don't know the last one but on other things it says differnt please help me

10. One group of gases that is responsible for destroying ozone in the ozone layer is exhaust fumes B.CFCs C.nitrogen oxides and sulfur oxides D. Carbon monoxide and carbon dioxide I got B for my answer.

how many moles of ozone does the atmosphere hold?

What is the mass in grams of a 15.8 L sample of ozone (O3) at 1.67 atm and 30.0 °C?

Earth Science
In recent years, scientists have been concerned about decrease in the ozone content of earth’s upper atmosphere. What is the principle threat to humans if this decrease in ozone continues? My answer is, Decreasing precipitation leading to crop failure and possible human ...

1. Force exerted on an area is called _____. (1 point) pressure temperature gravity mass 2. The composition of the atmosphere is changing due to _____. (1 point) smog ozone depletion increase in CO2 (carbon dioxide) all of the above 3. The _____ is the layer of the atmosphere ...

Calculate The volume occupied at s.t.p by 0.24g of ozone ( o=16, G.M.V=22.4dm3

Aside from lead, the two air pollutants most hazardous to human health are: A. sulfur dioxide and carbon monoxide. B. ozone and sulfur dioxide. C. ozone and fine airborne particulates. D. nitrous oxides and carbon monoxide. is it A

I have absolutely no clue how to approach this question please help. The destruction of the ozone layer is an issue that is being discussed all around the world. Freons, or chlorinated hydrocarbon molecules, are very stable on the ground, but in the upper atmosphere, ...

What is the chemical composition of ozone, carbon dioxide, salt and water

True or false? 1 mole of ozone has 1.8 x 10^24 atoms? correct if wrong THANK YOU!

We only can make ozone layer by adding 3 oxygen atoms or we cannot

AP Chemistry
What effect would a catalyst have on the rate of reaction for the decomposition of ozone?

hi can someone please help me I need a detailed scientific article about ozone depletion thank you

29. CFCs are a problem because they a. have been released in large quantities in the past b. break down to reactive free chlorine atoms c. attack ozone molecules in the upper atmosphere d. all of the above D? 10. Ozone depletion in the atmosphere a. leads to the formation of ...

An excited ozone molecule, O3*, in the atmosphere can undergo one of the following reactions, O3* → O3 (1) fluorescence O3* → O + O2 (2) decomposition O3* + M → O3 + M (3)deactivation, where M is an inert molecule, the rate constant for the fluorescence ...

An excited ozone molecule, O3*, in the atmosphere can undergo one of the following reactions, O3* → O3 (1) fluorescence O3* → O + O2 (2) decomposition O3* + M → O3 + M (3)deactivation, where M is an inert molecule, the rate constant for the fluorescence ...

does anyone know what the effects of low level ozone is on animals and plants? Moderate to high levels of ozone causes respiratory problems in animals. it also slowly kills trees. This can be seen in portions of the San Bernardino Mountains affected by Los Angeles Basin smog. ...

Reaction Stiochiometry Involving Gases
Ozone is depleted in the stratosphere by chlorine from CF3Cl according to the following set of equations: CF3Cl + UV Light ---> CF3 + Cl Cl + O3 ---> ClO + O2 O3 + UV Light ---> O2 + O ClO + O ----> Cl + O2 What total volume of ozone measured at a pressure of 25.0 ...

three compounds A,B and C all have the formula C5H8. All three compounds will decolorize bromine in CCl4. Compound A reacts with NaNH2. Compounds A and B both yield pentane when they are treated with excess H2 with the pt catalyst. Under the same conditions C absorbs only 1 ...

A 32-u oxygen molecule (O2) moving in the +x direction at 580 m/s collides with an oxygen atom (mass 16 u) moving at 870 m/s at 27 degrees to the x axis. The particles stick together to form an ozone molecule. Find the velocity of the ozone. Express your answer in terms of the...

C12H20(Y)--> 22CH2=O+ 2CH3C(=O)CH2C(=O)CH3 The reagents used are ozone, Zn and H20 Give condensed formula of C12H20Y

The standard enthalphies of formation of ozone, O3(g), and oxygen atoms are +142.70 and +249.17 kJ/mol. Calculate the reaction enthalpy for 2O2(g)-->O3(g)+O(g)

if from 3moles MgSO4.7H2O all the 'o' atoms are taken out and converted into ozone, find the number of O3 molecules formed.

(1)Write a balanced equation in each case dilute htdrochloric reacts with[i]ZnCO3[ii]CuCO3 (2)Discuss how hydrocarbons contribute to the formation of ozone in the atmosphere

One of the concerns about the use of Freons is that they will migrate to the upper atmosphere, where chlorine atoms can be generated by the following reaction: CCl2F2 --> CF2Cl + Cl Chlorine atoms can act as a catalyst for the destruction of ozone. The Activation energy for...

If an electric discharge produces 800 cm3 of ozone (O3), how many cm3 of oxygen (O2) are required? 3O2(g) ---> 2O3(g)

Explain why different ozone depleting substances differ in terms of the length of time that elapses between their emission to the atmosphere and their release if catalytically active chlorine.

Can somebody help me please??? Ozone, O3 has a O-O-O connectivity. 1. Draw a lewis structure for ozone 2. Calculate the formal charge for each oxygen of ozone 3. Describe the shape of ozone http://dbhs.wvusd....

The decomposition of ozone is believed to occur in two steps O3 <==> O2 + O O3 + O ---> 2O2 Identify any reaction intermediate. What is the overall reacion? I got O3 + O3 --> O2 + 2O2

The decomposition of ozone is believed to occur in two steps O3 <==> O2 + O O3 + O ---> 2O2 Identify any reaction intermediate. What is the overall reacion? I got O3 + O3 --> O2 + 2O2

Integrated Physics and Chemistry
Some refrigerants used in air conditioners have been associated with.. A)somg B)destruction of the ozone layer C)thermal pollution D)power failures

Integrated Physics and Chemistry
Some refrigerants used in air conditioners have been associated with... A)smog B)destruction of the ozone layer C)thermal pollution D)power failures

PLS HELP ME(1)Write a balanced equation in each case dilute hydrochloric reacts with[i]ZnCO3[ii]CuCO3 (2)Discuss how hydrocarbons contribute to the formation of ozone in the atmosphere.I'M CONFUSED I NEED HELP!

The average rate of disappearance of ozone in the reaction 2O3(g) ---> 3O2 (g) is found to be 8.12 x 10^-3 molecules over 15 seconds. What is the rate of appearance of O2 during this interval

Dr. Mario Jose Molina won the Nobel Prize in Chemistry for his work studying which problem? a. the ozone layer*** b. deforestation c. the El Nino effect d. the greenhouse effect

How do I answer this question? The average rate of disappearance of ozone in the reaction 2O3 --> 3O2 is found to be 8.12 x 10^-3 molecules over 15 seconds. What is the rate of appearance of O2 during this interval?

A given volume of ozone diffused from a certain apparatus in 96seconds calculate the time taken by an equal volume of carbonoxide to diffuse under the same condition?

I need help on how to calculate the following please: Calculate the risk assesment of the amount of the ozone in the air between the hours of 4pm and 6pm where I live(Corpus Christi,Texas)

What is the ozone

The reaction describing the formation of ozone from oxygen is shown below. 3 O2(g) <--> 2 O3(g) Calculate Grxn at 288 K for this reaction in a flask where [O2] = 3.419 x 10-2 M and [O3] = 5.783 x 10-4 M. Assume G° = 326 kJ. Use molarity to construct the reaction ...

9th grade
how does ozone form?

Ozone layer formed

The ozone layer is located

The depletion of the Earth's ozone layer has created concern among some health experts. They believe that dramatic increases in the number of illnesses and deaths due to ultraviolet radiation rays may occur as a result of breaks in the ozone layer. The Environmental Protection...

How does the ozone effect the wind patterns

Why can't the ozone layer be higher in the atmosphere?

what do the ozone and oxygen have in common?

Why is ozone can be describe as our friend

If the equilibirium reaction is 2 03(g) <--> 3 O2 9(g) is first order with respect to ozone, what type of plot( meaning what is plotted on the y axis vs what is plotted on the x-axis) will yield a straight line? what will the slope of the line represent? PLEASE help im ...

9th grade
What are the similarities of ozone depletion and uv light

Physical Science
How does the ozone layer cause global warming?

environment chem
how many moles of ozone does the atmosphere hold?

How are oxygen and ozones alike? How are xyggen and ozone different?

how does the thinning of the ozone layer protect your health?

How does ozone gas to int get into the earth?

Is there a relationship between ozone depletion and global warming?

does methane have anything to do with ozone depletion? What Drainage basin does Michigan belong to? I have answered this one a couple of times already. Can I direct you to the statement in the conclusion in DrBob's ...

Hydrogen fluoride is used in the manufacture of Freons (which destroy ozone in the stratosphere) and in the production of aluminum metal. It is prepared by the reaction below. CaF2 + H2SO4 CaSO4 + 2 HF In one process 9.00 kg of CaF2 are treated with an excess of H2SO4 and ...

hi can someone please help me What is the chemical reaction mechanism of ozone depletion thank you

college physics
the question is that what happened when the ozone layer becomes destroyed?

earth science
what makes scientists think that the ozone layer is disappearing?

true or false some air pollutants are harmful to the ozone layer

Soil Chemistry
Understanding the strengths of carbon halogen bonds can help us to understand the behavior of CFCs and related molecules. Arrange the members of the set of carbon halogen bonds shown below in the order of bond strength. A) carbon dioxide B) methane C) ozone D) water A) c > ...

social studies
can you give little information about antartic ozone hole

Issue Sources Health/Environmental Effects Carbon dioxide (CO2) Chlorofluorocarbons (CFCs) Ground-level ozone (O3) Sulfuric acid (H2SO4) I need to complete the table above and have no idea what to do. Choose one of the following atmospheric issues: air pollution, global ...

Environmental Science
Nonliving and living factors that contribute to or are affected by the problem of the ozone layer?

A NASA satellite showed that in 2003 the ozone hole was much larger than it was in 2002. The 2003 hole measured 1.04 x in diameter, while the diameter of the 2002 hole was 6.9 x Calculate the difference in size between the two holes in square meters

I need help with unscrambling this sentence - a the absorbs upper rays uv beneficial of layer atmosphere, ozone

environmental science
what are the sources of the following: carbon dioxide CO2 chlorofluorocarbons CFC's ground level ozone

Which statement best summarizes the world’s reaction to stratospheric ozone depletion discussed in Chapter 7.4 of your text?

Chlorofluorocarbons (CFC's) are organic compounds that have been implicated in ozone depletion. When the CFC known as Freon 12 (CCl2F2) is exposed to UV radiation (wavelength in the range of 10 nm to 400 nm, a bit shorter than visible light), a chlorine atom breaks off from ...

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

what are sources and Health/Environmental Effects Carbon dioxide, Chlorofluorocarbons, Ground-level ozone, Sulfuric acid?

Difference between ozone depletion and global warming Must include 2 cause, 3 effects, 3 solutions and 2 internet information

How did the primordial atmosphere, photosynthesis, oxygen, the ozone layer, and the endosymbiotic theory influence the origin of living organisms?

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. Next>>

Post a New Question