Post a New Question

Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality

110,891 results

science
Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to ...

Chemistry
Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality.

Chemistry
1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality

Chem 3A
please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?

Chemistry
write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

chem help
i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate + calcium nitrate d) ...

Chemistry
Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...

Chemistry - please help
1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen sulphide and potassium ...

Chemistry
Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for NaN3... please ...

chemistry
Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

chemistry
Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

chemistry
write the balanced chemical equation for the reaction that would occur ewhen a base is added to a solution containing H2PO4-/HPO4^2- buffer system can you please help we write this balanced equation. thank you

chemistry
I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the reaction of ...

chemistry
Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Chemistry
A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in balancing this equation? Is the answer a.b.c or d? ...

Chemistry
A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in balancing this equation? Is the answer a.b.c or d? ...

Chemistry
NaCl [Symbol] Na + Cl2 Type of reaction: synthesis KOH + HNO3 [Symbol] HOH + KNO3 Type of reaction: double replacement Ca + S [Symbol] CaS Type of reaction: synthesis BaBr2 + Cl2 [Symbol] BaCl2 + Br2 Type of reaction: Cs2 + H2O [Symbol] CsOH + H2 Type of reaction: Na2CO [...

Chemistry
A solution is made by mixing NaOH and HNO3. Write a balanced equation for the reaction that occurs between the solutes. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Chemistry
Question 1. (SEE QUESTION 2 ) A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a....

Chemistry!!
1) Write balanced chemical equation for the oxidation of Fe^2+(aq) by S2O6^2-(aq)? 2)Write balanced chemical equation for the oxidation of Fe^2+ by N2O 3)Write balanced chemical equation for the oxidation of Fe^2+ by VO2+

Chemistry
Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams of HI should be ...

chemistry
Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams of ...

Chemistry
Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

Chemistry
Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

chemistry
Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

chemistry
Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases in your answer. ...

HELP PLEASE
I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is the main rule ...

Chemistry
Write a balanced chemical equation for the reaction of propylamine with water. Is propylamine --> CH3CH2CH2NH2? Is the equation CH3CH2CH2NH2 + H2O --> CH3CH2CH2NH3+ + OH- right? Isn't this balanced?

chemistry
Consider the following reagents: zinc, copper, mercury (density: 13.6 g/mL), silver nitrate solution, nitric acid solution. a. Given a 500-mL Erlenmeyer flask and a balloon can you combine two or more of the foregoing reagents to initiate a chemical reaction that will inflate ...

chemistry 20
A student mixed a solution of aqueous calcium chloride with an aqueous solution of magnesium sulphate. A precipitate formed. 1) Write the balance chemical equation for the reaction including states of matter. Ensure you write the reactants as a dissociated ions. 2) Based on ...

Chemistry
What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.

Cemistry
Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the states and if there ...

Chemistry
Write a balanced chemical equation (molecular equation). Write a total ionic equation. write a net ionic equation. (NH4)2 SO4(aq)+Na2CO3(aq) -->

Chem Help!
I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide forms from hydrogen and bromine. Type of ...

chemistry
Write a balanced chemical equation for the neutralization reaction between aqueous hydrochloric acid and aqueous calcium hydroxide. Be sure the formulas are written correctly before balancing, and include phases. HCl+H2CaO2 im not sure that's written correctly but that is what...

Chemistry - Le Chatelier's Principle
Hi, I have a question regarding the following chemical equilibrium equation: 2CrO4^2- + 2H3O^+ <--> Cr2O7^2- + 3H2O The question is: how would you manipulate the above equation to produce more Cr2O7^2- ions without adding any Chromium based compounds? I understand the ...

chemistry
What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare professionals? List a balanced ...

college chem
Two questions where I have to write a balanced net ionic equation. 1. Write a balanced net ionic equation for the reaction that occurs when aqueous solutions of sodium chromate and silver nitrate are mixed 2. Write a balanced net ionic equaion reaction for the acid-base ...

chemistry
Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking soda. 3. Record your ...

Chemical Equations
Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. Communicate the balanced chemical equation ...

Chemistry
Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide with hydrochloric acid ...

Chemistry
in a neutralization reaction, dilute tetraoxosulphate (vi) acid completely reacted with sodium hydroxide solution.write a balanced chemical equation for the reaction

Chemistry
Nitric acid is a component of acid rain that forms when gaseous nitrogen dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous nitric acid. Write a balanced chemical equation for this reaction. Express your answer as a chemical equation. Identify all of...

chemistry
testing bronsted lowry reaction predictions...... im super stuck can someone help me steo by step how to figure this out assuming i use the 5 step process? write a balanced chemical equation for ch3coona and hcl reaction position of equilibrium. I know that ch3coo is a SB and ...

Chemistry
Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4

chemistry
Answer the following questions based on the following electrochemical reaction: Al(s) + Cu 2+(aq) <====> Cu(s) + Al3+ (aq) Write the balanced chemical equation for this cell. I'm confused.. how would this be balanced?

chemistry check
A) Write a balanced chemical equation for the reaction between sulfuric acid and potassium hydroxide. I got H2SO4 + KOH ---> H2OH + KSO4 B) Write the ionic equation for the reaction. H2 + S2O4-2 + K + OH- ---> H2 + OH + K2SO4-2 C) Write the net ionic equation I'm not ...

chemistry
Write the balanced formula equation, complete ionic equation, and net ionic equation. If no precipitate forms, write "No reaction" a) Hg2(NO3)2 (aq) + CuSO4 (aq) b) Ni(NO3)2 (aq) + CaCl2 (aq) c) K2CO3 (aq) + MgI2 (aq) d) Na2CrO4 (aq) + AlBr3 Please explain! Thank you

science
Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation below is an unbalanced ...

chemistry
Does this equation need to be balanced? AlCO3 => AlO+CO2 Also, how would this equation be balanced? NiCl+O2 => Ni2O3+Cl2O5 Neither equation you have is an equation so they can't be balanced. Do you mean aluminum carbonate. That would have the formula Al2(CO3)2. Aluminum ...

Chemistry
WRITE THE BALANCED CHEMICAL EQUATION,WRITE THE OVERALL IONIC EQUATION,IDENTIFY THE SPECTOR IONS AND POSSIBLE PRECIPITATES,WRITE THE NET IONIC EQUATION FOR mercury(II)chloride(aq)+potassium sulfide(aq)

Chemistry
Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???

chemistry
Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

chemistry
Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

chemistry
write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.

chemistry
Please help me!!! Write a balanced chemical equation for oxidation-reduction reaction of fluorene

Chemistry (Help)
For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each chemical reaction, ...

Chemistry
When iron metal reacts with oxygen, the reaction can form Fe2o3 (numbers are subscripts). Write a balanced chemical equation for this reaction and find the number of moles of oxygen that are needed to form 6 mol of Fe2o3. Show your work. I am really stuck and I don't know how ...

chemistry
write a balanced chemical equation for the following reaction including states not complete; no question.

chemistry
Write a balanced chemical equation for the reaction that occurs when the hydrocarbon styrene, {\rm C}_{8}{\rm H}_{8}(l), is combusted in air.

chemistry
is this the answer to B ) CH3CH2OH + 3O2 → 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol...

chemistry
When ammonia gas is burned in oxygen the products formed are water and nitrogen monoxide gas. Write the balanced equation showing this reaction NH4 + O2 --> H2O + NO i am stuck balancing this

Physical Science
For questions #14 – 17, write an equation for the reaction of magnesium oxide with sodium chloride to produce magnesium chloride and sodium oxide. 14. Show the formulas of the reactants. 15. Show the formulas of the products. 16. Write the balanced the equation for this ...

Chemical Formulas and Reactions
When aqueous copper(II)chloride reacts with aqueous ammonium phosphate, soluble ammonium chloride forms and copper(II) phosphate precipitates out of solution. 1. Write the balanced molecular equationfor this reaction. 2. Write the balanced complete ionic equation for this ...

College chemistry
Need help balancing chemical equation. Complete and balance the chemical equation. Be sure to include the states of the reactants and products. C3H8(g)+O2(g) →

chemistry
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

chemistry help!!!
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

chemistry help!!!
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

Chemistry
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

CHEMISTRY!!!!
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

chemistry help!
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

CHEMISTRY!!!!
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

Chemistry
In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the equation i think it's C2H6OH...

chemistry
my ques ok a coumpond containing 3atoms of carbon an 8 atoms ofhydrogen combined in reaction with oxy molecules the two end products of this equation are carbon dioxide co2 an water wat element should i look at first in balancing this question and wen i hav finished balancing ...

Chemistry
Can someone tell me if I have this correct, I am leaving something out, or if I need to start over. I am alittle confused about the balanced equation involving a reaction. Write a balanced equation for the reaction of MG with HCI. Mg+HCL---MgCl2=H2 Mg-1 Mg-1 H-1 H-1 Cl-1 Cl-2 ...

Chemistry..
A chemical engineer calculated that 15.0 mol H2 was needed to react with excess N2 to prepare 10.0 mol NH3. But the actual yield is 60.0% . Write a balanced chemical equation for the reaction. Is the amount of H2 needed to make 10.0 mol NH3 more than, the same as, or less than...

chemistry
Need help balancing this chemical reaction equation Ca(NO3)2+2NaOH>Ca(OH)2+2NaNO3

Chemistry
Write the balanced chemical equation for the reaction of the weak acid HCN with water. Include the phase of each species.

Chemistry
hi I'm having a serious problem with balancing chemical equations , can someone explain to me how we can do them also if i had a word equation hhow can i convert it into a symbolic equation and balance it e.g can someone show me how we do this equation: KOH3+HNO3 ---}( what's ...

Chemistry
hi I'm having a serious problem with balancing chemical equations , can someone explain to me how we can do them also if i had a word equation hhow can i convert it into a symbolic equation and balance it e.g can someone show me how we do this equation: KOH3+HNO3 ---}( what's ...

Chemistry Pleasee Help
Can you please help me with these problems, I followed the textbook but i am still not getting the write balanced equations.I am not sure if it is the phases or my balancing, or if i got the right answers and not submitting it correctly Please I really need help :( Write ...

Chemistry
Hydrogen peroxide can act as either an oxidizing agent or a reducing agent, depending on the species present in solution. Write balanced half-reaction equations for each of the following: (a) H2O2(aq) acting as an oxidizing agent in an acidic solution. Write the balanced half-...

Chemistry
Completion Stuck on number 7 & 11 on my homewowrk 7)An Equation must never be balanced by changing the _______ in the chemical formula of a substance. 11)If a _______ is used to increases the rate of a chemical reaction its formula is written above the arrow I think 7 is "...

chemistry
im doing a lab on le chatelier's priciple and the question is 'describe what you observe when the saturated solution of sodium chloride was stressed by the addition of CL- ions, write the ionic equation and explain how le chatelier's principle is applied to this experiment.' i...

chemistry
write a balanced chemical equation for the process of photosynthesis and the conditions of the reaction giving physical state of all the substances

Chemistry
Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Chemistry
Copper(II) chloride and lead(II) nitrate react in aqueous solutions by double replacement. Write the balanced chemical equation, the over all ionic equation, and the net ionic equation for this reaction. If 16.06g of copper(II) chloride react, what is the maximum amount of ...

chemistry BOB
is this the answer to B ) CH3CH2OH + 3O2 → 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol...

Fundamental Chemistry
Given the balanced reaction below; write out the balanced ionic equation and the balanced net ionic equation. Include phase labels and charges where appropriate. Cu(s) + Zn(NO3)2 (aq) → Cu(NO3)2 (aq) + Zn(s)

chemistry
What is the balanced chemical equation of Shampoo? And what is the chemical reaction of it? Please i need a help ASAP! Thank you!

Chemistry1
The questions asks to write a word equation and a balanced chemical equation for a reaction between aqueous copper (ii) sulfate and solid iron. Assume that iron forms the Fe2+ ion.) Include proper states of matter after each substance (s, l, g, aq). Here is what I got ANSWER: ...

chemistry
1. An aqueous solution of weak base B of unknown concentration is tritrated with a known concentration of strong acid, HA. (a) Write the balanced chemical equation for this acid-base reaction, identifying the conjugate acid/base pairs. (b) If the base-dissociation constant of ...

Chemistry
I have to write the balanced equation for the reaction between hydrochloric acid and zinc metal.I came to the answer of: HCl+Zn(s)-->H(g)+ ZnCl Can someone tell me if this is the correct balanced equation for this reaction? No it isn't but it's close. The gas hydrogen ...

College Chemistry
One liter of benzene (C6H6) is completely burned (oxidized) with air. Write a balanced chemical equation to represent this reaction.

Organic Chemistry
1. Benzene is often produced as a side product during Grignard reactions where phenylmagnesium bromide is used as the Grignard reagent. How can its formation be explained? Please include a balanced chemical equation that describes its formation. 2. Why, after the reaction is ...

Chemistry
Write a balanced molecular equation for aqueous nitric acid and aqueous ammonia. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Chemistry
Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. a. Which of the two reactants is a limiting reactant? Show your calculations (including the correctly balanced chemical ...

chemistry
help!!!! is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion ...

CHEMISTRY
In half reaction method of the chemical equation balancing , how about those redox reactions that they don't contain any (H) and ( O ) atoms ?

AP Chemistry
i'm having trouble balancing the redox reaction for the iodine clock lab. The redox reaction inovlves a hydrogen sulfite ion and iodate ion in an acidified solution. i have the final balanced equation, 5 HSO3 + 2 IO3 ---> I2 + 5SO4 + H20 + 3H but i'm having trouble figuring...

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. Next>>

Post a New Question