July 24, 2014

Search: Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality

Number of results: 63,451

chem help
i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate + calcium nitrate d) ...
January 15, 2013 by thad

Chemistry - please help
1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen sulphide and potassium ...
December 6, 2007 by kim

Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for NaN3... please ...
October 8, 2012 by Heather

Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
January 25, 2013 by Anonymous

Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
September 25, 2011 by Anonymous

Chem 3A
please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?
July 25, 2008 by shylo

I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the reaction of ...
April 21, 2014 by jazz

Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
October 1, 2012 by Anonymous

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...
March 12, 2012 by Susan

Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams of HI should be ...
October 20, 2012 by Tasha

What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare professionals? List a balanced ...
May 16, 2014 by slomomo

Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams of ...
October 19, 2012 by Tasha

What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.
March 7, 2009 by Lucy

1) Write balanced chemical equation for the oxidation of Fe^2+(aq) by S2O6^2-(aq)? 2)Write balanced chemical equation for the oxidation of Fe^2+ by N2O 3)Write balanced chemical equation for the oxidation of Fe^2+ by VO2+
May 4, 2012 by John

A solution is made by mixing NaOH and HNO3. Write a balanced equation for the reaction that occurs between the solutes. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
July 15, 2010 by Wende

Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases in your answer. ...
February 9, 2009 by Jake

Need Help Finishing: Purpose: To observe a chemical reaction. Materials: Vinegar (acetic acid, CH3COOH) Baking soda (NaHCO3) Measuring cups and spoons Cup Procedure: 1. Place cup of vinegar in the cup. 2. Add 1 tablespoon on baking soda. 3. Record your observations...
January 21, 2007 by key

Write a balanced chemical equation for the reaction of propylamine with water. Is propylamine --> CH3CH2CH2NH2? Is the equation CH3CH2CH2NH2 + H2O --> CH3CH2CH2NH3+ + OH- right? Isn't this balanced?
November 13, 2011 by Steph

Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality.
March 7, 2012 by Adrian

1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality
January 15, 2013 by Tyler

Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4
July 21, 2009 by Michelle

college chem
Two questions where I have to write a balanced net ionic equation. 1. Write a balanced net ionic equation for the reaction that occurs when aqueous solutions of sodium chromate and silver nitrate are mixed 2. Write a balanced net ionic equaion reaction for the acid-base ...
June 2, 2009 by kelly

Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...
November 8, 2012 by Amanda

Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???
March 22, 2010 by Danny

Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)
March 1, 2011 by Jazmin

Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)
March 1, 2011 by Jazmin

write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.
September 11, 2011 by jess

Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the states and if there ...
March 16, 2012 by Julie

write a balanced chemical equation for the following reaction including states not complete; no question.
July 30, 2007 by walter

Write a balanced chemical equation for the reaction that occurs when the hydrocarbon styrene, {\rm C}_{8}{\rm H}_{8}(l), is combusted in air.
October 4, 2011 by seema

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
April 18, 2013 by Ashley

testing bronsted lowry reaction predictions...... im super stuck can someone help me steo by step how to figure this out assuming i use the 5 step process? write a balanced chemical equation for ch3coona and hcl reaction position of equilibrium. I know that ch3coo is a SB and ...
November 20, 2012 by Tara

Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide with hydrochloric acid ...
November 30, 2013 by T.C.

Chemical Equations
Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. Communicate the balanced chemical equation ...
December 2, 2011 by Fizzylicous

Chem Help!
I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide forms from hydrogen and bromine. Type of ...
April 8, 2008 by Lisa

1. An aqueous solution of weak base B of unknown concentration is tritrated with a known concentration of strong acid, HA. (a) Write the balanced chemical equation for this acid-base reaction, identifying the conjugate acid/base pairs. (b) If the base-dissociation constant of ...
April 8, 2011 by Phuong

Hydrogen peroxide can act as either an oxidizing agent or a reducing agent, depending on the species present in solution. Write balanced half-reaction equations for each of the following: (a) H2O2(aq) acting as an oxidizing agent in an acidic solution. Write the balanced half-...
April 28, 2014 by Alexis

11 U chemistry
Predict the products of a reaction between solid beryllium chloride and solid potassium,write the products in a balanced chemical equation also indicate what type of reaction this is.
June 7, 2011 by timothy

College Chemistry
One liter of benzene (C6H6) is completely burned (oxidized) with air. Write a balanced chemical equation to represent this reaction.
September 25, 2011 by Jenny

Suppose you tired to carry out a double-replacement reaction by mixing together equal volumes if a solution that contained dissolved NaF and a solution NaCl. Would you expect a reaction, if Si write the balanced chemical equation
April 25, 2011 by Lou

Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the production of one mole...
October 20, 2012 by Sam

Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation below is an unbalanced ...
April 21, 2007 by katie

Completion Stuck on number 7 & 11 on my homewowrk 7)An Equation must never be balanced by changing the _______ in the chemical formula of a substance. 11)If a _______ is used to increases the rate of a chemical reaction its formula is written above the arrow I think 7 is "...
March 19, 2007 by Chris

Write a balanced chemical equation that represents the reaction between methane and hydrochloric acid. CH4+HCl-> I'm not quite sure what please? Thanks in advance!
June 6, 2012 by Cicilia

Can someone tell me if I have this correct, I am leaving something out, or if I need to start over. I am alittle confused about the balanced equation involving a reaction. Write a balanced equation for the reaction of MG with HCI. Mg+HCL---MgCl2=H2 Mg-1 Mg-1 H-1 H-1 Cl-1 Cl-2 ...
February 4, 2008 by Tim

write a balanced chemical equation for the reaction that occurs when aqueous solutions of sodium chloride and sodium iodate are mixed
October 5, 2010 by k

2cr(s) + SnCL4(aq) --> can this reaction occur if so write the balanced equation if it doesnt explain why
April 16, 2009 by mel

Write the balanced formula equation, complete ionic equation, and net ionic equation. If no precipitate forms, write "No reaction" a) Hg2(NO3)2 (aq) + CuSO4 (aq) b) Ni(NO3)2 (aq) + CaCl2 (aq) c) K2CO3 (aq) + MgI2 (aq) d) Na2CrO4 (aq) + AlBr3 Please explain! Thank you
December 11, 2011 by Gabby

Write a balanced chemical equation (molecular equation). Write a total ionic equation. write a net ionic equation. (NH4)2 SO4(aq)+Na2CO3(aq) -->
March 15, 2011 by Jake

Organic Chemistry
1. Benzene is often produced as a side product during Grignard reactions where phenylmagnesium bromide is used as the Grignard reagent. How can its formation be explained? Please include a balanced chemical equation that describes its formation. 2. Why, after the reaction is ...
April 28, 2012 by genius

February 9, 2011 by Jasmine

Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. a. Which of the two reactants is a limiting reactant? Show your calculations (including the correctly balanced chemical ...
February 27, 2014 by Nyla

write a balanced chemical equation for calcium nitate plus sulfuric acid produces calcium sulphate and ? This is a metathetical reaction, I think more properly called a double displacement reaction now. Just change + and - partners. Ca(NO3)2 + H2SO4 ==> CaSO4 + HNO3. I will...
August 9, 2007 by walter

physical science with earth science
Write a balanced chemical equation for the reaction for propane C3H8 burning in oxygen to for carbon dioxide and water vapor
December 2, 2010 by abby

Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated.
January 25, 2013 by Anonymous

Chemistry- Stoichiometry
"Why must a chemical reaction be balanced before it can be used in stoichiometry?" I mean, I get it, that the equation will be off if it doesn't start out balanced, but, why? How do I phrase that?
September 27, 2007 by Shelby

physical science
When iron metal reacts with oxygen, the reaction can form Fe2O3. Write a balanced chemical equation for this reaction, and find the number of moles of oxygen that are needed to form 6 mol of Fe2O3. Show your work.
January 7, 2013 by Megan

Use the activity series of metals to write a balanced chemical equation for each single-replacement reaction. Zn(s) + AgNO3 (aq) --> NOTE: The three above is a should be a small 3. Please explain how to figure out this problem, and provide a thorough ...
February 5, 2008 by stacy

Write the balanced chemical equation for each of the following. (Use the lowest possible coefficients. Include states-of-matter at 1 atm and 25unknown_prefixC in your answer.) (b) the reaction of magnesium metal and hydrobromic acid
April 2, 2014 by Grace

The electrolysis (decomposition) of water produces hydrogen gas at the rate of 30.0 mL/min. A) Write a balanced chemical equation for this reaction and include phase designations. 2H2O(aq)---> 4H2(g)O2(g) Is whatever I've done above correct? B) What volume of hydrogen gas ...
October 11, 2010 by Anonymous

I have to write the balanced equation for the reaction between hydrochloric acid and zinc metal.I came to the answer of: HCl+Zn(s)-->H(g)+ ZnCl Can someone tell me if this is the correct balanced equation for this reaction? No it isn't but it's close. The gas hydrogen ...
April 23, 2007 by Chrissy

decomposition of water to form elemental Hydrogen and Oxygen gas. What will be the balanced chemical equation, type of reaction and the driving force of the reaction?
October 3, 2012 by shay

1. Write the balanced chemical equation for the reaction NaOH + HCI --> NaCI + H20 2. Extract the relevant information from the qustion: NaOH v= 30mL, M=0.10 HCI v= 25.0 mL, M=? 3. Convert to Liters NaOH v= 0.03 L, M= 0.10M HCI v=0.025L, M=? 4. Calculate moles NaOh: n(NaOH...
March 8, 2010 by Maria

Suppose you tired to carry out a double-replacement reaction by mixing together equal volumes of a solution that contained dissolved NaF and a solution that contained dissolved NaCl. Would you expect a reaction, if so write the balanced chemical equation?
April 25, 2011 by Anonymous

another A.P Chemistry Question
A different rigid 5.00L cylinder contains 0.176mol of NO(g) at 298 k. A 0.176mol sample of 02(g) is added to the cylinder, where a reaction occurs to produce NO2(g) (d) write the balanced equation for the reaction. (e) calculate the total pressure, in atm, in the cylinder at ...
October 23, 2006 by T-Baby

Diborane and related compounds were proposed as rocket fuels in 1950s. A representative reaction for this class of molecules that B2H6 and O2. Write the balanced chemical reaction
August 20, 2012 by PJcotieboi

1) Write a balanced chemical equation for the reaction between Cu(NO3)2 * 3 H2O and NaOH. Underline the formula for the precipitate produced by this reaction. (The water of hydration in Cu(NO3)2 * 3 H2O appears as liquid water on the right side of the equation) 2) Calculate ...
May 17, 2010 by Sarah

Urea (NH2)2CO is prepared by reacting ammonia with carbon dioxide. The byproduct is water. 637.2g of ammonia are reacted with 787.3 g of carbon dioxide. a. (15 points) Which of the two reactants is a limiting reactant? Show your calculations (including the correctly balanced ...
February 28, 2014 by Keni

Mg + HCl ----> MgCl2 + H2 If the water in tube is evaporated , the other product , a white salt remains . Write the balanced chemical equation . Ans: Mg + HCl ----> MgCl2 + H2 + H2O I don't know how to balanced it . I'm confusing where O is in reactants to balanced. ...
February 27, 2013 by Maria

A chemical engineer calculated that 15.0 mol H2 was needed to react with excess N2 to prepare 10.0 mol NH3. But the actual yield is 60.0% . Write a balanced chemical equation for the reaction. Is the amount of H2 needed to make 10.0 mol NH3 more than, the same as, or less than...
January 2, 2013 by Anonymous

what is the balanced chemical equation for the reaction between Fe and S? ?Fe + ?S -->
February 26, 2009 by carrie

Nitric acid is a component of acid rain that forms when gaseous nitrogen dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous nitric acid. Write a balanced chemical equation for this reaction. Express your answer as a chemical equation. Identify all of...
October 15, 2010 by Lisa

Write a balanced molecular equation for aqueous nitric acid and aqueous ammonia. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
October 3, 2011 by Anonymous

chem need assistance
Write a balanced chemical reaction to show the reaction between ammonium and a chlorite? Is this correct? 2NH3 + CLO2 + H2O ⇒ NH4Cl + NH2O2
November 1, 2010 by dan

Consider the following unbalanced equation. H1+(aq) + Fe(s) H2(g) + Fe2+(aq) What is the balanced oxidation half-reaction? What is the balanced reduction half-reaction? What is the balanced overall cell reaction?
June 8, 2012 by Mel

Calculate the amount (volume) of 5.25% (wt./vol.) NaOCl solution (commercial bleach) required to oxidize 100 mg of 9-fluorenol to 9-fluorenone. Whenever appropriate, use balanced chemical equations as a part of your calculation. I know that I need to start off with the ...
December 22, 2009 by Sarah

12 chemistry
Write the balanced chemical equation for each reaction: K2MnO4(aq)+H2SO4(aq)+NaHSO3(aq)= ? K2MnO4(aq)+NaOH(aq)+NaHSO3(aq)= ? start with the net ionic equations.
September 28, 2009 by izzy

Write a balanced chemical reaction showing how the 4.99 g Sn dissolves in HNO3.
April 28, 2010 by Orangutan

Copper(II) chloride and lead(II) nitrate react in aqueous solutions by double replacement. Write the balanced chemical equation, the over all ionic equation, and the net ionic equation for this reaction. If 16.06g of copper(II) chloride react, what is the maximum amount of ...
March 16, 2010 by Steven

1-Butene (CH2=CHCH2CH3) burns in the presence of O2 to produce CO2 and H2O. Write the balanced chemical equation for this reaction (omit physical states and use condensed molecular formulas). CH2CHCH2CH3+6O2=4CO2+4H2O
February 14, 2012 by krystal

write a balanced chemical reaction representing the combustion of hexane? C6H14
February 5, 2012 by April

The reaction of calcium bicarbonate, Ca(HCO3)2 with hydrochloric acid, HCl, produces a solution of CaCl2, gaseous carbon dioxide, CO2, and water, H2O. Write a balanced chemical equation for this reaction and determine the volume of CO2, in mL, that forms at 30.0 oC and 0.660 ...
July 20, 2011 by terria

With which of the following will the weak acid HCHO2 react? If a reaction occurs, write the balanced molecular equation. If no reaction occurs write the left half of the reaction and use "NR". Do not include physical states in your answers. KOH: NH3:
November 1, 2011 by Colt

Wwrite a balanced equation for the following chemical processes: the reaction between NaOH an dsalicyclic acid; the reaction between HCl and socium benzoate.
June 3, 2009 by Mandy

write the balanced chemical equation for the reaction that occurs when water is added to anhydrous BaCl2. would it be BaCl2+2H2o --> BaCl2+2H2O
September 11, 2011 by jess

In the reaction between formic acid (HCHO2) and sodium hydroxide, water and sodium formate (NaCHO2) are formed. To determine the heat of reaction, 75.0 mL of 1.07 M HCHO2 was placed in a coffee cup calorimeter at a temperature of 20.8 C, and 45.0 mL of 1.78 M NaOH, also at 20...
April 4, 2013 by timmy

hydrogen selenide can be prepaired by reacting aluminium selinide with water the other product being solid aluminium hydoxide AL(OH)3,write a balanced chemical equasion for the reaction of aluminium selenide with water including the phisical states of the reactents can u help ...
January 26, 2007 by jill

I need to write a balanced equation for this problem and am having difficulty doing so. The question is this: use the mole ratio of CuO produced per mole of malachite to write a balanced equation for the malachite decomposition reaction. Assume that CO2 is also a product of ...
February 22, 2009 by Laura

What is the balanced chemical equation for the reaction used to calculate of delta Hdagrees f of CaCO3(s)?
October 19, 2008 by Lilit***

What is the balanced chemical equation for the reaction of potassium with oxygen? would it be: K + 0 --> K20 I am not sure can you help me?
February 9, 2009 by sabrina

Using the activity series, write a balanced chemical equation for the following reactions: 1. iron metal is added to a solution of copper (II) nitrate 2. zinc metal is added to a solution of magnesium sulfate 3. hydrobromic acid is added to tin metal 4. hydrogen gas is bubbled...
March 27, 2011 by Jessica

chemistry-balanced redox equations
Use the following steps to balance the redox reaction below: Mg + Au+ Mg2+ + Au a. Write the oxidation and reduction half-reactions. Make sure each half-reaction is balanced for number of atoms and charge b. Multiply each half-reaction by the correct number, in order to ...
March 25, 2012 by princess

Copper(II) chloride and lead(II) nitrate react in aqueous solutions by double replacement. Write the balanced chemical equation, the overall ionic equation, and the net ionic equa- tion for this reaction. If 10.27 g of copper(II) chloride react, what is the maximum amount of ...
February 23, 2014 by jan

I did a lab where we had to determine the iron content in ore...i am confused about the reactions that occured during the reaction...i need reactions for the following... 1) The samples were treated with 6M HCl until all the iron ore dissolved.Assuming all of the ore is in the...
December 1, 2009 by Joanna

How do I write out the reactants and products for the following chemical equation? How do I write the names of the products? How do I write the net ionic reaction for this double replacement reaction? barium acetate and potassium phosphate ->
July 8, 2009 by Sue

The first step of the synthesis is described by the reaction below. When 1.750 g of Fe(NH4)2(SO4)2 6H2O is mixed with 13 mL of 1.0 M H2C2O4 , the theoretical yield of FeC2O42H2O is ? grams.. I do not understand why my answer is not correct. How do you find the answer for this ...
June 30, 2007 by Tiffany

In the formation of acid rain, sulfur dioxide reacts with oxygen and water in the air to form sulfuric acid. Write the balanced chemical equation for the reaction. (Type your answer using the format CH4 for CH4.)
February 2, 2012 by skyler

Write the balanced chemical equation for the reaction of sodium bicarbonate with aqueous acetic acid to produce carbon dioxide, water, and sodium acetate. Follow the example set by the sodium bicarbonate.
October 19, 2011 by Rodney

how do you write the balanced chemical equation of Fe3+-ASA
January 27, 2010 by blasting

In acidic solution MnO4- oxidizes H3AsO3, a weak acid, to H3AsO4, a weak acid, and is reduced to Mn2+. Write the balanced net ionic equation for this reaction. How many H+ are there in the balanced equation
October 9, 2010 by faith

Pages: 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | Next>>
