Post a New Question

Which substance is an electrolyte? C2H5OH C6H12O6 C12H22O11 CH3COOH

3,197 results

chemistry
Which substance is an electrolyte? C2H5OH C6H12O6 C12H22O11 CH3COOH

Chemistry
The hydrolysis of sucrose (C12H22O11) produces fructose and glucose (each C6H12O6). Two mechanisms are proposed: I) Step 1: C12H22O11 --> C6H12O6 + C6H10O5 (slow) Step 2: C6H10O5 + H2O--> C6H12O6 (fast) II) C12H22O11 + H2O--> C6H12O6 + C6H12O6 Would these mechanisms ...

Chemistry
Which of the following solutions would have the highest osmotic pressure? 0.15 M KCl 0.2 M C6H12O6 0.2 M C12H22O11 0.2 M CH3COOH 0.15 M CaCl2

chemistry
The fermentation of sugar (C6H12O6) to form ethanol (C2H5OH) and carbon dioxide (CO2) occurs according to the following equation: C6H12O6(aq) ¡ú 2 C2H5OH(aq) + 2 CO2(g) kJ mol¨C1 ¦¤Hf (C6H12O6(s)) is ¨C1275 ¦¤Hf (C2H5OH(l)) is ¨C277 ¦¤Hbond (C=O) 799 (a) Assuming ...

chem
Consider the fermentation reaction of glucose: C6H12O6 ----) 2C2H5OH+2CO2 A 1.00-mol sample of C6H12O6 was placed in a vat with excess yeast. If 35.1 g of C2H5OH was obtained, what was the percent yield of C2H5OH?

chem
The equilibrium constant Kc equals 5.90 for the reaction CH3COOH + C2H5OH <==> CH3COOC2H5 + H2O Find the molar concentrations of acetic acid, ethanol, ethyl acetate, and water at equilibrium when .10 M acetic acid and .20 M ethanol are allowed to equilibrate. I started ...

chemistry
given C12H22O11+H2O----C6H12O6+C6H12O6 heat combustion 0f 2815.8 kj/mol what is the standard enthalpy

chemistry
given C12H22O11+H2O----C6H12O6+C6H12O6 heat combustion0f 5646.7kj/mol what is the standard enthalpy

chemistry
given C12H22O11+H2O----C6H12O6+C6H12O6 heat combustion0f 2826.7kj/mol what is the standard enthalpy

chemistry
4. Give two reasons why graphite (carbon) electrodes are used in electrolysis. 5. You have 2 compounds called X and Y. X melts at 1200 degrees C and is soluble in water. Y melts at 156 degrees C and is insoluble in water. Draw 2 diagrams to show how you could prove which of ...

chem
. Give two reasons why graphite (carbon) electrodes are used in electrolysis. 5. You have 2 compounds called X and Y. X melts at 1200 degrees C and is soluble in water. Y melts at 156 degrees C and is insoluble in water. Draw 2 diagrams to show how you could prove which of ...

chemistry
The fermentation of glucose to form ethanol occurs according to the following chemical reaction: C6H12O6(aq) → 2 C2H5OH(l) + 2 CO2(g) A) If 700 grams of glucose (C6H12O6) are fermented, what is the maximum volume in milliliters of ethanol (C2H5OH) that can form? (Density of ...

Chemistry
net ionic equation for the following molecular equation. HNO3 is strong electrolyte and CH3COOH is weak electrolyte. NaCH3COO(aq)+HNO3(aq)----->NaNO3(aq)+CHOOH(aq

Chemistry
net ionic equation for the following molecular equation. HNO3 is strong electrolyte and CH3COOH is weak electrolyte. NaCH3COO(aq)+HNO3(aq)----->NaNO3(aq)+CHOOH(aq

chemistry
if C6H12O6 -> 2 C2H5OH + 2 CO2 represents the fermentation of sugar to produce alcohol, and the reaction is only 40.0% efficient (% yield), what is the actual yield of alcohol from 454 g of C6H12O6

Chem
Can you please tell me if these are right? Classify the solutes in the following equations as a weak electrolyte, a strong electrolyte of a non electrolyte in water. a. XY2(s)=X2+(aq) +2Y-(aq) b. HX(g) ß=H+(aq) + X-(aq) c. XYZ(s)=XYZ(aq) d. YOH(s)=Y+(aq) + OH-(aq) a. strong ...

Chemistry
I'm not sure if i did this problem right or not. I keep reading through my book, and i think i followed the equations right, but i'm not confident with my answers. The problem: 5.0 g of glucose,C6H12O6, is disolved in 500.0 g of acetic acid. What is the new freezing point and ...

chemistry
C2H5OH+O2-CH3COOH+H2O HOW MANY MOLES OF ETHANOL IN 5g

Chemisty
How many grams of c6h12o6 are needed to form 7.50g of c2h5oh

Chemistry
Which substance is a conductor of electricity ? (1)NaCl(s) (2)NaCl (l) (3)C6H12O6(s) (4) C6H12O6 (l) thanks for any help !

chem
C6H12O6(aq)->2 C2H5OH(aq) + 2CO2(g) Fermentation of 744mL grape juice(density=1.0 g/cm^3) is allowed to take place in a bottle witha V of 825mL until 12% by volume is ethanol (C2H5OH). Assuming CO2 is insoluble in H2O what would the pressure be of the CO2 inside the wine ...

science
How could you distinguish one from the other? (a) CH3COOH and CH3OH? (b) C2H5OH and H2O?

chemistry
Subject – equilibria Pure ethanoic acid (25.0cm3, CH3COOH), pure ethanol (35.0 cm3, C2H5OH) and pure water (20.0cm3, H2O) were mixed in a sealed flask at room temperature. The flask was placed in a heated water bath and maintained at 323K until equilibrium was established. ...

carbon+sugar=starch
Why are you saying that carbon is needed to make starch? Actually only sugar (glucose) is needed along with an enzyme to catalyze the linkage of multiple glucose units in a dehydration (loss of water) reaction. Glucose + Glucose ----> maltose + H2O maltose is disaccharide. ...

chemistry
Which of the following would have the lowest vapor pressure? A. 0.8 m C6H12O6 B. 0.10 m C6H12O6 C. 0.05 m C6H12O6 D. 0.15 m C6H12O6 I think it is D... is that correct? Which of the following would have the lowest boiling point? A. 0.8 m C6H12O6 B. 0.10 m C6H12O6 C. 0.05 m ...

Environmental Science
Answer the questions about the following processes in the space provided below. You only need to indicate a process by its number. For each question list as many processes as apply. Process 1: 6 CO2 + 6 H2O → C6H12O6 + 6 O2 Process 2: C6H12O6 + 6 O2 → H2O + 6 CO2...

chemistry
Calculate the volume ( mL ) of the solute C2H5OH and the mass ( g ) of the solvent diethyl ether that should be mixed to produce 3.46 kg of a solution that is 1.31 m C2H5OH. volume ( mL ) of the C2H5OH mass ( g ) of the (C2H5)2O Molar Mass (g/mol) C2H5OH 46.07 (C2H5)2O 74.12 ...

chemistry
Which of the following can be classified as a pure compound? Choose one answer. a. iodine, I2 b. sugar, C12H22O11 c. mercury, Hg d. alcohol in water, C2H5OH in H2O e. carbon, C

science
What have the compounds in each of these pairs in common? How could you distinguish one from the other? (a) CH3COOH and CH3OH? (b) C2H5OH and H2O?

science
If 23 g of ethanol (c2h5oh) is dissolved in 60 g of ethenoic acid (ch3cooh). Then find out the mole fraction of each component?

chemistry
what is the net ionic equation for the following molecular equation. HNO3 is strong electrolyte and CH3COOH is weak electrolyte. NaCH3COO(aq)+HNO3(aq)----->NaNO3(aq)+CHOOH(aq) the same question says use H+ for the hydronium ion, CH3OOH for acetic acid and CH3COO for the ...

chemisrty
put in decreasing freezing point 0.10m Na3PO4,0.35m NaCl,0.20 m MgCl2, 0.15 m C6H12O6,0.15 m CH3COOH

chemistry
Calculate the molarity of a solution containing 40.0 g glucose (C6H12O6) in enough ethanol (C2H5OH) to make 40.0 mL of solution.

Chemistry
Which of the following compounds is a strong electrolyte? a. C6H12O6 b. C7H14O5 c. C4H8O2 d. NaC2H3O2 e. All of these --- I think it is D but I'm not sure. Also, how do you know if it is a strong or weak acid?

Chemistry
Calculate the volume (L) of the solute C4H8O and the volume (mL) of the solvent C2H5OH that should be combined to prepare 5.54 kg of a solution that is 0.608 m. Molar Mass (g/mol) C4H8O 72.12 C2H5OH 46.07 Density (kg/L): C4H8O 0.8892 C2H5OH 0.7893 Name/Formula: tetrahydrofuran...

Chemistry
Indicate which is more soluble in ethanol? C2H5OH, acetic acid, CH3COOH, or stearic acid C17H35COOH.

Chemistry
How do you balance, step by step C2H5OH + K2Cr2O7 + H2SO4 = Cr2(SO4)3 + K2SO4 + CH3COOH + H2O?

chemistry
is it other than CH3COOH + C2H5OH => CH3COOC2H5 propanoic acid and isoamyl alcohol to make isoamyl propanoate?

chemistry
If 700 grams of glucose (C6H12O6) are fermented, what is the maximum volume in milliliters of ethanol (C2H5OH) that can form? (Density of ethanol is 0.79 g/mL)

Chemistry
step by step, show how to balance C2H5OH + K2Cr2O7 + H2SO4 = Cr2(SO4)3 + K2SO4 + CH3COOH + H2O

chemistry
help!!!! is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion ...

Science
13.)How can substance A and B be compared? Choose all that apply. A.)The particles of substance A have more energy than the particles of substance B.*** B.)The particles of substance A are more tightly held together than the particles of substance B. C.)The particles of ...

Chemistry
I have a lab for chemistry that I have to turn in soon, and I have no idea what the major and minor species if any of each of the substances we tested. Can someone please help me answer which one is the major/minor species of each of the elements? They are: 1. H2O(deionized)[...

Chemistry
I have a lab for chemistry that I have to turn in soon, and I have no idea what the major and minor species if any of each of the substances we tested. Can someone please help me answer which one is the major/minor species of each of the elements? They are: 1. H2O(deionized)[...

chemistry
Arrange the following aqueous solutions in order of decreasing freezing points (lowest to highest temperature): 0.10 m Na3PO4, 0.35 m NaCl, 0.20 m MgCl, 0.15 m C6H12O6 and 0.15 m CH3COOH.

chemistry
which isn't a pure substance? 1.Cl2(g) 2.Fe(s) 3.O2(aq) 4.C6H12O6(b) 5.H2O(l)

Chemistry
The following table contains data for the equilibrium reaction CH3COOH(g)+ C2H5OH(g)↔ CH3COOC2H5(g)+ H2O(g) T = 100oC. Each row in the table represents a different experiment (diffferent intial concentrations). Initial concentration Equilibrium concentration...

Chemistry
The unbalanced equation for the combustion of ethanol is as follows: C2H5OH(l) + O2(g) ¨ CO2(g) + H2O(g) How much heat, in kJ, is liberated when 4.84 kg of C2H5OH(l) is burned? Species Delta H‹f (kJ/mol) H2O(g) -241.8 CO2(g) -393.5 C2H5OH(l) -277.7 Express the answer ...

chemistry
The enthalpy of formation of C2H5OH is -238.7 kJ/mol. What information does this reveal about the bonds in the molecule? A. Bond formation in C2H5OH from its elements only occurs in cold temperatures. B. Bond formation in C2H5OH from its elements does not occur. C. Bond ...

Chemistry
Pure ethanoic acid (25.0cm3, CH3COOH), pure ethanol (35.0 cm3, C2H5OH) and pure water (20.0cm3, H2O) were mixed in a sealed flask at room temperature. The flask was placed in a heated water bath and maintained at 323K until equilibrium was established. CH3COOH(aq) + C2H5OH(aq...

chemistry
which pair(s) of liquids will be miscible ? H2O AND CH3CH2CH2CH2CH3(PENTANE) C6H6 (BENZENE) AND CCl4(CHLOROFORM) C2H5OH (ETHANOL) AND CH3COOH(ACETIC ACID) how do you know if they are miscible?

chemistry
Which solution would show the GREATEST change in pH on the addition of 10.0 mL of 1.0 M NaOH to 1.0 L of each of the following solutions? a. 0.50 M CH3COOH + 0.50 M NaCH3COO. b. 0.10 M CH3COOH + 0.10 M NaCH3COO. c. 0.50 M CH3COOH. d. 0.10 M CH3COOH. e. 0.50 M NaCH3COO. 4. (...

chem- plz check my work
2. Given the following equation, C2H5OH(l) + 3 O2(g)---> 2 CO2(g) + 3 H2O(l) How many liter of CO2 are expected in the combustion of 12.0 grams of ethanol? My work: 12.0g C2H5OH X 1 mol C2H5OH/46.08g C2H5OH X 2 mol CO2/1 molC2H5OH X 22.4L CO2/1 mol CO2 = 11.7 L CO2 all i ...

Chemistry
I just to know how to identify the substance that is reduced, the substance that is oxidized, the oxidizing agent and the reducing agent in each reaction. As (s) + ClO3-(aq) → H3AsO3 (aq) + HClO(aq) CN-(aq) + MnO4-(aq) → CNO-(aq) + MnO2(s) C2H5OH + MnO4- → ...

chemistry
last check: (c) A wine cooler contains 4.5% ethanol by mass. Assuming that only the alcohol burns in oxygen, how many grams of wine cooler need to be burned to produce 3.12 L of CO2 (d = 1.80 g/L at 25°C, 1 atm pressure) at the conditions given the density? 1 C2H5OH + 3 O2 = ...

chemistry DR BOB!
is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion reaction ...

chemistry DR BOB
is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion reaction ...

CHEMISTRY
The major component of vinegar is acetic acid CH3COOH. Which of the following reactions represents the balanced equation between acetic acid and sodium bicarbonate? a. CH3COOH(aq) + NaHCO3 a CH3COONa(aq) + CO2(g) + H2O(I) b. CH3COOH(aq) + 2 NaHCO3(aq) + 3/2 O2(g) a 4 CO2(g) + ...

Chemistry
In the "Methode Champenoise," grape juice is fermented in a wine bottle to produce sparkling wine. The reaction is given below. C6H12O6(aq) 2 C2H5OH(aq) + 2 CO2(g) Fermentation of 712 mL grape juice (density = 1.0 g/cm3) is allowed to take place in a bottle with a total volume...

CHemistry
My professor gave us these question in call and we solved for it in class, however im not sure how we got the answers. I dunt really understand the concept of intermolecular forces if some can please help me i have a quiz tomorrow. A. For each pair of substance, identify the ...

Chemistry
A solution is made by mixing 500 ml of 0.172 M NaOh with exactly 500 ml of 0.100 M CH3COOH. Calculate the equilibrium concentration of the species below. Ka of CH3COOH is 1.8 x10^-5 [H+]=? {OH-]=? [CH3COOH]=? [Na+]=? [CH3COO-]=?

Chemistry
In photosynthesis, glucose, C6H12O6, and O2 are produced from CO2 and H2O. Glucose from starches is the major fuel for the body. 6CO2(g)+6H2O(l)+680kcal⟶ C6H12O6(aq)+6O2(g) How much heat, in kilojoules, is needed to produce 22.5 g of C6H12O6?

chemistry
The equilibrium constant of the reaction CH3COOH (l)+C2H5OH (l)=CH3COOC2H5+H2O is 4.if one mole of each of acetic acid and ethyl alcohol are heated in presence of little concentrated H2SO4 at equilibrium the amount of ester present is?

chemistry
The equilibrium constant of the reaction CH3COOH (l)+C2H5OH (l)=CH3COOC2H5+H2O is 4.if one mole of each of acetic acid and ethyl alcohol are heated in presence of little concentrated H2SO4 at equilibrium the amount of ester present is?

chemistry
Which of the following is true of a substance with a pH of 11.0? A. The substance is an acid. B. The substance is a base. C. The substance is neutral. D. The substance is a transition metal. I think A

chemistry
how would you prepare 250 mL of a .1 M C12H22O11 starting with 2.5M C12H22O11

Inorganic Chemistry
Which aqeuous solution has a freezing point closest to that of 0.30M C12H22O11? A) 0.075M AlCl3 B) 0.15M CuCl2 C) 0.30M NaCl D) 0.60M C6H12O6 I know the answer but I don't know the reason or rationale behind it. Please explain. I suggest you review Raoult's Law at http://...

chemistry
Calculate the molar mass of a non-electrolyte that lowers the freezing point of 25.0 g of water to - 3.9 oC when 4.27 g of the substance is dissolved in the water.

CHemistry
True/ False: The pH of a soln that is 0.20 M CH3COOH and 0.20 M CH3COONa should be higher than the pH of a 0.20 M CH3COOH soln Would it be true since CH3COOH and CH3COONa are both weak acids, and if you mix them together, it becomes more diluted, and hence should have a higher...

Chem
Acetic acid (CH3COOH) reacts with isopentyl alcohol (C5H12O) to form isopentyl acetate (C7H14O2), a fragrant substance with the odor of bananas. CH3COOH + C5H12O -> C7H14O2 + H2O If the yield for the reaction is 45%, how many grams of the product are formed when 3.58 g of ...

science ap chemistry
What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

chemistry
Which of the following has the greatest buffer capacity? There are three separate problems below. 1. 0.40 M CH3COONa / 0.20 M CH3COOH 2. 0.40 M CH3COONa / 0.60 M CH3COOH 3. 0.30 M CH3COONa / 0.60 M CH3COOH Thanks!

science
compare table salt with glucose table salt is a strong electrolyte that will completely dissolve in a solution. whereas, glucose is a weak electrolyte and won't dissolve in a solution. ex. NaCl in water makes Na+ and Cl- ions glucose in water is basically just glucose...I ...

Chemistry
Neat pure ethanol C2H5OH has an enthalpy of vaporization of 39.3 Kj/mol, and a vapor pressure of 0.308 atm at 50 C. What is the boiling point, at atmospheric pressure of 1 atm, of a solution consisting of 35 G of phenol (a non-electrolyte hydrocarbon with a molecular formula ...

chemistry
What is the value of [OH-] in a 0.015 M CH3COOH solution? Ka = 1.8 x 10-5 I started by writing the equation: CH3COOH + H2O <---> H3O+ + CH3COO- Ka= [H3O+][CH3COO-]/[CH3COOH]= 1.8 E-5 ... Now what? I don't understand where OH relates to this ...

Chemistry
Table sugar consists primarily of sucrose, C12H22O11(s). The standard enthalpy of combustion for sucrose is the ΔHo for the reaction: C12H22O11(s) + 12 O2(g) → 12 CO2(g) + 11 H2O(l) Calculate this ΔHo. Give your answer in units of kJ to five significant figures. Use the ...

chemistry
What is the difference between a strong electrolyte and a weak electrolyte? Explain what makes an electrolytic solution strong or weak. Do you look at the pH to determine between a strong electrolyte and a weak one?

Chem
Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O <=> H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O <=> CH3COOH + OH- Now, using the above formulas, I have to show how a buffer works ...

chemistry
What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

chemistry
What does it mean to say that the ions of an electrolyte behave independently of one another when the electrolyte is dissolved in water? is it something about the compound splitting?

Chemistry
I cannot find information that gives me a clear answer whether NaBr is an electrolyte or non electrolyte. I have found some information that K2SO4 is an electrolyte, but now I am doubting that. All of my others I have been able to find solid information on, but these two have ...

chemistry
Substance A and substance B react to form substance C as described by the equation: A + B ↔ C If only substance A and substance B are placed in an enclosed vessel and allowed to react what would the reaction be?

Analytical Chemistry
Need help with question. Calculate the pH of a buffer prepared by adding 100mL of 0.0500M NaOH to 100mL of 0.175M CH3COOH. so far I have calculated mols of CH3COOH---->H+ + CH3OO- CH3COOH=0.1L*0.175mol/1L=0.0175mol OH-=0.1L*0.0500/1L=0.00500mol Not sure were to go from here...

chemistry
Acetic acid (CH3COOH) has a Ka of 1.8x10^-5. a buffer is to be prepared with a pH of 5.00 from solutions of CH3COOH and sodium acetate (NaCH3COO) of the same concentration. How many mLs of NaCH3COO would have been added to 100 mL of CH3COOH to make the proper buffer solution??

Chemistry
A crystalline white solid is a mixture of glucose (C6H12O6) and sucrose (C12H22O11). Is it possible that a 10.00 g sample of the solid dissolved in 100.0 g H2O might have a freezing point of -1.25 degrees C? Explain. Answer: No. The freezing point would be -1.03 degrees C

Chemistry
Suppose 1.0 mol of substance A reacts with 1.0 mol of substance B. to produce 2.0 mol of substance C. In a reaction, 2.4 mol of substance A is allowed to react with 2.1 mol of substance B. What amount in moles of substance c is produced?

PLS HELP ASAP 1 SUPER HARD & ANNOYING QUESTION
Use the diagram to answer question 13. so substance A looks like a row of three little circles on the top and bottom all organized (total six dots). substance b is all clumped together circles and is disorganized. 13. How can substance A and B be compared? Choose all that ...

General Chemistry
Im having trouble balancing this redox rection in acidic solution. I don't know how to balance reactions in which one reactant splits up into two products. C2H5OH(aq) + I3-(aq) --> I-(aq) + CO2(g) + CHO2-(aq) + H+(aq) I know I split it into C2H5OH --> CO2 + CHO2 + H+ and...

Chemistry
which of the following compounds dissolve in water?? -Sodium Nitrate (NaNO3) - Sucrose (C12H22O11) - Sodium Chloride (NaCl) - Potassium Sulfate (K2SO4) - Ethanol (C2H5OH) - Sodium Bicarbonate (Baking Soda)(NaHCO3) - Calcium Sulfate (CaSO4) i did an experiment, but I was not ...

Chemistry
Why will a reaction that forms a very weak electrolyte not form an equilibrium reaction? Your preface is questionable. Do you have an example of one? All the weak electrolytes I can think of form in solution an equilibrium reaction. No the question did not give an example with...

chemistry
An unknown substance has a mass of 17.3 . When the substance absorbs 1.557×102 of heat, the temperature of the substance is raised from 25.0 to 45.0 . What is the most likely identity of the substance?

chemistry
C2H5OH + 3O2 --> 2CO2 + 3H2O How many grams of O2 are consumed when 5.86 ml of Ethanol burns completely (the density of C2H5OH is 0.789 g/ml)?

chemistry
How do you balance this equation? C6H12O6 + O2 --> H2O + CO2 Thanks! C6H12O6+6O2=6H2O+6CO2 (that should be right!) C6H12O6 + 6O2 --> 6H2O + 6CO2 Thank you! Thank you too!

Chemistry
Would it be correct to say that it is harder for a weak electrolyte to dissociate in a solution than it is for a stronger electrolyte to dissociate? If a weak electrolyte can't dissociate completely it wouldn't be able to form an equilibrium reaction right? yes Second question...

Chemistry
The esterification of acetic acid and ethanol is given by the reaction below: C2H5OH(aq) + CH3COOH(aq)===>CH3COOC2H5(aq) + H2O(l) When 1.00 mol of ethanol was mixed with 2.00 mol of acid in a 1.00 L flask, 0.86 mol of ester was formed at room temperature. What is the value ...

Chemistry
In the "Methode Champenoise," grape juice is fermented in a wine bottle to produce sparkling wine. The reaction is given below. C6H12O6(aq)--> 2 C2H5OH(aq) + 2 CO2(g) Fermentation of 746 mL grape juice (density = 1.0 g/cm3) is allowed to take place in a bottle with a total ...

Chemistry
In the "Methode Champenoise," grape juice is fermented in a wine bottle to produce sparkling wine. The reaction is given below. C6H12O6(aq)--> 2 C2H5OH(aq) + 2 CO2(g) Fermentation of 746 mL grape juice (density = 1.0 g/cm3) is allowed to take place in a bottle with a total ...

chemistry
In the "Methode Champenoise," grape juice is fermented in a wine bottle to produce sparkling wine. The reaction is given below. C6H12O6(aq)--> 2 C2H5OH(aq) + 2 CO2(g) Fermentation of 746 mL grape juice (density = 1.0 g/cm3) is allowed to take place in a bottle with a total ...

chemistry
) Calculate the amount of unreacted aqueous ethanoic acid (CH3COOH(aq)) in the sample taken for titration with aqueous potassium hydroxide(KOH(aq)). Clearly show the steps in your calculation. (1 mark) (v) Hence calculate the amount of aqueous ethanoic acid CH3COOH(aq)) in the...

Chemistry
What mass of the ionic substance KBr would result in the same osmotic pressure as 34.2 g of nonionic sucrose (C12H22O11)? A little step by step walk through would help me. Thanks

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. Next>>

Post a New Question