Post a New Question

Math - Trigonometry

134,771 results

plane and spherical trigonometry
trigonometry in oblique triangles

High School Courses
How often do state colleges which are moderately competitive require trigonometry? Is trigonometry something like algebra that they expect you to have, or do they usually not care as long as you have the right number of math courses? Would it look better for me to take ...

Math (trigonometry)
Trigonometry identities are so hard... I need some help proving these identities: *Oh, and I'm only in grade 11, so the identities we use are quotient identity and Pythagorean identity. sinx/(sinx + cosx) = tanx/(1 + tanx) cos^2x - sin^2x = 2cos^2x - 1 Thanks! Lucy

MATHS 2
If x+y=45°, prove that {(cotx+1)(coty+1)}/{cotx×coty}=2 Please help me in this TRIGONOMETRY problem. From the topic - TRIGONOMETRY Ratios of compound angles

Grammar
Replace with or replace for? Sentence: I want to replace algebra (with/for) trigonometry. If I use the word with, then does that's an I want trigonometry and not algebra? If I use the word for, then does that mean I want algebra and not trigonometry? Any rules?

spanish
is this translated right? In the morning I wake up at 8:30 a.m. The first thing I do is brush my teeth and comb my hair. Then I eat breakfast. By 9:00 a.m., I start my schooling (home). The first thing I work on is trigonometry. Then I do English, Trigonometry, American ...

trigonometry
determine the trend of each linear function: 1. f(x)= 3x+5 I don't know what you call the "trend" or why you call this a trigonometry question. It is about algebra. The value of the function increases with x at a rate of three times the change in x.

Trigonometry
a 20ft. ladder is leaning against a wall so that the foot of the ladder is 9ft. from the buss of the wall what angle does the ladder make with the ground? what is the distance from the top of the ladder to the base of the house? based in trigonometry

trigonometry
okay so i have this trigonometry problem were i HAVE to use logarithms. Now this is my work but can u help me solve it using logarithms. Find the area of the following triangles:(use logarithms) 1) c=426, A=45degrees 48' 36",and B=61degrees 2' 13"

Trigonometry
PLEASE HELP!! I really don't understand this...I just started learning about trigonometry and SOH CAH TOA and I think this probably has to do with that but I don't know how to apply it... Please explain this to me!!!! I need to know how to do it and not just the answer. ...

math
what does trigonometry mean?

math
what does trigonometry mean?

Trigonometry
The light on the Prince Shoal lighthouse is 25m above water level. From a position behind the light, the angle of the depression of the sailboat is 12 degrees. How far is the sailboat from the lighthouse, to the nearest metre? (I have no idea how the diagram would look - it ...

Math/Trigonometry
Is there a formula for sin(x/3)?

Trigonometry
Solve for x to the nearest hundreth and can you explain how you get your answer I don't understand 3^x = 1.295 Your question has nothing to do with trigonometry. You can solve for x by taking the logarithm (to any base) of both sides of the equation. Then x log 3 = log 1.295 x...

Math - Trigonometry
Math - Find the amplitude, period, phase shift - y=cosPi/2 (x+1/3)

Math - Trigonometry
What is the answer to (sin45) / (cos45)?

math
need help with 20 question for algebra and trigonometry

math
How do I find the degree for a right triangle trigonometry??

math/trigonometry
solve this equation by completing the square. x^2+4x-21=0

Math trigonometry
Prove sinA/1+cosA =tan1/2A

trigonometry
y=−34 sin(10θ+10π)−14 I need to graph this trigonometry problem. I need the parent graph, period, vertical shift, phase shift, a separate graph showing the new mid line with the amplitude and a final product graph. thanks for any help :)

Trigonometry
A balloon is flying west of two trigonometry students who are 7 miles apart. The angles of elevation of the two students to the balloon are 15 and 28 degrees. Approximate how high the balloon is flying.

Math (Trigonometry)
square root(a^2 -u^2) where a>0, let u=(a sinx) where -pi/2<x<pi/2 answer is (a cosx) and I don't know how to get there

Math/Trigonometry
Convert 2pi/3 radians into degrees.

Math-Trigonometry
In Quadrant II, is the value of cosecant positive or negative?

math,trigonometry
how do i state the law of sines and cosin in words ??

Math
I'm trying to decide what math course to take next year. How do Statistics and Trigonometry compare in difficulty? Which is more helpful for the SAT's? THank you for your explanations.

trigonometry
how do u draw a triangle on here cuz i need help on my math hw and i dunno how

Math - Trigonometry
Find the amplitude, period, and phase shift - y=cosð/2 (x+1/3)

Math (trigonometry)
Find the value of each of the remaining trig functions. Cscè=-4, ð<è<3ð/2

Math/Trigonometry
What is the angular displacement of 1.6 revolutions? Round to the nearest tenth.

math
Trigonometry - determine the area of a parallelogram in which 2 sides are 10 and 13 and the angle between them is 55

Math - Trigonometry
I need help proving this identity 2sin^2x - 1 = sin^2x - cos^2x

math trigonometry
Simplify cos180*sin225*cos80/sin170*tan135

Math (Trigonometry)
Find csc B when a - 2 and b = 7 (A detailed answer would be really helpful)

Math - Trigonometry
Sketch the curve represented by the parametric equations x=3cos¦È and y=3sin¦È for 0 ¡Ü ¦È ¡Ü ¦Ð?

math trigonometry
Prove the identity Sin^3X sinx*cos^2X=tanx/cosX

math trigonometry
Prove the identity Sin^3X+sinx*cos^2X=tanx/cosX

Math Trigonometry
determine the amplitude and period of each function. 1) y = 3sin (2x-pi/2) 2) y = -3sin2 (x-pi/4) 3) y = 2cos (2x+pi) 4) y = -2cos2 (x+pi/2)

Math Trigonometry
A man is 6 ft. tall casts a shadow of 8 ft. find the angle of elevation of the sun.

math / geometry
connections academy, trigonometry practice unit for lesson three answers

Trigonometry
I really need help with this trigonometry question.please any help is appreciated. 1.I have to draw the graph of y=cos x from 0deg to 360deg. 2.Be sure to show a table of vales similar to the this table. colum X l colum :y=sinx 0 l 0.00 pi/10 l 0.31 pi/5 l 0.59 3pi/10 l 0.81 ...

math/trigonometry
solve secx/2=cosx/2 over the interval[0,2pi) without using a calculator

math(advanced algebra&trigonometry)
find, to the nearest minute, the angle whose measure is 3.45 radians.

Math trigonometry
Find the measures of the acute angles of a right triangle whose legs are 9 cm and 16 cm long.

Maths trigonometry
using basic trigonometry derive the following equations, which are used to convert cartesian to polar coordinates and vice versa. why is the cos(phi)in the x term? x = R cos (phi) sin (lamda) y = R sin (phi) they are used in orthogonal projection of a spherical surface to a ...

trigonometry-math
what is the solution set (in terms of pi) of the equation sin2t-cos^2t=1=sin^2t+sint in the interval 0<t<2pi

Math Trigonometry
What is the maximum integer value of n, where n<148, that satisfies the following inequalities: sin(pi/2+(pi*n)/74)<0 and tan(pi−(pi*n)/74)<0?

Math: Trigonometry
Find the sum of the three smallest positive values of x such that 4cos^2(2x-pi) = 3. (Answer in radians.)

Math Trigonometry
Let f(x)=cos(pi*x/3) g(x)=1^x+(−1)^x h(x)=f(x)⋅g(x) where x is a positive integer. Given that h(x) has a range of exactly 3 different values: a, b and c, what is the value of a^2+b^2+c^2?

trig, precalc, math, algebra, trigonometry
Rewrite: tan(cos^−1 (v)) as an algebraic expression in v. Please help me understand.

Course Planning
I'm trying to decide what math course to take next year. How do Statistics and Trigonometry compare in difficulty? Which is more helpful for the SAT's? THank you for your explanations.

Trigonometry (Math)
Can someone help me simplify this equation? It needs to be ten characters or less, including signs, parenthesis, etc. If you could show me how you get there that would be great! Thanks!

Math
How to write a math story that includes 4 examples... Possible math topics include: introduction to functions investigating quadratics quadratics highs & lows exponential functions fiancial applications of exponential function acute triangle trigonometry I'm taken MCF3M math ...

Math
What is the area of a rhombus with: Side=8 cm Acute angle between one pair of sides=30 degrees Please don't use trigonometry as I'm in Class 7. Thanks in advance.

math (trigonometry)
help me solve this coz im stumped secx-secx sin^2x= cosx thanks

Trigonometry
Let's solve this fun trigonometric fun math problem! 1.) SEC²X-1/SIN²X

Math (Trigonometry)
What is the maximum value of [9sinθ+2sin(θ+π/3)]^2?

math
How can trigonometry enhance futuristic money question to linytron.go get answer linytron.

Math - Trigonometry
I need help proving this identity 1/cosx - cosx = sinxtanx

trigonometry. Math
In a triangle PQR, angle Q=50 degrees,PR=5CM, QR=4CM. find angle P?

trigonometry math help
If cos 20=m determine the values of the following in terms of m. (a)sin 250 (b)sin 20 thanks

Math
Trigonometry Identities problem: Prove the following; (tan^2x)(cos^2x) = (sec^2x - 1)(1-sin^4x) ÷ (1+sin^2x)

math trigonometry
Prove that 2sin150*cos315*cos(90-x)/sin(360-x)cos(-240)sin135

math(advanced algebra&trigonometry)
the expression cos4x cos3x + sin4x sin3x is equivalent to which one of the following is the answer: 1) sinx 2) sin7x 3) cosx 4) cos7x

Math
I'm in gr 11 doing Trigonometry 14.2 = b ---- ---- sin38 sin 67 a = 46 --- ---- sin20 sin130 (10.7)^2 = (9.5)^2 + (12.4)^2 - 2(9.5)(12.4) cos <B I just need someone to explain this to me because I just don't get it... thank you for any help

Math
Trigonometry problem: The sides AB and AC of triangle ABC are of lengths 4 and 7 respectively. M is the midpoint of BC. AM is of length 3.5, Find the length of BC.

math- Trigonometry
If cos degree equals to 0.8641 What is Sin degree? I have no idea how to find this. Please help me. Thank you

Math (Trigonometry)
In triangle ABC, we have AB = 16, BC = 29 and CA = √1097. What is the integer that is closest to 100 sin∠ABC?

Math(Trigonometry)
kos^2 theta - sin^2 theta = 0.25

math(Trigonometry)
2cos^2 theta + 5 sin theta - 4 = 0

math(advanced algebra&trigonometry)
If a is an angle in standard position and its terminal side passes through the point (-3,2), find the exact value of csc a. Answer: radical 13/2

math-trigonometry
I'm working woith multiple ange and product sum formulas and I'm stuck on these. Can you help? Thanks sin2xsinx=cosx cos2x-cosx=0

math and language arts
What is a sentence using the words abacus and trigonometry and hypotenuse i could use as a example? It much use definions.

Math 132 Trigonometry (College)
when the angle of elevation of the sun is 58 degrees. the shadow cast by a tree is 28 ft. long. how tall is the tree?

Math
Hello! I need assistance in solving for a side for a right triangle in trigonometry. Can anyone give me the easiest way/formula how to go about solving it? Thank you!

MATH trigonometry
in an isosceles triangle the vertex angle measures 90 degrees and the length of each congruent leg is 5√2. whats the length of the base?

Math- Trigonometry
The point, in on the terminal side of an angle in standard position find the exact value of the six trigonometric functions of the angle a. (8,15) b.(-9,-40)

math-geometry-soh-cah-toa???
Thank you for using the Jiskha Homework Help Forum. Hopefully the following sites will help you: 1l http://www.mathwords.com/s/sohcahtoa.htm 2. http://en.wikipedia.org/wiki/Trigonometry I get how to use soh-cah-toa and everything but could someone help me with how to plug it ...

Math-Trigonometry
Use the half-angle formulas to find the exact values. Cosine 165 degrees, Sine 157 degrees 30' and tan pi/8

Math (trigonometry)
How do you solve this trig identity problem without factoring? I just used @ to represent theta: sin^4@ + 2sin^2@cos^2@ + cos^4@ = 1

Math - Trigonometry
A, B and C are three towns, the bearing of B and C from A being 295° and 205°, and their distances from A are 280km and 800km respectively. Find the bearing of C from B to the nearest minute.

Math, trigonometry
how to evaluate sin (40)[1+sin(10)]

math trigonometry
if 5sin theta + 12cos theta is equal to 13 find the value of tan theta

math
respected sir i want to know the table describing the values of angles of trigonometry functions. eg. sin,cos & tan 15,30,45,60,75,90 separately in table format. thanking you! padam singh.

trigonometry math
An aviator heads his airplane due west. He finds that because of a wind from the south, the course makes an angle of 20" with the heading. If his airspeed is 100 mi/h, what is his groundspeed and what is the speed of the wind?

math,trigonometry
solve each triangle described below using Δ ABC : 1)a = 10, A = 16°, B = 49° 2)a = 8, b = 7, A = 88° I don't know how to do this i forgot ... could u help (Steve, or Mrs.Sue, or Writeteacher plz help) this topic is Oblique triangle

trigonometry
sinxcosx=0,x=?

Trigonometry
What is the arcsin of (pi/2)?

trigonometry
what is sin 35=x/6

Trigonometry
sin x= -1

Trigonometry
Find m < D if d=10, e=8 and m< E= 43

Trigonometry
expand ( 5d-1) 4

Trigonometry
v=2(ab+bc+ca), solve for a

Trigonometry
Simplify i^45. A. 1 B. i C. –1 D. –i

Trigonometry
If g(t) = 5t+1 and h(n) = 2(n - 7), what is the value of h(g(3))?

Trigonometry
n-1/n divided by 1+1/n

Trigonometry
if cot 2x = 5/12 with 0<=2x<=pi

Math/Trigonometry
Find the exact value of cosθ if sinθ=-2/3, and θis in standard position with its terminal side in Quadrant IV.

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. Next>>

Post a New Question