Post a New Question

After balancing of the equation for the reaction, MnO4-(aq) + H2C2O4(aq) + H+(aq) Mn2+(aq) + CO2(g) + H2O(l) what is the sum of ALL the coefficients in the equation?

106,404 results

The reaction of MnO4- with oxalic acid (H2C2O4) in aciic solutiob, yielding Mn2+ and CO2 gas, is widely used to determine the concentration of permanganate solutions. (a) write a balanced equation for the reaction would it be MnO4- + H2C2O4 --> Mn2C2O4 + H2O + O3-?????

balanced equation
? MnO4– + ?H+ + ?C2O42– --> ?Mn2+ + ?H2O + ?CO2 what's the balanced equation? correct coefficients? is it 1MnO4- + 2H+ + 1C2O42- --> 1Mn2+ + 1H20 + 2CO2 ? c2042..? are you missing parenthesis somewhere? oh i see, no i believe this is correct: MnO4- + 8h+ + C2042- -&...

I need chemistry help. I think 1. c, 2.b, & 3.a (please tell me why or why not and help me set up the problems if possible) 1.) The following half reaction has been balanced except for the electrons. How many and where should the electrons be included? 14 H+(aq) + Cr2O72-(aq...

chemistry- electrochem
Complete and balance the following redox equation. The sum of the coefficients when they are all whole numbers is MnO4- + H+ + Br-® Mn2+ + Br2 + H2O (acidic solution) 6 17 21 29 43

Hey i have a question regarding disproportionate reactions: Permanganate ions MnO4 reacts with oxalic acid, H2C2O4 in acidic aqueous solution, producing manganese(II) ions and carbon dioxide. The skeletal equation is MnO4^-(aq)+ H2C2O4(aq)--> Mn^2+(aq)+ Co2 (g) balance this...

In many residential water systems, the aqueous Fe3+ concentration is high enough to stain sinks and turn drinking water light brown. The iron content is analyzed by first reducing the Fe3+ to Fe2+ and then titrating with MnO4- in acidic solution. Fe2+(aq) + MnO4-(aq) ? Mn2+(aq...

For the following electrochemical cell: Fe(s)/Fe2+(aq)//MnO4–(aq), Mn2+(aq)/ Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. 2Mn2+(aq) + 8H2O(l) + 5Fe2+ ==> (aq)5Fe(s) + 16H+(aq) + 2MnO4–(aq) B. 5Fe(s) + 16H+(aq) + ...

For the following electrochemical cell: Fe(s) | Fe2+(aq) || MnO4–(aq), Mn2+(aq) | Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. 2Mn2+(aq) + 8H2O(l) + 5Fe2+(aq)-> 5Fe(s) + 16H+(aq) + 2MnO4–(aq) B. Fe(s)+8H+(aq)+MnO4...

For the following electrochemical cell: Fe(s) Fe2+(aq) MnO4–(aq) Mn2+(aq) Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. Fe(s) + 8H+(aq) + MnO4–(aq)Mn2+(aq) + 4H2O(l) + Fe2+(aq) B. 5Fe(s) + 16H+(aq) + 2MnO4–(aq)2Mn2+(aq...

For the following electrochemical cell: Fe(s) Fe2+(aq) MnO4–(aq) Mn2+(aq) Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. Fe(s) + 8H+(aq) + MnO4–(aq)Mn2+(aq) + 4H2O(l) + Fe2+(aq) B. 5Fe(s) + 16H+(aq) + 2MnO4–(aq)2Mn2+(aq...

chemistry Dr BOB
In many residential water systems, the aqueous Fe3+ concentration is high enough to stain sinks and turn drinking water light brown. The iron content is analyzed by first reducing the Fe3+ to Fe2+ and then titrating with MnO4- in acidic solution. Fe2+(aq) + MnO4-(aq) ? Mn2+(aq...

For the following electrochemical cell: Fe(s) / Fe2+(aq) // MnO4–(aq) Mn2+(aq) / Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. 5Fe(s) + 16H+(aq) + 2MnO4–(aq)--> 2Mn2+(aq) + 8H2O(l) + 5Fe2+(aq) B. Fe(s)+8H+(aq)+MnO4...

Because of the changing color of the solution as the following reaction proceeds, the rate law can be determined by measuring the rate of disappearance of the permanganate ion (MnO4-). 2MnO4-(aq)+ 5H2C2O4(aq) + 6H+(aq) -> 2Mn2+(aq) + 10CO2(g) + 8H2O(l) The following initial...

Can someone help me balance this equation? MnO4(¨C) + H(+) + C2O4(2¨C)--> Mn(2+) + H2O + CO2 Sure but tell us what you don't understand about it. You need to learn how to do them yourself. Tell me what you don't understand, in detail, and I can help you through it. Well I...

For the following electrochemical cell: Fe(s) / Fe2+(aq) // MnO4–(aq) Mn2+(aq) / Pt(s) Which letter corresponds to the correct balanced chemical equation in an acidic solution? A. 5Fe(s) + 16H+(aq) + 2MnO4–(aq)--> 2Mn2+(aq) + 8H2O(l) + 5Fe2+(aq) B. Fe(s)+8H+(aq)+MnO4...

What is the reduction half-reaction for the reaction between iron(II) sulfate and potassium permanganate in a sulfuric acid solution? 5Fe2+(aq) + MnO4–(aq) + 8H+(aq) --> 5Fe3+(aq) + Mn2+(aq) + 4H2O(l) a. MnO4– + 3e– --> Mn2+(aq) + 4H2O b. MnO4–(aq) + 8H+(aq) + 5e...

What is the reduction half-reaction for the reaction between iron(II) sulfate and potassium permanganate in a sulfuric acid solution? 5Fe2+(aq) + MnO4–(aq) + 8H+(aq) --> 5Fe3+(aq) + Mn2+(aq) + 4H2O(l) a. MnO4– + 3e– -->Mn2+(aq) + 4H2O b. MnO4–(aq) + 8H+(aq) + 5e...

1)The reaction of methane and oxygen yields carbon dioxide gas and water. The unbalanced reaction is as follows: CH4(g) + O2(g)CO2(g) + H2O(g) A. If 0.718 grams of methane are reacted, how many grams of water vapor are produced? B. If 1.621 grams CO2 are released, how many ...

Suppose 70.00 mL of a lithium hydroxide, LiOH, solution requires 55.42 mL of a 0.1050 M solution of propanoic acid, C2H5COOH, for neutralization. LiOH + C2H5COOH ® C2H5COOLi + H2O What is the concentration of the base solution? 0.08313 M 0.1663 M 0.3325 M 0.6650 M Question 2 ...

I was given a problem that my book did not explain how to do, so I attempted to figure it out myself. Let me know if my conclusion is fallacious. Given the reactions H2O(g) + CO(g) <--> H2(g) + CO2(g), K= 1.6 FeO(s) + CO(g) <--> Fe(s) + CO2(g), K= .67 Find K for ...

Chemistry Dr. BOB
In many residential water systems, the aqueous Fe3+ concentration is high enough to stain sinks and turn drinking water light brown. The iron content is analyzed by first reducing the Fe3+ to Fe2+ and then titrating with MnO4- in acidic solution. Fe2+(aq) + MnO4-(aq) ? Mn2+(aq...

Can someone please help me with balancing ASAP
Balance the following equation. (for a balanced eq. aA + bB → cC + dD, enter your answer as the integer abcd) MnO4−(aq) + SO32−(aq) + H+(aq) → Mn2+(aq) + SO42−(aq) + H2O(l)

Reaction Descriptions
Complete the table below: Enter all letters containing appropriate descriptions for each of the equations below. a. precipitation reaction b. neutralization reaction c. oxidation reduction reaction d. molecular equation e. complete (total) ionic equation f. net ionic equation...

chemistry to Dr. Bob
Balance the equation: Note: If a chemical species coefficient is "1" then "1" needs to be entered in the field before that species. MnO4– + H+ + C2O42– Mn2+ + H2O + CO2 I'm not exactly sure how to do this question..Help?

When the equation for the following reaction in basic solution is balance, what is the sum of the coefficients? MnO2 + HO2^1-.....>MnO4^1- A=11 B=31 C=14 D=9

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

Dr.Bobb222 please help balance the following oxidation-reduction reactions, which occur in acidic solution, using the half-reaction method. (Use the lowest possible coefficients. Include states-of-matter under the given conditions in your answer.) (a) NO3−(aq) + Pb(s) &#...

Chemistry Problem
A student proposes to use visible spectroscopy to measure the kinetics of the permanganate/oxalic acid reaction. The initial permanganate solution was very dark. For a 1 cm sample cell, the absorbance A = 2,500[MnO4]. As a practical rule of thumb, Beer's law is only accurate ...

Balance the equation: MnO4¡V + H+ + Fe2+ Mn2+ + H2O + Fe3

During combustion, methine yeilds carbon dioxide and water. the unbalanced equation for this reaction is : CH4(g)+O2(g)>CO2(g)+H2O(i) what will the mole ratios for the balanced equation be?(what coefficients are needed in order to balanced the equation?)

NaCl [Symbol] Na + Cl2 Type of reaction: synthesis KOH + HNO3 [Symbol] HOH + KNO3 Type of reaction: double replacement Ca + S [Symbol] CaS Type of reaction: synthesis BaBr2 + Cl2 [Symbol] BaCl2 + Br2 Type of reaction: Cs2 + H2O [Symbol] CsOH + H2 Type of reaction: Na2CO [...

I need to know how to right a net ionic equation for the following chemical reaction: 5 H2C2O4 + 3 H2SO4 + 2 KMnO4 = K2SO4 + 2 MnSO4 + 8 H2O + 10 CO2

What is the chemical equation for the combustion reaction between methanol and air? CH4 + O2 ==> CO2 + H2O. All hydrocarbons produce CO2 and H2O when they are combusted in air. The above equation isn't balanced. I assume you can do that? If not, ask OR take a shot at it and...

AP Chem (Thank you for help)
Hey guys! Stuck on some Redox Reactions. I tried my best to put as much work as I could, but I'm super stuck on these ones. Thanks for any help: 1) Balance the equation as written, what is the coefficient for O2? NH4+ + O2-->NO2− + H2O (in basic solution) Maybe answer...

AP Chemistry
For the reaction ?CH4+ ?O2 ==> ?CO2+ ?H2O, what is the maximum amount of CO2 (44.0095 g/mol) which could be formed from 3.67 g of CH4 (16.0425 g/mol) and 4.23 g of O2 (31.9988 g/mol)? Answer in units of g I know that you have to balance the equation, so the coefficients 1, ...

Given the following standard reduction potentials in acid solution: MnO4- + 8 H+ + 5 e-® Mn+2 + 4 H2O E°cell = 1.51 V Co+2 + 2 e-® Co E°cell = -0.28 V Cr+3 + 3 e-® Cr E°cell = -0.74 V The strongest oxidizing agent listed above is: Cr3+. Cr. Mn2+. Co2+. MnO4–

3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant? C) How many grams of C2, H2, O2, CO2, and H2O...

Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to ...

college chemistry
Balance the equation in aqueous acidic solution: C2O42-(aq) + MnO4-(aq) → Mn2+(aq) + CO2(g) please teach me how to do it!

MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...

MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...

Solve with half equation reaction SO3 2- + MnO4 -=SO4 2- + Mn2+

chemistry check
1. 48 KNO3+ _ C 12 H22O11-„³ ? CO2+ _ N2+ _ K2CO3+ _ H2O a. 12 b. 24 s c. 36 d. 48 The reaction is 48 KNO3 + 5 C12H22O11 --> 24 K2CO3 + 36 CO2 + 55 H2O + 24 N2 So the answer is C =36 2. 6 KNO3+ _ S + ? H2O„³ _ H2SO4+ _ N2+ _ K2SO4 a. 2 b. 4 c. 6 d. 8 The balanced ...

When the equation below is balanced and all coefficients are in the lowest, whole number ratio, the coefficients are: C2H6 + O2 ¨ CO2 + H2O I am currently doing an online worksheet to improve in chemistry and I am not quite understanding how to find the coefficients and how...

what is the coefficients on Oxygen in the balanced equation for the following hydrocarbon combusion reaction C7H14 + O2 = CO2 + H2O

Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality.

1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality

ap chemistry
Write the half reactions and the balanced equation for the galvanic cell Hg(ℓ)|Hg2+2(aq)||MnO4(aq),Mn2+(aq),H+(aq)|Pt(s). What is the smallest possible integer coefficient of H2O(ℓ) in the combined balanced equation?

Half reaction method of balancing redox reaction CHCl3 + MnO4- = Cl2 + CO2 + Mn+2

Chemistry - DrBob222 please check and help
Can you check these? And I need help on one. Oxidation Number Method of Balancing Redox Reactions 1)Neutral Solution Sn^2+ + Fe^3+ ----> Fe^2+ + Sn^4+ Balanced equation Sn^2+ + 2Fe^3+ ----> 2Fe^2+ + Sn^4+ 2)Acidic Solution Fe^2+ + Cr2O7^2- ---> Cr^3+ + Fe^3+ Balanced ...

Chemistry - DrBob222 please check and help
Can you check these? And I need help on one. Oxidation Number Method of Balancing Redox Reactions 1)Neutral Solution Sn^2+ + Fe^3+ ----> Fe^2+ + Sn^4+ Balanced equation Sn^2+ + 2Fe^3+ ----> 2Fe^2+ + Sn^4+ 2)Acidic Solution Fe^2+ + Cr2O7^2- ---> Cr^3+ + Fe^3+ Balanced ...

Based on the following balanced equation: 2 C4H10 + 13 O2 --> 8 CO2 + 10 H2O a. How many moles of CO2 are produced after complete reaction of 8.00 moles of C4H10? b. How many grams of CO2 are produced after complete reaction of 8.00 moles of C4H10? c. How many moles of H2O ...

1. Tube # 3: (a) It started out as purple, and turned into green. (b) No precipitate was noticably formed. Tube #4: (a) This tube was purple, and turned into white. (b) A brown precipitate was formed after adding 1 mL of NaHSO3. Tube #5: (a) This tube was also purple, but then...

Chemistry Lab
Provide the correct coefficients to balance the following equation: ___ Fe(NH4)2(SO4)2·6H2O + ___ H2C2O4 + ___ K2C2O4 + ___ H2O2 -----> ___ K2Fe(C2O4)3·3H2O + ___ (NH4)2SO4 + ___ H2SO4 + ___ H2O I'm usually okay when it comes to balancing equations but this one has me ...

The reaction: H2C2O4 + CuO + Heat = ? This reaction was produced in organic elemental analysis to identify C and H. So I think CO2 is formed to react with Ca(OH)2 to giving CaCO3. Additionally was formed H2O, so I though H2 or H2O was produced. Is correct : = C2CuO4 + CO2 + H2 ?

Why doesn't potassium ion K+ from KMnO4 appear in the following two unbalanced equations: MnO4– + C2O42– Mn2+ + CO2 MnO4– + Fe2+ Mn2+ + Fe3+ ? A. KMnO4 is not added to either reaction. B. The presence of K+ would result in a net positive charge in the products. C. K+ is ...

Why doesn't potassium ion K+ from KMnO4 appear in the following two unbalanced equations: MnO4– + C2O42– Mn2+ + CO2 MnO4– + Fe2+ Mn2+ + Fe3+ ? A. The presence of K+ would result in a net positive charge in the products. B. The equations cannot be balanced if the ...

Why doesn't potassium ion K+ from KMnO4 appear in the following two unbalanced equations: MnO4– + C2O42– Mn2+ + CO2 MnO4– + Fe2+ Mn2+ + Fe3+ ? A. KMnO4 is not added to either reaction. B. K+ is a spectator ion and redox reactions are written as net ionic reactions. C. ...

chemistry(check my asnwer)
Why doesn't potassium ion K+ from KMnO4 appear in the following two unbalanced equations: MnO4– + C2O42– Mn2+ + CO2 MnO4– + Fe2+ Mn2+ + Fe3+ ? A. KMnO4 is not added to either reaction. B. The presence of K+ would result in a net positive charge in the products. C. The ...

how do I balance the following skeleton redox equation for a reaction occurring in acidic solution. HNO2 + MnO4- yield to Mn2+ + NO3-

Choose the equations which correctly describe the dissolution of a compound into water. a) CaBr2(s)-> Ca2+(aq) + Br2(l) b) sodium bicarbonate(s)-> Na+(aq) + HCO3–(aq) c) CH3OH(l)-> C4+(aq) + O2–(aq) + 4 H+(aq) d) Ba(NO3)2(s)-> Ba2+(aq) + 2 NO3–(aq) e) H2SO4(g...

Why doesn't potassium ion K+ from KMnO4 appear in the following two unbalanced equations: MnO4– + C2O42– Mn2+ + CO2 MnO4– + Fe2+ Mn2+ + Fe3+ ? The potassium ion is a spectator ion. You have written ionic equations (but omitted the arrows to separate the reactants from ...

Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...

Chem balancing equation
C5H602+O2 ---> CO2+H2O what is the coefficient of O2?

The redox reaction below occurs in acidic solution. Balance it with the smallest whole number coefficients and determine the coefficient for H+. MnO4-(aq) + HNO2(aq) ---> Mn2+(aq) + NO3-(aq)

what is the oxidation half reaction, reduction half reaction, and the complete balanced reaction of the following? (a) Al(s) + MnO4‾(aq) → MnO2(s) + Al(OH)4‾(aq) (b) Cl2(g) → Cl ‾(aq) + ClO ‾(aq) (c) NO2‾(aq) + Al(s) → NH3(g) + ...

Gen Chem
What is n, the number of moles of electrons transferred, in the following reaction? 2 MnO4-(aq) + 16 H+(aq) + 10 Cl-(aq) ===> 2 Mn2+(aq) + 5 Cl2(g) + 8 H2O(l).

How do I balance this redox reaction? MnO4- + Fe2+ + H+ + Mn2+ + Fe3+ + H2O I don't understand. Don't I need a product?

Balance the equation: Note: If a chemical species coefficient is "1" then "1" needs to be entered in the field before that species. MnO4– + H+ + Fe2+ Mn2+ + H2O + Fe3+

Physical Science
In a certain reaction 1.5 mol of CO and 1.5 mol of H2O are placed in a 2,0 dm3 sealed vessel. Equilibrium is established at a temperature of 1 000 C. The equilibrium reaction equation is CO(g) + H2O(g) = CO2(g) + H2(g) The value of Kc for this reaction is 0,63. Calculate the ...

Balancing Equation Al2C3O3 + H3PO4 --> AlPO4 + CO2 + H2O

In acidic solution MnO4- oxidizes H3AsO3, a weak acid, to H3AsO4, a weak acid, and is reduced to Mn2+. Write the balanced net ionic equation for this reaction. How many H+ are there in the balanced equation

Balance the following equation. (for a balanced eq. aA + bB → cC + dD, enter your answer as the integer abcd) MnO4−(aq) + SO32−(aq) + H+(aq) → Mn2+(aq) + SO42−(aq) + H2O(l) i got 2525 and its going in as incorrect Now you get to balance this ...

Balance the following oxidation-reduction reaction in acid solution: SO32- + MnO4- --> SO42- + Mn2+ + H2O

Balance the following equation. (for a balanced eq. aA + bB → cC + dD, enter your answer as the integer abcd) MnO4−(aq) + SO32−(aq) + H+(aq) → Mn2+(aq) + SO42−(aq) + H2O(l) i got 2525 and its going in as incorrect Now you get to balance this ...

In acidic solution MnO4- oxidizes H3AsO3, a weak acid, to H3AsO4, a weak acid, and is reduced to Mn2+. Write the balanced net ionic equation for this reaction. How many H+ are there in the balanced equation? Question 8 answers

permanganate ion oxidizes hydrogen peroxide to oxygen gas and Mn2+ in acidic solution balance this equation: MnO4- + H2O2 yield Mn2+ + O2 this is what i got 16H+ + 2MnO4- + 5H2O2 yield 2Mn2+ + 8H2O + 5O2 + 10H+ all the atoms and charges are balanced but why did my professor ...

Determine the total number of electrons transferred in the following balanced reaction. 4 MnO4– (aq) + 12 H3O+ (aq) → 4 Mn2+ (aq) + 5 O2 (g) + 18 H2O (g)

5 Fe2+(aq)+MnO41-(aq)+8 H1+(aq)-->5Fe3(aq)+Mn2+(aq)+4 H2O(l) 2 MnO41-(aq)+5 C2O42-(aq)+16 H1+(aq)-> 2 Mn2+(aq)+CO2 g)+8 H2O(l) Both of these reactions result in the purple permanganate (MnO41-(aq)) ion reacting to form the colourless manganese (II) ion. The difference is...

What coefficients are needed to balance the equation for the complete combustion of methane? Enter the coefficients in the order CH4,O2,CO2, and H2O,respectively. Express your answer as four integers, separated by commas (e.g., 1,2,3,4).

I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is the main rule ...

Using the change-in-oxidation-number method, balance the redox reaction below. Show your work; partial credit will be given. NO2– + MnO4– → NO3– + Mn2+ Figure out which atoms’ oxidation numbers are changing, and by how much. Balance the equation for charge. Add ...

chem-balancing acidic equation
the reaction: Cr2O7^-2(aq) + Cl- -> Cr^3+(aq) + Cl2(g) My balancing. Cr2O7^-2(aq)-> Cr^3+(aq) +Cr +7H2O +14H+ +6e- Cr2O7^-2(aq)+14H+ +6e- -> 2Cr^3+(aq)+7H2O Cl- -> Cl2(g) +Cl- +2e- 2Cl- -> Cl2 +2e- Cr2O7^-2(aq)+14H+ +6e- +2Cl- -> 2Cr^3+(aq)+7H2O +Cl2 +2e- ...

Calculate the change in enthalpy for the following reaction: C25H52(g) + O2(g) → CO2(g) + H2O(l) I started off by balancing the equation: C25H52(g) + 38O2(g) → 25CO2(g) + 26H2O(l) Can someone help me with the rest.

The redox reaction below occurs in acidic solution. Balance it with the smallest whole number coefficients and determine the coefficient for H+. MnO4-(aq) + HNO2(aq) ---> Mn2+(aq) + NO3-(aq) when i did it..i got the answer as1...but im not to 1. 3 2. 5 3. 1 4. 4...

could someone check my answers to see if they are right? Balance the following equation and give the value of the stoichiometric coefficient marked with a question mark. 6 KNO3+ _ S + ? H2O _ H2SO4+ _ N2+ _ K2SO4 answer:6KNO3 + 5S + 2H2O --> 3 K2SO4 + 3N2 + 2H2SO3 42 KMnO4...

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

I need help with a,b,and c. I tried to balance it but im having a little trouble Ethane gas, C2H6, burns in air and produces carbon dioxide and water vapor. a)write a balanced equation for this reaction. I know this isnt balanced but is this what im working with? C2H6 + O ---&...

Consider the following two reactions: 5 Fe2+(aq)+MnO41-(aq)+8 H1+(aq)-->5Fe3(aq)+Mn2+(aq)+4 H2O(l) 2 MnO41-(aq)+5 C2O42-(aq)+16 H1+(aq)-> 2 Mn2+(aq)+CO2 g)+8 H2O(l) Both of these reactions result in the purple permanganate (MnO41-(aq)) ion reacting to form the colourless...

chemistry Help
Consider the following two reactions: 5 Fe2+(aq)+MnO41-(aq)+8 H1+(aq)-->5Fe3(aq)+Mn2+(aq)+4 H2O(l) 2 MnO41-(aq)+5 C2O42-(aq)+16 H1+(aq)-> 2 Mn2+(aq)+CO2 g)+8 H2O(l) Both of these reactions result in the purple permanganate (MnO41-(aq)) ion reacting to form the colourless...

my ques ok a coumpond containing 3atoms of carbon an 8 atoms ofhydrogen combined in reaction with oxy molecules the two end products of this equation are carbon dioxide co2 an water wat element should i look at first in balancing this question and wen i hav finished balancing ...

BrO3^-(aq)+Sn^2+(aq)+ ____ -->Br^-(aq)+Sn^4+(aq)+ _____ H20(l)and H^+(aq) are involved in the reaction. What are the coefficients of the six species in the balanced equation above? Remember to include coefficients for H2O(l) and H+(aq) in the appropriate blanks.

How would you balance this equation?? Ba(NO3)2 + NH2SO3H + H2O -> Ba(NH2SO3)2 + HNO3 Would you have to make the H2O 0, ultimately removing H2O from the equation (is that even allowed?), or is there another way of balancing it??

Write a balanced equation for the following reduction-oxidation reaction. SO3–2 + MnO4–SO42– + Mn2+ __SO32–(aq) + ___MnO4–(aq) + ___H+(aq)--> ___SO42–(aq) + ___Mn2+(aq) + ___H2O(l) I have no idea how to do this type of problem, care to explain?

Chem 3A
please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?

MnO4+C2O42-=Mn2+ +CO2

How to make into compounds to get a formula? Li+: Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Cu:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Pb2+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Ca2+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Al3+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Cr5+:Br-, O2-, CN-, SO3^2-, ...

How to make into compounds to get a formula? Li+: Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Cu:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Pb2+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Ca2+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Al3+:Br-, O2-, CN-, SO3^2-, PO3^3-,MnO4- Cr5+:Br-, O2-, CN-, SO3^2-, ...

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. Next>>

Post a New Question