Tuesday
September 2, 2014

Posts by xX_Supaman_Xx


Total # Posts: 19

chem
In the formation of sulfur hexaflouride, does the reaction at constant pressure or volume proceed more spontaneously? I've done the calcs to show that at constant volume, it is slightly more spontaneous, but I can't seem to find a good reason why... it might have ...
January 28, 2008

Chem
In thermodynaics, what is the relationship between enthalpy (H) and heat (q) - [at constant pressure]?
January 27, 2008

Physical Chemistry
In terms of bomb calorimetry, can one assume the temperature of the water surrounding the cmopartment is equal to the temperature within the compartment? If not, how would one determine T for the reaction occuring inside the compartment?
January 26, 2008

French
Can the words "les hommes du maison" be translated to both "the men of the house" and "the men from the house" or just one of them?
January 5, 2008

drwls & Damon - maths
hey guys, i follow you up to the point of intergrating the final line. How would I intergrate [x^-2.e^-x] dx thx
December 29, 2007

Mathematics
Solve the following differential equation, i.e. solve for y: dy/dx - y/x = 1/x + y + 1 I have this so far, 1. dy/dx= (y + 1 + xy + x)/x 2. x dy = (y + 1 + xy + x)dx 3. Integrate both sides... xy + c = xy + x + .5x^2y + .5x^2 + k where c and k are constants 4. c = x + .5x^2 (y...
December 29, 2007

French
What is the main linguistical difference between the phrases; 1. Je m'en vais and 2. J'y vais
December 14, 2007

maths
how would i solve the differential equation dx/dt=-kx^2 i.e. solve for x as a function of t. I've been told to rearrange the equation to yield dx/x^2=-k dt but what can and should I do now?
December 14, 2007

Math
d/dx x^2+3x = 2x+3
December 5, 2007

Mathematics
Solve d/dx x(ln(x)-1) I had: =d/dx xln(x) - d/dx 1 =d/dx ln(x)^x =x^(-x-1) [and this is wrong] Can someone show me the correct answer and working please?
December 5, 2007

Mathematics
Differentiate ln(x)-1 I have d/dx lnx-1 = d/dx(ln x)- d/dx1 = d/dx(ln x) = 1/x Could you tell me if this is right or not? If not, please suggest the right working out.
December 4, 2007

Reposted: Maths - Trig
I've been told that sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) but how? please explain
December 2, 2007

Maths-Trig
How does sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) please explain
December 1, 2007

Physics - Electricity
Can you please check my answers. 1) What carries energy through wire? electrons 2) What happens to some of the energy when it moves through the wire? becomes lost due to the movement of energy requiring some kinetic energy 3) If a resistance is large, why does the wire heat up...
November 24, 2007

Maths-Logs
when writing log b to base a, (log-a(subscript)-b), can a be less than 0?
November 23, 2007

Sport - Football
In FLAG FOOTBALL, how many players are allowed on the field at one time and what are their positions' names? Please help, I'm in Australia and Football just ain't as big as it is in some other countries.
November 21, 2007

math
diameter= sqr[(6^2+(-2)^2)+(4^2+0^2)] therefore, radius= (sqr[(6^2+(-2)^2)+(4^2+0^2)])/2 = ?
November 10, 2007

math
see my other response
November 10, 2007

CHEM
HOCl forms from OCl- + H+ and vice versa. the anion is hypocholrite (OCl-). Given the attaching proton is positively charged and out of O and Cl, O is more nucleophilic (Cl has the highest electronegativity), the H will attach to the O atom making the oxygen the cetral atom. I...
November 10, 2007

Pages: 1

Search
Members