Sunday
April 20, 2014

Posts by meghan


Total # Posts: 213

Physics
a person's metabolic processes can usually operate at a power of 6 W/kg of body mass for several hours at a time. If a 60 kg woman carrying a 12 kg pack is walking uphill with an energy-conversion efficiency of 20 percent, at what rate, in meters/hour, does her altitude in...

Excelsior
he following transactions occurred during March 2009 for the Wainwright Corporation. The company owns and operates a wholesale warehouse. 1. Issued 30,000 shares of common stock in exchange for $300,000 in cash. 2. Purchased equipment of a cost of $40,000. $10,000 cash was pai...

Physics
The hypothenuse of a right triangle measures to be 17.5 cm. If the three angles are 30 degrees, 60 degrees, and 90 degrees, what are the lengths of the other two sides?

Physics
The hypothenuse of a right triangle measures to be 17.5 cm. If the three angles are 30 degrees, 60 degrees, and 90 degrees, what are the lengths of the other two sides?

Business 101
your #2,13,15,17,18 are wrong

chemistry
The kinetic energy of a rolling billiard ball is given by KE=1/2mv2. Suppose a 0.17-kg billiard ball is rolling down a pool table with an initial speed of 4.7m/s . As it travels, it loses some of its energy as heat. The ball slows down to 3.7m/s and then collides straight-on w...

statistikc
1. statistic 2. B. 3.

Science (MYOGLOBIN)
It's heme I figured it out myself. Thanks

Science (MYOGLOBIN)
Does anyone know the coenzyme found in myoglobin

chemistry
how do I determine the total charge of Asn-Tyr-Asp with a pH 7.4

chemistry
How do I determine the total charge of Asn-Tyr-Asp with a pH 7.4

chemistry
a certain a digestive reaction, performed at optimum temperature and pH takes 10 minutes to reach completion when performed in the absence of the associated catalyst. How many minutes would the same reaction require if an enzyme that increase the reaction rate one million time...

Chem
Ok thank you :D

Chem
Use a chemical equation to help explain why the pH of an aqueous solution changes after HCl solution has been added This is what I got HCL + H2O = H30+ plus CL- Hope that makes since (those are a positive and negative signs at the right side of the equation) Tell if I'm ri...

organic chem
Amide formation: draw the structure (or provide the IUPAC name) of the amide formed (appropriate coupling reagent required) between benzoic acid and N-ethyl ethanamine (diethyl amine)

organic chem
Hydrolysis: draw or name the products of hydrolysis of sec butyl 2-methylbenzoate Thank you I know you cant draw them but the names of products would be helpful.

org. chem
Give IUPAC name of the products of the dehydration of this alcohol? 2-ethyl cylcopentanol

organic chem
Draw and give IUPAC name the products of dehydration of 2-ethyl cyclopentanol I know you can't draw it but the name or even how to draw this would be appreciated

organic chem
Dehydrate the following a. 2-methyl-1-propanol b. 2-methylcyclohexanol c. 2-methyl-1-phenyl-1-propanol d. 1-methylcyclopentanol

organic chem
Classify as primary, secondary, tertiary alcohols. i. 2-butanol ii. 3-methyl-3-pentanol iii. 2-methyl-1-pentanol iv. 3-chlorocyclohexanol

organic chem
Oh ok thank you. Sorry, I'm really dumb when it comes to this stuff :)

organic chem
Ok I understand how your getting the parent compound. I'm not understanding where for example question 1, the '2-methylbutyl'. Thats where I keep getting messed up.

organic chem
Name the ester obtained when the alcohol is reacted with 2-ethylpentanoic acid? 1. 2 -propanol 2. 2-butanol 3, phenol

organic chem
Ok thank you so much I'm going to try to attempt the others.

organic chem
oh sorry, I wrote the ethyl group on my equation just didn't write it on the forum. Anyway, I'm curious how did you do the first one. Where did the ammonia come into play? It looks like you lost the -anoic acid group and replaced with the ammonia (NH3). And why did the...

organic chem
Ok, I'm just confused on the coupling reaction. Is the coupling reaction the amide like for A. Is is Ammonia. I drew out 3-hexanoic acid + NH3...thats where I'm stuck. I do apologize for the amount I'am asking you. I appreciate the help.

organic chem
ok, then just name the amide

organic chem
Draw and name the amides that would be obtained by reaction of 3-ethylhexanoic? Also with the apropriate coupling reagent, and the following amines: A. ammonia B. methanamine C. N-methyl methanamine D. Aniline E. N-ethyl aniline

organic chem
which of following alcohols can be oxidized to be a carboxylic acid. Name the carboxylic acid produced. Those that cannot be oxidized to a carboxylic acid name the final product A. ethanol b. 2-propanol c. 1-propanol d. 3-pentanol

org. chem
what would the oxidation product 1. 2-methylpentnal 2. 3-pentanone My answers: 1. 2-methylpentanoic acid 2. no further reaction I just want to be sure I'm doing this right. Thanks.

organic chem
Write an equation representing the oxidation of each of the following. I'm on 3-hexanol. And this is what I got -> [o] 3-hexanal and further oxidation I know you get 3-hexananoic acid. I don't know how to make this in the line formula. Can I put the -OH and the doub...

organic chem
Which are enatiomers? optically active?identical? diastereomers? A.)...CH3 .....| ...H-C-Cl .....| .....Ch2Cl B.).....H .......| ...H3C-C-CH2CL .......| .......CL C.)...CH3 .......| ....CL-C-H ......| ......CH2CL D.)....CH2CL .........| ......CL-C-H .........| .........CH3 E.)...

org. chem
Draw the acetal obtanined from 1-propanol and benzaldehyde Draw the ketal obtained from 2-propanol and 3-methylcyclpentanone Can someone tell me where the actal/ketal comes from or do I just add it to the equation. Not sure how to start this. Thanks :)

org. chem
Can someone explain in simple terms the difference between hemiketal and hemiacetal? Just curious

organic chem
Draw the hemiketal obtained by addition of methanol to 3-methyl-2-hexanone This is what I got: 3-methyl-2-hexanone + CH3OH <-> CH3CH2CH(CH3)CH2C(OH)(CH3). But my answer is line angle formula because that's what the professor wants here's my line formula CH3 /\/\/...

org. chem
ok thank you thats what I got :)

org. chem
The question asks, "draw the hemiacetal obtained by addition of ethanol 2-methylpentanal" My question is how to do this problem? I know you can't actually draw it out on this site. However so I know how to do it on the upcoming test. Thanks :)

organic chem
oxidation product for 3-methyl-1-heptanol

org. chem
Hello, I do apologize DrBob222 I didn't see your post from yesterday. However, thank you for help and thank you devron for your help as well. The extra credit only says how would prepare a .6m acetate buffer with a pH = 4.0. So I too, wasn't sure what the question was ...

org. chem
How to start these problems out: Please help thank you Use the Henderson-Hasselbach equation: pH = pKa + log [A-]/[AH], where A- is the conjugate base and AH is the weak acid. Calculate the pH of an acetate buffer in which the acetate concentration [CH3COO-] is 3.5 times great...

organic chem
. Use the Henderson-Hasselbach equation: pH = pKa + log [A-]/[AH], where A- is the conjugate base and AH is the weak acid. Calculate the pH of an acetate buffer in which the acetate concentration [CH3COO-] is 3.5 times greater than acetic acid [CH3COOH]. pKa = 4.74. 9. How wou...

physics
The body of a 1258 kg car is supported on a frame by four springs. The spring constant of a single spring is 1.31 × 104 N/m. Four peo- ple riding in the car have a combined mass of 230 kg. When driven over a pothole in the road, the frame vibrates and for the first few s...

AP Psychology
What is right brain education and how does it relate to cerebral lateralization

College algebra
What is the domain for X³+2X²-9X-18

College Physics
Just for clarification, the question asks if he does 3.85 X 10^2 J of work.

College Physics
Suppose the Eskimo is pushing the same 50.0-kg sled across level terrain with a force of 51.5 N. If he does 3.85 102 J of work on the sled while exerting the force horizontally, through what distance must he have pushed it?

Physics
An astronaut on a distant planet wants to determine its acceleration due to gravity. The astronaut throws a rock straight up with a velocity of + 14.2 m/s and measures a time of 22.2 s before the rock returns to his hand. What is the acceleration (magnitude and direction) due ...

Geometry
Find the perimeter of a square with sides 10 feet long?

Geometry
In the standard (x,y) coordinate plane, if the x-coordinate of each point on a line is 4 less than twice its y-coordinate, what is the slope of the line?

business
all 400 answers are correct

Physics
A capacitor consisting of two parallel plates of area A = 4.6 m2 and spacing d = 0.150 m is filled with two parallel slabs of dielectric material of equal thickness and with dielectric constants 1 = 2.20 and 2 = 5.50, respectively. What is the total capacitance?

social studies
How can you use the word league in a sentence

7th Geometry
We are using the Pythagorean rule and I'm a little confused... Solve each problem using a grid. Round your answer to the nearest hundredth. Dover is located at (1,2) and Goodlow is located at (5,7). How far apart are the 2 cities? My answer is 6.40... am I doing this right...

geometry
A tree that is 100 feet tall casts a shadow that is 150 feet long. Determine the angle at which the rays of the sun hit the ground to the nearest degree.

algebra
The half-life of plutonium-234 is 9 hours. If 40 milligrams is present now, how much will be present in 4 days? (Round your answer to three decimal places.)

chemistry 111
2A+3B 3C hOW MANY MOLES OF b ARE REQUIRED TO COMPLETELY REACT WITH 9 MOLES OF A?

math
Suppose that the format for license plates in a certain state is two letters followed by four numbers. How many different plates can be made if repetitions of numbers and letters are allowed except that no plate can have four zeros?

physics
how to solve for velocity using these values... distance time(s) 28.5 (initial) 4.26 (initial) 89 (final) 6.77 (final)

physics
the car travels at 20m/s when the driver sees a child. It takes 0.8s to react, then steps on the brakes and slows at 7.0m/s^2. How far does the car go before it stops?

physics
a bike first accelerates from 0m/s to 5.0m/s in 4.55, then continues at this constant speed for another 4.5s. what is the total distance traveled by the bike?

physics
a student drops a ball from a window 3.5m above the sidewalk. the ball accelerates at 9.80m/s^2. How fast is it moving when it hits the sidewalk.

physics
A bike accelerates from 0.0m/s to 4.0m/s in 4s. what distance does it travel?

Statistics
An automatic machine in a manufacturing process is operating properly if the lengths of an important subcomponent are independently and normally distributed with a mean of 120 cm and a standard deviation of 4.7 cm. Find the probability that if 3 are randomly selected, all 3 ha...

physics
A baseball thrown at an angle of 65.0^\circ above the horizontal strikes a building 16.0 {\rm m} away at a point 5.00 {\rm m} above the point from which it is thrown. Ignore air resistance. a) find the magnitude of the initial velocity of the baseball. b) find the magnitude of...

physics
A man stands on the roof of a 19.0 m tall building and throws a rock with a velocity of magnitude 30.0 m/s at an angle of 30.0 degrees above the horizontal. Ignore air resistance. Calculate the horizontal distance from the base of the building to the point where the rock strik...

AP Calculus
If f(x)=3x^2-x+2 then what is 2f(a)? What is f(2a)? What is f(a^2)? What is [f(a)]^2? What is f(a+h)?

English
Our state is bordered by Kansas to the west. Should west be capitalized...I was thinking it was a direction and didn't.

Math
Bacteria experiences exponential growth, increasing 17% every hour. If there are 800 bacteria now, in how many hours will there be 2000? How would I go about this problem?

Math
Okay, I need to find the 101th term of the sequence 5,9,13,17,21... Do I do this: a1 + (n-1)d SO... 5+(101-1)4 5+(100)4 105x4 420 Did I do this problem correctly?

Algebra
Thanks for your help!! I knew how to start, just wasn't sure the steps to go!

Algebra
Solve the logarithmic equation. log2(4x)-log2(x+3)=1

Algebra
4^(2x-2)=26

Algebra
Solve the exponential equation. 4^2x – 2 = 26 I know I use the one to one property to equate. But I am confused. Thanks!

pre cal
what is the equation to make a heart out of a cardioid?

Math
A raffle held by Mundane Products has collected 700 entries. They are giving away 40 TVs and 30 stereos. John bought 5 entries for the raffle. What is the probability that John wins exactly one TV as well as exactly one stereo? John just heard that the TVs are already decided ...

Math
What is the probability that at least 2 people in a random group of 4 people have a birthday on the same day of the week? Answer:

Math
A right circular cylinder with a height of 20 cm and a right circular cone share a circular base and have the same volume. What is the height of the cone?

math
In a game of blackjack, each player is dealt two cards from a standard 52-card deck. If the first card is 10 of clubs, what is the probability that the second card is heart?

Math
A teacher is trying to pick 7 students to represent his class at an upcoming state competition. If there are 18 boys and 10 girls in the class, in how many ways can the teacher pick 4 boys and 3 girls to attend the event?

Math
Thanks!!!!!!!

Math
A florist has access to 9 types of flowers and 8 types of foliage. He makes bouquets using 4 types of flowers and 3 types of foliage. How many different bouquets can he make?

APUSH
The U.N. Resolution 1441 authorized what?

Math
If you can afford a monthly payment of $760 for 27 years and if the available interest rate is 5.40%, what is the maximum amount that you can afford to borrow?

AP Chemistry
what si the procedure to make a 0.10m solution of Potassium Hydroxide during a class lab?

AP Chemistry
This is an Advance placement chemistry class. We were told to fine the materials needed to do this lab, and the procedure. i need this info so i can physically do the lab.

AP Chemistry
what are the procedures and materials needed to make a 0.10m solution of Silver(I) Chloride?

AP Chemistry
what is the procedure and materials needed to make a 0.10m solution of Potassium Hydroxide?

physics
thank you!

physics
A hot stell ball of mass 1 kg is dropped into a 4 L bucket of water at room temperature (70 degrees F). If the system reaches an equilibrium temperature of 320 K, what was the initial temperature of the steel ball before it was dropped into the water? Cp of steel = 490 J/kg de...

chemistry
when a balloon has 1.2 L of a gas at 1.1 atm what will be the new volume of the balloon if the ballooon is placed in a partial vacuum, with a pressue of .35 atm?

math
scientific notation please exlain.

New Age Math
Consider the region defined by the inequalities: 0≤x 0≤y -21/4≤y-7/4x y+x≤7 4≤y-3/7x Pick up those points which are the boundary points of the resulting convex region.

New Age Math
Suppose that y≤5x,3x≤y and 14x+15y≤1 together with 0≤x, 0≤y. The maximum value of the function y+x on the resulting region occurs at x=? and y=? The maximum value of the function is ?

English
I need to write a Reading Response to "Why We Crave Horror Movies" by Stephen King. I need help figuring out the theme to the essay.

6th grade English
Draw a line under each preposition and to lines under the object of a preposition. He was thirty years old when he first went to California in 1868. i underlined once "to California" and "in 1868" and i under lined twice twice Californiia and 1868. is this ...

algebra2
What is the value of x in the solution to the system y = 4x + 3 and 3x + 2y = -16? (Round to the nearest integer if necessary.)

Math- Geometry
A board 20 feet long is cut into two boards with lengths in ratio of 5 to 2. To the nearest tenth of a foot, how lng is the longer piece of the board?

math
how long will it take to earn 525$ in interest if $3500 is invested at a 6% annual interest rate?

math
Omar wants to buy a double scoop ice cream cone. His favorite flavors are vanilla, strawberry, raspberry and chocolate. A combination with both scoops of raspberry represents ___ out of ___ possible combinations.

physics
A disk, with a radius of 0.25 m, is to be rotated like a merry-go-round through 800 rad, starting from rest, gaining angular speed at the constant rate α1 through the first 400 rad and then losing angular speed at the constant rate -α1 until it is again at rest. The ...

Pages: 1 | 2 | 3 | Next>>

Search
Members