Post a New Question

Posts by jessie

Total # Posts: 748

Please help correct my answers for potential interview. what are your strenghts and weaknesses? my greatest strengths is i always completed a multi tasks a head the deadline. my weaknesses is being a perfectionist on myself i always make sure that every tasks assigned to me is...

Pleaese correct my answers on the potential interview for telll me about yourself. i'm 48 years old, previously i have been working abroad in k.d.s as photolab operator since 1993-2003. i completed a training course in caregiver may 2003. from 2006-2015 i have been working...

please help me to correct my anserw below: 1. Shhhh! Be quiet! John (sleep) _____. He might hear us from the other room. 1.sleeps 2.will sleep sleeping 4.have been sleeping ans.3 2. You look great! (you, exercise) _____ at the fitness center? 1. Are you exercising 2.Do ...

126 is the product of 7 and Victor's savings. Use the variable v to represent Victor's savings.

please kindly help if my answers below are coorect.thank you . Teacher: So you want to learn _____ English? 1. To Talk 2.Talking 3.Speaking 4.To Speak ans. 3 2. Student: Yes, I want to be able to speak _____. 1.Good 2.Goodly 3.Proper 4.Well ans. 4 3. Teacher: I don't see ...

Please help me to correct my answers below.let me know the correct answers. thank you 1. Justin (write) _____ his speech for the presentation now. I hope he finishes it before we meet. 1. is writing 2.will write 3.writes 4.has been writing ans.3 2. The boys' clothes are ...

Please help me to correct my anserw below.thank you Petroleum, or crude oil, is one of the world's (1) _____ natural resources. Plastics, synthetic fibres, and (2) _____ chemicals are produced from petroleum. It is also used to make lubricants and waxes. (3) _____, its ...

Please help if my answers are correct and let me know the correct answers below. thank you. Can we see (1) _____ the earth is a globe? Yes, we can. When we watch a ship that sails out to sea, we can see that the ship begins (2) _____. The bottom of the ship disappears first, ...

Please help me to correct my answers below.let me know the correct answers. thank you 1. Justin (write) _____ his speech for the presentation now. I hope he finishes it before we meet. 1. is writing 2.will write 3.writes 4.has been writing ans.2 2. The boys' clothes are ...

please kindly help if my answers below are coorect.thank you . Teacher: So you want to learn _____ English? 1. To Talk 2.Talking 3.Speaking 4.To Speak ans. 2 2. Student: Yes, I want to be able to speak _____. 1.Good 2.Goodly 3.Proper 4.Well ans. 1 3. Teacher: I don't see ...


oohh!! Thanks Steve.

what is the recursive rule for the sequence -7.4, -21.2, -35, -48.8, -62.6 an=an-1+13.8 an=an+1+13.8 an=an+1-13.8 <-- or D an=an-1-13.8 <-- or C

an 1100 kg car accelerates from rest at 3.4 m/s2. if the horizontal force exerted on the wheels by the road is 5600 N, what force must be resisting the motion of the car? use a free body diagram to illustrate your answer.

Help: biology
1. You have in front of you three vials containing a clear liquid. You are told that each vial contains one of the following carbohydrates: Fructose, Sucrose, Amylose. What experiments could you carry out to determine the composition of each vial. What would be the expected ...

Molecular bio
Which of these sugar(s) would contain amylose? (*I looked it up but there wasn't a clear answer* ) Glucose Fructose Sucrose Lactose Starch -This one is amylose because it's a long chain. What about the other four?

You measure out 3.00 mL of 0.100 M Co(NO3)2, place it in a test tube and add 7.00 mL of water. What is the concentration of the diluted solution in the test tube?

In an experiment designed to determine the concentration of Cu+2 ions in an unknown solution, you need to prepare 100 mL of 0.10 M CuSO4 as your stock solution. How many grams of CuSO4(s) should you use?

A hotel gives every customer who makes a reservation a confirmation code. How many different confirmation codes can be created if each code has 4 letters followed by 2 numbers?

A diagonal of a square has the same length as a diagonal of a rectangle. The area of the rectangle is 60% of the area of the square. What is the ratio of the shorter side to the longer side of the rectangle? Write your answer as a common fraction (or an integer). How do I even...

The reaction 2 NO(g) + O2(g) --> 2 NO2(g) is important in forming smog. Under certain conditions, the rate law for a the reaction is rate = 4.0 x 10-3 1/M2*s * [NO]2* [O2] What is the rate when [NO]=0.020 M and [O2]=0.035 M? a. 5.6 x 10-2 M/s b. 9.8 x 10-5 M/s c. 9.8 x 10-8...

Calculate the concentration of KIO3(aq) present at the beginning of a reaction when 2.00 mL of 0.020 M KIO3(aq) is mixed with 8.00 mL of other solutions so the initial volume for the reacting mixture is 10.00 mL.

Consider the reaction: N2(g) + 3 H2(g) --> 2 NH3(g). At a particular time, the nitrogen is being consumed at a rate of 0.60 moles/sec. At this same time, what is the rate at which ammonia is being formed? a. 3.0 mol/s b. 0.12 mol/s c. 0.30 mol/s d. 2.0 mol/s e. 1.2 mol/s

The rate of a reaction A + 2B --> products is determined. When the concentration of A is 1.0 M, the rate of the reaction is 0.50 M/s. When the concentration of A is 0.50 M, the rate is 0.25 M/s. From this data, you can determine: a. that the reaction is second order in A. b...

In a reaction, a chemist is observing the absorbance of CoCl2(aq) as a function of time to determine the rate at which it is being consumed in a reaction. At time t=10 s, the chemist determines that the concentration of CoCl2(aq) is 0.12 M. At time t=20 s, the chemist ...

Whuch of the following expressions is equivalent to the expression below? 4[5x+2-x]

In an extensive study involving thousands of British children, Arden and Plomin (2006) found significantly higher variance in the intelligence scores for males than for females. Following are hypothetical data, similar to the results obtained in the study. Note that the scores...

Social Studies
what did hatshepsut do as pharaoh of Egypt?

2 1/8 divided by 3 1/4= a.68/104 b.221/32 c.17/26 d.6 29/32

Instructions: Modifique el párrafo por cambiar las palabras entre comillas al tiempo FUTURO. Modelo: Mi familia ‘va a visitar’ a nuestros abuelos este verano. Mi familia visitará a nuestros abuelos este verano. 1. Este año ‘vamos a hacer&#...

Pre Cal help please!!
given f(x) = { 2x^2 + 5 x < or equal to 2 3 - x^2 x > 2 find lim f(x) x -> 2^+ lim f(x) x -> 2^- lim f(x) x -> 2

Chemistry AP
I know that the answer is not A... can anyone help me any further?

Chemistry AP
The equilibrium constant for the formation of phosphorus pentachloride is 1.9. If the partial pressure of each gas is 0.5 atm, will the reaction (as written) proceed forward or backward to reach equilibrium? PCl3(g) + Cl2(g) PCl5(g) A. Forward, because K is greater than Q B. ...

ap chemistry
Which of the following statements about the pH scale is not true? A. In a pH expression, the hydronium ions, H3O+, can be abbreviated simply as H+. B. A solution with a pH of 4 has twice the [H+] of a solution with a pH of 2. C. The pH scale is based on a scale involving ...

ap chemistry
When are more products of a reaction available initially than at equilibrium? A. K = 0 B. Q < K C. Q = K D. Q > K

When are more products of a reaction available initially than at equilibrium? A. K = 0 B. Q < K C. Q = K D. Q > K

Given the following solubility constants, which list arranges the solutes in order of increasing solubility? CaCO3: Ksp = 2.8 × 10-9 Ca(OH)2: Ksp = 5.5 × 10-6 CaSO4: Ksp = 9.1 × 10-6 CaF2: Ksp = 5.3 × 10-9 A. CaSO4 < Ca(OH)2 < CaCO3 < CaF2 B. ...

Given the equilibrium concentrations in the table, what is the equilibrium constant for the synthesis of ammonia at this temperature? 3H2(g) + N2 2NH3(g) A. 0.0035 B. 0.014 C. 0.066 D. 0.017

What change do you expect if the value of the reaction quotient is greater than the value of the equilibrium constant? A. The rate of the forward reaction is greater than the rate of the reverse reaction. More reactant forms. B. The rate of the forward reaction is greater than...

Which of the following is true about the results of a neutralization reaction? A. An acid and a base form water and salt. B. Water reacts with a base to form the hydroxide ion. C. Water reacts with an acid to form the hydronium ion. D. An acid and a base dissociate into their ...

What does a buffer do? A. It resists a change in pH when H+ or OH- is added to a solution. B. It prevents an acid-base reaction from happening. C. It prevents an acid or base from being neutralized. D. It prevents a salt from forming in solution.

Why is HCl required in the stomach? A. To transport proteins into the small intestines B. To help absorb other acids in the stomach C. To catalyze the digestion of carbohydrates D. To aid in the digestion of proteins

The [OH-] ion concentration of a sample is 1 × 10-10 M. What is the concentration of [H+] in the sample at 25°C? A. 1 × 10-14 M B. 1 × 10-4 M C. 1 × 10-10 M D. 1 × 10-6 M

Which of the following chemical reactions represents a neutralization reaction? A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl C. NH3 + H2O NH4++ OH- D. CH3COOH + H2O CH3COO- + H3O+

Which of the following is true about the results of a neutralization reaction? A. An acid and a base form water and salt. B. Water reacts with a base to form the hydroxide ion. C. Water reacts with an acid to form the hydronium ion. D. An acid and a base dissociate into their ...

What is the general form for the simplest type of acid-base reaction? A. acid + base salt + water B. acid + base base + acid C. acid + base H+ + OH- D. acid + base solid + water

A, B, C, and D are 4 salts whose Ksp values are 9.21 × 10-8, 7.44 × 10-11, 1.07 × 10-21, and 38.65, respectively. What is the correct arrangement of their solubilities in decreasing order? A. D, A, B, C B. C, B, A, D C. A, B, D, C D. C, B, D, A

Acetic acid is known to be a weak acid. What will happen to the acidity of the solution when sodium acetate is added to acetic acid? A. The solution will become more acidic. B. The pH will remain the same. C. The solution will become less acidic. D. The solution will become ...

Which of the following bases could you write an equilibrium expression for? A. Ba(OH)2 B. KOH C. NaOH D. NH3

During a chemical reaction, if Q = K, what can be said about the reaction? A. The reaction still proceeds in both directions, but the net result is that the reactant and product concentrations do not change. B. The amount of product is always equal to the amount of reactant. C...

Which of the following is true of the solubility product constant? A. It is the product of the initial concentrations of the ions in a solution. B. It is an equilibrium constant. C. It is an equilibrium position. D. Its value changes in the presence of a common ion. Hi, I know...

Which equation would describe the following equilibrium constant? Kc = [Bi3+]2[S2-]3 A. Bi2S3(s) + 6HCl(aq) 2BiCl3(aq) + 3H2S(aq) B. Bi2S3(s) 3Bi2+(aq) + 2S3-(aq) C. BiS(s) Bi3+(aq) + S2-(aq) D. Bi2S3(s) 2Bi3+(aq) + 3S2-(aq)

What happens to the following reaction at equilibrium if the pressure is decreased? 2H2(g) + O2(g) 2H2O(g) A. The equilibrium shifts left because Q < K. B. The equilibrium shifts right because Q < K. C. The equilibrium shifts right because Q > K. D. The equilibrium ...

What is the equilibrium expression for the change when iron(II) chloride dissolves? FeCl2(s) Fe2+(aq) + 2Cl-(aq)

science ap chemistry
What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

math homework
use the limit process to find the slope of the graph of 'square root' x+8 at (8,4) a. 4 b. 1/4 c. the slope is undefined at this point d. 1/8 e. infinity

solve the system of equations for x and y { x^2 - 11x -y =-24 x^2 - 11x + y = -24

evaluate the expression (94) (93) a. 94 b. 93 c. 1 d. 88 e. -5

find the area of the parallelogram that has the vectors as adjacent sides u = -2i + j + 5k v = 4i - 3j - 3k a. 11 b. squareroot 26 c. 86 d. 2 squareroot 86 e. 1

math homework help please?!!
determine lim f(x) x -> 1 where f(x) = { 13 - x^2, x < or equal to 1 11 - x, x > 1 a. 11 b. limit does not exist c. 13 d. 10 e. 12

Rainy can you help me with this question?!
find the values of x and y that will make the matrix equal [x y] 1 9 = [3 5] 1 9 the answer options are a. x=-3 y=-5 b. x=5 y=3 c. x=-3 y=5 d. x=3 y=5 e. no solution

What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

A reaction has an equilibrium constant very much less than 1. Will the reaction proceed spontaneously? A. Yes, because products are favored and deltaG° < 0. B. Yes, because reactants are favored and deltaG° > 0. C. No, because reactants are favored and deltaG°...

If the equilibrium constant is much less than 1, how can you tell where the equilibrium lies? A. Reactants are in the numerator of the equilibrium expression, so equilibrium lies toward the reactants. B. Products are in the numerator of the equilibrium expression, so ...

What information does an equilibrium constant give about a reaction? A. It tells how long it takes the reaction to reach equilibrium. B. It tells how much energy is required for the reaction to happen. C. It tells what the rate constant of the reaction is at equilibrium. D. It...

Under constant pressure, a system of gases is sealed in a cylinder and then allowed to expand. What can you conclude about the work associated with this change? A. Work is negative and is done to the system. B. Work is negative and is done by the system. C. Work is positive ...

Knowing what information would allow you to order gas molecules according to their velocity? A. Pressure and temperature B. Volume and molecular mass C. Pressure and volume D. Temperature and molecular mass

Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the reactants D. The rate ...

please help with this trigonometric identity!
verify this trigonometric identity cos 'a' - cos 'b' / sin 'a' + sin 'b' + sin 'a' - sin 'b' / cos 'a' + cos 'b' = 0 please help me with this! i don't know how to do it!

Knowing what information would allow you to order gas molecules according to their velocity? A. Pressure and temperature B. Volume and molecular mass C. Pressure and volume D. Temperature and molecular mass

chemistry help?!
Which properties result from minimal interactions between molecules in a gas? A. A characteristic geometric shape and limited particle motion B. A random shape, limited particle motion, and inability to be compressed C. A random shape, significant particle motion, and ability ...

chemistry help
How do forces determine the shape of a protein? A. The covalent bonds in the protein determine the shape of the protein. B. The protein folds into complex shapes through intermolecular forces. C. Polar parts of a protein are repelled by water. D. Hydrophobic parts of a protein...

How do intermolecular forces determine the vapor pressure of a liquid? A. A nonpolar compound has a low vapor pressure because of London dispersion forces. B. A compound that can form hydrogen bonds has a low vapor pressure. C. A polar compound has a high vapor pressure ...

So is it just IV?

Which of the following statements is (or are) true? I Hydrogen bonds occur between two hydrogen atoms. II Hydrogen bonding occurs between a hydrogen atom and an oxygen atom within a molecule. III Hydrogen bonding requires a molecule containing a large atom. IV Hydrogen bonding...

chemistry help?!
so is it d ?

chemistry help?!
Which statement correctly pairs the order of a reaction with the units for the rate constant? A. third order; s/M B. zero order; 1/(M2) C. second order; 1/(M•s) D. first order; 1/M

chemistry help?!
Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the reactants D. The rate ...

Steve help please?!?!
How many moles of oxygen are produced from the decomposition of 36.7 g of dinitrogen pentoxide? 2N2O5 4NO2 + O2 A. 3.19 mol B. 0.340 mol C. 0.170 mol D. 5.44 mol Hi Steve, I posted this question the other day but really don't know how to answer it. Can you walk me through ...

Which of the following terms are present in the rate law? A. The rate constant, the concentration of the reactants, and the order of the reactants B. The rate constant and the concentration of the reactants C. The rate constant and the temperature of the reactants D. The rate ...

Science - Chemistry
If the rate law of a chemical reaction is k[NH4+]2[NO2–], what is the order of the reaction? 1. The order of the reaction cannot be determined. 2. 3 3. 1 4. 2

So that would be answer A correct?

During which stroke of a four-stroke internal combustion engine is the system's temperature raised because work is done to the gases? A. Compression stroke B. Power stroke C. Exhaust stroke D. Intake stroke

_____________ are a type of intermolecular force that _____________ . A. London forces; occur between permanent dipoles B. London forces; are the attractive forces between all molecules due to instantaneous dipoles C. Hydrogen bonds; are weaker than dipole-dipole forces D. ...

I don't know. Please help me figure it out!!

How many moles of oxygen are produced from the decomposition of 36.7 g of dinitrogen pentoxide? 2N2O5 4NO2 + O2

What are the zeroes of the polynomial equation, 𝑦 = 𝑥3 + 3𝑥2

An antifreeze solution is prepared containing 40.0 g of ethylene glycol (molar mass = 62.0 g/mol) in 60.0 g of water. Calculate the freezing point of this solutions A.-20.1°C B.0.518°C C.20.1°C D.120.1°C

what is 875 multiplied by 3/2?

World History
Winning which World War II battle allowed the Allied forces to protect strategic locations for trade and resources in the Mediterranean region? Battle of El Alamein**** Battle of Stalingrad Battle of Britain Battle of Midway

How many grams of sodium sulfate na2so4 must be added to make 500ml of a 12.5 M sodium sulfate solution

English II
Is it A?

English II
From the three windows, through the cracks of the old wooden shutters, came only a few scattered sunbeams which, in the midst of the obscurity, made a soft brightness that bathed surrounding objects in a diffused and tender light. Which word, if substituted for "diffused&...

English II
I think its A

English II
Standing before the press which faced the windows, Dr. Pascal was looking for a paper that he had come in search of. With doors wide open, this immense press of carved oak, adorned with strong and handsome mountings of metal, dating from the last century, displayed within its ...

English II
Okay, I was leaning more towards A. Thank you!

English II
Marc Antony's Speech from Shakespeare's Julius Caesar Friends, Romans, countrymen, lend me your ears; I come to bury Caesar, not to praise him. The evil that men do lives after them; The good is oft interred with their bones; So let it be with Caesar. The noble Brutus ...

English II
Thank you!

English II
Friends, Romans, countrymen, lend me your ears; I come to bury Caesar, not to praise him. The evil that men do lives after them; The good is oft interred with their bones; So let it be with Caesar. The noble Brutus Hath told you Caesar was ambitious: If it were so, it was a ...

English II
@Mrs. Sue?

  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. Next>>

Post a New Question