chemistry
A(g)+ B(g) <---> C(g) + D(g) Kc= 144. If .4 mol of A and B are placed in a 2 Liter container, what will be the concentration of C at equilibrium? I said the concentration of A= .2 because (.4/2=.2) and because 1 mol of A = 1 mol of C, the concentration of C also = .2 But...
chemistry
what is the pH of a solution that is .15 M in HOCl and .25 M NaOCl after .05 mol HCl/L has been bubbled into the solution? this is what I did: HOCl + H2O ----> H3O+ + OCl- .15 .25 -.05 +.05 --------------------------- .1 .30 3.5E-8=[H3O][.3]/[.1] H3O= 1.167E-8 pH= -log(1.67...
chemistry
thanks!!!
chemistry
Calculate the value of [H3O+] in a 0.01 M HOBr solution. Ka = 2.5E-9 I'm having a problem with just writing the equilibrium expression. do you add H2O to the HOBr? HOBr + H2O <---> H3O+ + OBr- but then you could say that because HOBr = .01 M, then 0Br- = .01 M, and H...
chemistry
The solubility of Fe(OH)2 is 3.00 10-3 g in 2.00 liters at 18°C. What is its Ksp at 18°C?
chemistry
How many grams of MgF2 will dissolve in 150. mL of 0.100 M NaF solution? Ksp for MgF2 = 6.4 x 10-9
chemistry
Calculate the ionization constant, Ka, of phenol (HC6H5O), a weak acid, if a 0.25 M solution of it has a pH of 5.24.
chemistry
The following system is at equilibrium with [N2O4] = 0.55 M and [NO2] = 0.25 M. If an additional 0.10 M NO2 is added to the reaction mixture with no change in volume, what will be the new equilibrium concentration of N2O4? N2O4(g) 2 NO2(g)
chemistry
What is the value of [OH-] in a 0.015 M CH3COOH solution? Ka = 1.8 x 10-5 I started by writing the equation: CH3COOH + H2O <---> H3O+ + CH3COO- Ka= [H3O+][CH3COO-]/[CH3COOH]= 1.8 E-5 ... Now what? I don't understand where OH relates to this ...
chemistry
If solid AgNO3 is slowly added to a solution that is .05 M in NaI and .12 M in NaCl, what is the concentration of I- when AgCl just begins the precipitate? Ksp for AgCl= 1.8 x 10^-10 Ksp for AgI= 1.5 x 10^-16
Pages: <<Prev | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | Next>>
For Further Reading
