Biomedical Ethics
Can there be individuals who deserve moral consideration even though they have no moral responsibilities? This question is confusing to me for some reason.
chemistry
Why does the compressed gas leaving the propane tank cause the temperature to drop around the valve?
Math
To convert a temperature in degrees Celsius to degrees Fahrenheit multiply the Celsius temperature by 9/5 and then add 32 F Is a temperature in degrees Celsius proportional to its equivalent temperature in degrees Fahrenheit.
math
Solve the equation: 1/x+3/x^2=-1
World geography
_______ is one of the first Latin American countries to have a separate ministry of tourism with dedicated funds within its federal governmental structure
physics
a spring is stretched 5*10^2m by a force of 5*10^-4N.a mass of 0.001kg is placed on the lower end of the spring.after equilibrium has been reached, the upper end of the spring is moved up and down so that the external force acting on the mass is given by F(t)=20coswt.calculate...
maths
a box contains 20 fuses ,out of which ,5 are defective.if a sample of 3 fuses is chosen from the box at random without replacement,find the probability that x fuses in this sample will be defective
maths
r1 and r2 are unit vectors in the x-y plane making angles a and b with the positive x-axis.by considering r1.r2 derive cos(a-b)=cos(a)cos(b)+sin(a)sin(b)
math
solve (4x^3y^3+1/x)dx+(3x^4y^2-1/y)dy=0
maths
d^2y/dx^2+4dy/dx+4y=4cosx+3sinx
Pages: 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | Next>>
For Further Reading