organic chem
Draw and name the amides that would be obtained by reaction of 3-ethylhexanoic? Also with the apropriate coupling reagent, and the following amines: A. ammonia B. methanamine C. N-methyl methanamine D. Aniline E. N-ethyl aniline
organic chem
which of following alcohols can be oxidized to be a carboxylic acid. Name the carboxylic acid produced. Those that cannot be oxidized to a carboxylic acid name the final product A. ethanol b. 2-propanol c. 1-propanol d. 3-pentanol
org. chem
what would the oxidation product 1. 2-methylpentnal 2. 3-pentanone My answers: 1. 2-methylpentanoic acid 2. no further reaction I just want to be sure I'm doing this right. Thanks.
organic chem
Write an equation representing the oxidation of each of the following. I'm on 3-hexanol. And this is what I got -> [o] 3-hexanal and further oxidation I know you get 3-hexananoic acid. I don't know how to make this in the line formula. Can I put the -OH and the doub...
organic chem
Which are enatiomers? optically active?identical? diastereomers? A.)...CH3 .....| ...H-C-Cl .....| .....Ch2Cl B.).....H .......| ...H3C-C-CH2CL .......| .......CL C.)...CH3 .......| ....CL-C-H ......| ......CH2CL D.)....CH2CL .........| ......CL-C-H .........| .........CH3 E.)...
org. chem
Draw the acetal obtanined from 1-propanol and benzaldehyde Draw the ketal obtained from 2-propanol and 3-methylcyclpentanone Can someone tell me where the actal/ketal comes from or do I just add it to the equation. Not sure how to start this. Thanks :)
org. chem
Can someone explain in simple terms the difference between hemiketal and hemiacetal? Just curious
organic chem
Draw the hemiketal obtained by addition of methanol to 3-methyl-2-hexanone This is what I got: 3-methyl-2-hexanone + CH3OH <-> CH3CH2CH(CH3)CH2C(OH)(CH3). But my answer is line angle formula because that's what the professor wants here's my line formula CH3 /\/\/...
org. chem
ok thank you thats what I got :)
org. chem
The question asks, "draw the hemiacetal obtained by addition of ethanol 2-methylpentanal" My question is how to do this problem? I know you can't actually draw it out on this site. However so I know how to do it on the upcoming test. Thanks :)
Pages: <<Prev | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | Next>>
For Further Reading
