math
If p is an odd prime, prove that (2/p)=(-1)^[(p^2-1)/8]
Chemistry
10, 122, 299, --> 162, 5, 122, 60, 60, 188
Chemistry
Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , p...
physics
A large balloon of mass 237 kg is filled with helium gas until its volume is 318 m3. Assume the density of air is 1.29 kg/m3 and the density of helium is 0.179 kg/m3. (b) Calculate the buoyant force acting on the balloon.________N (c) Find the net force on the balloon and dete...
calculus
a particle is moving counterclockwise around the circular path whose equation is x^2+y^2=100 of the abscissa of the particle is increasing by 72in/sec at a point where x=8 find the rate of changeof the cordinate(y) at this point
chemistry
If 92.75 mg of Na2CO3 is dissolved in 0.5mL of water, what would be the normality of the solution after the addition of 0.67 mL of water.
english
Baldwin uses many different writing techniques in the essay. Find instances of concrete description of a person of place, action reflection, and strong argumentative assertions. How do these techniques further his specific purposes?
Biology
In humans, W=widows peak while w=normal hair line and A=attached earlobes while a= unattached earlobes. A heterozygote in both traits reproduces with a similar heterozygote in both traits. What is the chance of any one child having the same genotype of the parents?
Macroeconomics
The graph has a SRAS going up from GDP 13.7 and 110 price level GDP 14.0 and 120 price level GDP 14.2 and 130 price level
Macroeconomics
Cannot attach graph! a. If the actual price level exceeds the expected price level reflected in long-term contracts, real GDP equals _______ and the actual price level equals _______ in the short run. b. The situation described in part (a) results in a(n) _______ gap equal to ...
Pages: <<Prev | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | Next>>
For Further Reading
