When CuCl2 and NH4OH are combined what is the product formed?
CuCl2+2NH4OH=2NH4Cl+Cu(OH)2
To determine the product formed when CuCl2 (copper(II) chloride) and NH4OH (ammonium hydroxide) are combined, we need to consider the reaction between the two compounds.
CuCl2 is a compound that contains copper (Cu) in the +2 oxidation state and chloride ions (Cl-). NH4OH is a compound that contains ammonium ions (NH4+) and hydroxide ions (OH-).
The reaction between CuCl2 and NH4OH can be written as follows:
CuCl2 + 2NH4OH -> Cu(OH)2 + 2NH4Cl
In this reaction, copper(II) chloride reacts with ammonium hydroxide to form copper(II) hydroxide and ammonium chloride.
So, when CuCl2 and NH4OH are combined, the product formed is Cu(OH)2 (copper(II) hydroxide) and NH4Cl (ammonium chloride).
It's worth noting that copper(II) hydroxide is a blue precipitate that may appear upon the reaction, while ammonium chloride remains in solution.