Please write the balanced chemical equation for reaction the following chemical reaction
ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O
When balancing the equation , please use the molecular formula of the organic compound
3C12H22 + 35 O3 ==> 36CO2 + 33H2O
To write the balanced chemical equation for the given reaction between ozone gas (O3) and 3,3,4,4,5,5-hexanmethyl-1-hexyne (H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3) to produce carbon dioxide gas (CO2) and water gas (H2O), follow these steps:
Step 1: Write the unbalanced equation.
O3 + H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 → CO2 + H2O
Step 2: Calculate the number of individual atoms on each side of the equation.
On the left side:
- Ozone gas (O3) has 3 oxygen atoms.
- There are no carbon or hydrogen atoms.
On the right side:
- Carbon dioxide gas (CO2) has 1 carbon and 2 oxygen atoms.
- Water gas (H2O) has 2 hydrogen and 1 oxygen atom.
Step 3: Balance the equation by adjusting the coefficients.
To balance the equation, start by balancing atoms that appear in only one compound on each side. In this case, we will balance the carbon atoms first:
O3 + H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 → 3CO2 + H2O
Now, let's balance the hydrogen atoms:
O3 + H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 → 3CO2 + 6H2O
Lastly, balance the oxygen atoms:
O3 + H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 → 3CO2 + 6H2O
The balanced equation is:
O3 + H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 → 3CO2 + 6H2O
Note: Balancing organic compounds in chemical equations often requires using the molecular formula to determine the number of atoms for each element.