Monday
April 21, 2014

Homework Help: Chemistry

Posted by Amanda on Thursday, November 8, 2012 at 7:32pm.

Please write the balanced chemical equation for reaction the following chemical reaction

ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O

When balancing the equation , please use the molecular formula of the organic compound

Answer this Question

First Name:
School Subject:
Answer:

Related Questions

Chemistry - please help - 1. Write the balanced chemical equation for the single...
Chem 3A - please help me with this chemistry problem. 1) Write out a balanced ...
chem help - i just don't know where to begin/how a) Write a balanced chemical ...
chemistry - Write a balanced chemical equation for the reaction that occurs when...
chemistry - Write a balanced chemical equation for the reaction that occurs when...
Chemistry - Write the balanced chemical equation for the decomposition of sodium...
chemistry - Write a balanced chemical equation for the reaction that occurs when...
Chemistry - What type of reaction may be occurring when a person's skin develops...
Chemistry - A solution is made by mixing NaOH and HNO3. Write a balanced ...
Chemistry - write the balanced chemical equation for reaction the following ...

Search
Members