write the balanced chemical equation for reaction the following chemical reaction
ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O .
When balancing the equation , use the molecular formula of the organic compound
I am not sure how to write the initial equation:
O3 + ?? --> CO2 + H20
For the ?? in your equation, substitute the formula you have in the problem. Then it's just a matter of balancing it.
To write the balanced chemical equation for the given reaction between ozone gas (O3) and 3,3,4,4,5,5-hexamethyl-1-hexyne (H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3) producing carbon dioxide gas (CO2) and water gas (H2O), we need to first identify the number of each element present in each compound.
The molecular formula of ozone gas is O3, meaning one molecule of ozone contains three oxygen atoms.
The molecular formula of 3,3,4,4,5,5-hexamethyl-1-hexyne is C10H18, indicating ten carbon atoms and eighteen hydrogen atoms.
The molecular formula of carbon dioxide gas is CO2, meaning one molecule of carbon dioxide contains one carbon atom and two oxygen atoms.
The molecular formula of water gas is H2O, indicating two hydrogen atoms and one oxygen atom per molecule.
Now, let's assume the balanced chemical equation as follows:
O3 + C10H18 → CO2 + H2O
To balance the equation, we need to ensure that the number of atoms of each element is the same on both sides.
1. Balancing carbon (C) atoms:
On the left side, there are 10 carbon atoms in C10H18, while on the right side, there is only 1 carbon atom in CO2. To balance the carbon atoms, coefficient 10 is placed in front of CO2.
O3 + C10H18 → 10CO2 + H2O
2. Balancing hydrogen (H) atoms:
On the left side, there are 18 hydrogen atoms in C10H18, while on the right side, there are 2 hydrogen atoms in H2O. To balance the hydrogen atoms, coefficient 9 is placed in front of H2O.
O3 + C10H18 → 10CO2 + 9H2O
3. Balancing oxygen (O) atoms:
On the left side, there are 3 oxygen atoms in O3, while on the right side, there are 20 oxygen atoms in 10CO2 and 9H2O. To balance the oxygen atoms, coefficient 10 is placed in front of O3.
10O3 + C10H18 → 10CO2 + 9H2O
The balanced chemical equation for the given reaction is:
10O3 + C10H18 → 10CO2 + 9H2O