how do you find how many hydrogens there would be in 2,5,6 trimethylnonane?
count them.
CH3CH(CH3)CH2CH2CH(CH3)CH(CH3)CH2CH2CH3
thank you i figured out how to do it right before you posted this :)
To find the number of hydrogens in a molecule, you need to know its molecular formula. In this case, the molecular formula for 2,5,6-trimethylnonane is C₉H₂₀. Let me break down how to determine the number of hydrogens step-by-step:
1. Start by identifying the number of carbon atoms in the molecule. In this case, there are nine carbon atoms (C₉).
2. Count the number of hydrogen atoms attached to each carbon atom. In an alkane molecule like 2,5,6-trimethylnonane, each carbon atom has four single bonds. Since hydrogen forms one single bond, each carbon atom is bonded to two hydrogen atoms.
3. Multiply the number of carbon atoms (C₉) by the number of hydrogen atoms attached to each carbon atom (2).
9 carbon atoms × 2 hydrogen atoms = 18 hydrogen atoms
Therefore, in 2,5,6-trimethylnonane, there are 18 hydrogen atoms.